├── iosApp ├── Configuration │ └── Config.xcconfig ├── iosApp │ ├── Assets.xcassets │ │ ├── Contents.json │ │ ├── AppIcon.appiconset │ │ │ ├── app-icon-1024.png │ │ │ └── Contents.json │ │ └── AccentColor.colorset │ │ │ └── Contents.json │ ├── Preview Content │ │ └── Preview Assets.xcassets │ │ │ └── Contents.json │ ├── iOSApp.swift │ ├── ContentView.swift │ └── Info.plist └── iosApp.xcodeproj │ └── project.pbxproj ├── composeApp ├── src │ ├── androidMain │ │ ├── res │ │ │ ├── values │ │ │ │ └── strings.xml │ │ │ ├── mipmap-hdpi │ │ │ │ ├── ic_launcher.png │ │ │ │ └── ic_launcher_round.png │ │ │ ├── mipmap-mdpi │ │ │ │ ├── ic_launcher.png │ │ │ │ └── ic_launcher_round.png │ │ │ ├── mipmap-xhdpi │ │ │ │ ├── ic_launcher.png │ │ │ │ └── ic_launcher_round.png │ │ │ ├── mipmap-xxhdpi │ │ │ │ ├── ic_launcher.png │ │ │ │ └── ic_launcher_round.png │ │ │ ├── mipmap-xxxhdpi │ │ │ │ ├── ic_launcher.png │ │ │ │ └── ic_launcher_round.png │ │ │ ├── mipmap-anydpi-v26 │ │ │ │ ├── ic_launcher.xml │ │ │ │ └── ic_launcher_round.xml │ │ │ ├── drawable-v24 │ │ │ │ └── ic_launcher_foreground.xml │ │ │ └── drawable │ │ │ │ └── ic_launcher_background.xml │ │ ├── kotlin │ │ │ ├── Platform.android.kt │ │ │ └── org │ │ │ │ └── faroukabichou │ │ │ │ └── kustomize │ │ │ │ └── MainActivity.kt │ │ └── AndroidManifest.xml │ ├── commonMain │ │ ├── kotlin │ │ │ ├── Platform.kt │ │ │ ├── Greeting.kt │ │ │ ├── App.kt │ │ │ ├── Comet.kt │ │ │ └── Compose svg test.kt │ │ └── composeResources │ │ │ ├── font │ │ │ └── font_certs.xml │ │ │ └── drawable │ │ │ ├── compose-multiplatform.xml │ │ │ ├── testt.svg │ │ │ └── comet.svg │ ├── wasmJsMain │ │ ├── resources │ │ │ ├── styles.css │ │ │ └── index.html │ │ └── kotlin │ │ │ ├── Platform.wasmJs.kt │ │ │ └── main.kt │ ├── iosMain │ │ └── kotlin │ │ │ ├── MainViewController.kt │ │ │ └── Platform.ios.kt │ └── desktopMain │ │ └── kotlin │ │ ├── Platform.jvm.kt │ │ └── main.kt └── build.gradle.kts ├── gradle ├── wrapper │ ├── gradle-wrapper.jar │ └── gradle-wrapper.properties └── libs.versions.toml ├── .idea ├── vcs.xml ├── compiler.xml ├── .gitignore ├── deploymentTargetDropDown.xml ├── artifacts │ ├── composeApp_desktop.xml │ └── composeApp_wasm_js.xml ├── misc.xml └── gradle.xml ├── gradle.properties ├── local.properties ├── .gitignore ├── settings.gradle.kts ├── README.md ├── gradlew.bat └── gradlew /iosApp/Configuration/Config.xcconfig: -------------------------------------------------------------------------------- 1 | TEAM_ID= 2 | BUNDLE_ID=org.faroukabichou.kustomize.Kustomize 3 | APP_NAME=Kustomize -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/values/strings.xml: -------------------------------------------------------------------------------- 1 | 2 | Kustomize 3 | -------------------------------------------------------------------------------- /gradle/wrapper/gradle-wrapper.jar: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/gradle/wrapper/gradle-wrapper.jar -------------------------------------------------------------------------------- /iosApp/iosApp/Assets.xcassets/Contents.json: -------------------------------------------------------------------------------- 1 | { 2 | "info" : { 3 | "author" : "xcode", 4 | "version" : 1 5 | } 6 | } -------------------------------------------------------------------------------- /composeApp/src/commonMain/kotlin/Platform.kt: -------------------------------------------------------------------------------- 1 | interface Platform { 2 | val name: String 3 | } 4 | 5 | expect fun getPlatform(): Platform -------------------------------------------------------------------------------- /iosApp/iosApp/Preview Content/Preview Assets.xcassets/Contents.json: -------------------------------------------------------------------------------- 1 | { 2 | "info" : { 3 | "author" : "xcode", 4 | "version" : 1 5 | } 6 | } -------------------------------------------------------------------------------- /composeApp/src/wasmJsMain/resources/styles.css: -------------------------------------------------------------------------------- 1 | html, body { 2 | width: 100%; 3 | height: 100%; 4 | margin: 0; 5 | padding: 0; 6 | overflow: hidden; 7 | } -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher.png -------------------------------------------------------------------------------- /composeApp/src/iosMain/kotlin/MainViewController.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.ui.window.ComposeUIViewController 2 | 3 | fun MainViewController() = ComposeUIViewController { App() } -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher_round.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher_round.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher_round.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher_round.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher_round.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher_round.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher_round.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher_round.png -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher_round.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher_round.png -------------------------------------------------------------------------------- /iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/app-icon-1024.png: -------------------------------------------------------------------------------- https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/app-icon-1024.png -------------------------------------------------------------------------------- /.idea/vcs.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/kotlin/Greeting.kt: -------------------------------------------------------------------------------- 1 | class Greeting { 2 | private val platform = getPlatform() 3 | 4 | fun greet(): String { 5 | return "Hello, ${platform.name}!" 6 | } 7 | } -------------------------------------------------------------------------------- /.idea/compiler.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | -------------------------------------------------------------------------------- /composeApp/src/wasmJsMain/kotlin/Platform.wasmJs.kt: -------------------------------------------------------------------------------- 1 | class WasmPlatform: Platform { 2 | override val name: String = "Web with Kotlin/Wasm" 3 | } 4 | 5 | actual fun getPlatform(): Platform = WasmPlatform() -------------------------------------------------------------------------------- /iosApp/iosApp/iOSApp.swift: -------------------------------------------------------------------------------- 1 | import SwiftUI 2 | 3 | @main 4 | struct iOSApp: App { 5 | var body: some Scene { 6 | WindowGroup { 7 | ContentView() 8 | } 9 | } 10 | } -------------------------------------------------------------------------------- /.idea/.gitignore: -------------------------------------------------------------------------------- 1 | # Default ignored files 2 | /shelf/ 3 | /workspace.xml 4 | # Editor-based HTTP Client requests 5 | /httpRequests/ 6 | # Datasource local storage ignored files 7 | /dataSources/ 8 | /dataSources.local.xml 9 | -------------------------------------------------------------------------------- /composeApp/src/desktopMain/kotlin/Platform.jvm.kt: -------------------------------------------------------------------------------- 1 | class JVMPlatform: Platform { 2 | override val name: String = "Java ${System.getProperty("java.version")}" 3 | } 4 | 5 | actual fun getPlatform(): Platform = JVMPlatform() -------------------------------------------------------------------------------- /iosApp/iosApp/Assets.xcassets/AccentColor.colorset/Contents.json: -------------------------------------------------------------------------------- 1 | { 2 | "colors" : [ 3 | { 4 | "idiom" : "universal" 5 | } 6 | ], 7 | "info" : { 8 | "author" : "xcode", 9 | "version" : 1 10 | } 11 | } -------------------------------------------------------------------------------- /composeApp/src/androidMain/kotlin/Platform.android.kt: -------------------------------------------------------------------------------- 1 | import android.os.Build 2 | 3 | class AndroidPlatform : Platform { 4 | override val name: String = "Android ${Build.VERSION.SDK_INT}" 5 | } 6 | 7 | actual fun getPlatform(): Platform = AndroidPlatform() -------------------------------------------------------------------------------- /composeApp/src/iosMain/kotlin/Platform.ios.kt: -------------------------------------------------------------------------------- 1 | import platform.UIKit.UIDevice 2 | 3 | class IOSPlatform: Platform { 4 | override val name: String = UIDevice.currentDevice.systemName() + " " + UIDevice.currentDevice.systemVersion 5 | } 6 | 7 | actual fun getPlatform(): Platform = IOSPlatform() -------------------------------------------------------------------------------- /.idea/deploymentTargetDropDown.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | -------------------------------------------------------------------------------- /gradle/wrapper/gradle-wrapper.properties: -------------------------------------------------------------------------------- 1 | distributionBase=GRADLE_USER_HOME 2 | distributionPath=wrapper/dists 3 | distributionUrl=https\://services.gradle.org/distributions/gradle-8.7-bin.zip 4 | networkTimeout=10000 5 | validateDistributionUrl=true 6 | zipStoreBase=GRADLE_USER_HOME 7 | zipStorePath=wrapper/dists 8 | -------------------------------------------------------------------------------- /composeApp/src/desktopMain/kotlin/main.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.ui.window.Window 2 | import androidx.compose.ui.window.application 3 | 4 | fun main() = application { 5 | Window( 6 | onCloseRequest = ::exitApplication, 7 | title = "Kustomize", 8 | ) { 9 | App() 10 | } 11 | } -------------------------------------------------------------------------------- /gradle.properties: -------------------------------------------------------------------------------- 1 | kotlin.code.style=official 2 | 3 | #Gradle 4 | org.gradle.jvmargs=-Xmx2048M -Dfile.encoding=UTF-8 -Dkotlin.daemon.jvm.options\="-Xmx2048M" 5 | 6 | #Android 7 | android.nonTransitiveRClass=true 8 | android.useAndroidX=true 9 | 10 | #Kotlin Multiplatform 11 | kotlin.mpp.enableCInteropCommonization=true -------------------------------------------------------------------------------- /local.properties: -------------------------------------------------------------------------------- 1 | ## This file must *NOT* be checked into Version Control Systems, 2 | # as it contains information specific to your local configuration. 3 | # 4 | # Location of the SDK. This is only used by Gradle. 5 | # For customization when using a Version Control System, please read the 6 | # header note. 7 | 8 | sdk.dir= 9 | -------------------------------------------------------------------------------- /composeApp/src/wasmJsMain/kotlin/main.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.ui.ExperimentalComposeUiApi 2 | import androidx.compose.ui.window.ComposeViewport 3 | import kotlinx.browser.document 4 | 5 | @OptIn(ExperimentalComposeUiApi::class) 6 | fun main() { 7 | ComposeViewport(document.body!!) { 8 | App() 9 | } 10 | } -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-anydpi-v26/ic_launcher.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | -------------------------------------------------------------------------------- /iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/Contents.json: -------------------------------------------------------------------------------- 1 | { 2 | "images" : [ 3 | { 4 | "filename" : "app-icon-1024.png", 5 | "idiom" : "universal", 6 | "platform" : "ios", 7 | "size" : "1024x1024" 8 | } 9 | ], 10 | "info" : { 11 | "author" : "xcode", 12 | "version" : 1 13 | } 14 | } 15 | -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/mipmap-anydpi-v26/ic_launcher_round.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | -------------------------------------------------------------------------------- /.idea/artifacts/composeApp_desktop.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | $PROJECT_DIR$/composeApp/build/libs 4 | 5 | 6 | 7 | 8 | -------------------------------------------------------------------------------- /.idea/artifacts/composeApp_wasm_js.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | $PROJECT_DIR$/composeApp/build/libs 4 | 5 | 6 | 7 | 8 | -------------------------------------------------------------------------------- /composeApp/src/wasmJsMain/resources/index.html: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | Kustomize 7 | 8 | 9 | 10 | 11 | 12 | -------------------------------------------------------------------------------- /.idea/misc.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | -------------------------------------------------------------------------------- /iosApp/iosApp/ContentView.swift: -------------------------------------------------------------------------------- 1 | import UIKit 2 | import SwiftUI 3 | import ComposeApp 4 | 5 | struct ComposeView: UIViewControllerRepresentable { 6 | func makeUIViewController(context: Context) -> UIViewController { 7 | MainViewControllerKt.MainViewController() 8 | } 9 | 10 | func updateUIViewController(_ uiViewController: UIViewController, context: Context) {} 11 | } 12 | 13 | struct ContentView: View { 14 | var body: some View { 15 | ComposeView() 16 | .ignoresSafeArea(.keyboard) // Compose has own keyboard handler 17 | } 18 | } 19 | 20 | 21 | 22 | -------------------------------------------------------------------------------- /.idea/gradle.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 16 | 17 | -------------------------------------------------------------------------------- /.gitignore: -------------------------------------------------------------------------------- 1 | .gradle 2 | build/ 3 | !gradle/wrapper/gradle-wrapper.jar 4 | !**/src/main/**/build/ 5 | !**/src/test/**/build/ 6 | 7 | ### IntelliJ IDEA ### 8 | .idea/modules.xml 9 | .idea/jarRepositories.xml 10 | .idea/compiler.xml 11 | .idea/libraries/ 12 | *.iws 13 | *.iml 14 | *.ipr 15 | out/ 16 | !**/src/main/**/out/ 17 | !**/src/test/**/out/ 18 | 19 | ### Eclipse ### 20 | .apt_generated 21 | .classpath 22 | .factorypath 23 | .project 24 | .settings 25 | .springBeans 26 | .sts4-cache 27 | bin/ 28 | !**/src/main/**/bin/ 29 | !**/src/test/**/bin/ 30 | 31 | ### NetBeans ### 32 | /nbproject/private/ 33 | /nbbuild/ 34 | /dist/ 35 | /nbdist/ 36 | /.nb-gradle/ 37 | 38 | ### VS Code ### 39 | .vscode/ 40 | 41 | ### Mac OS ### 42 | .DS_Store -------------------------------------------------------------------------------- /settings.gradle.kts: -------------------------------------------------------------------------------- 1 | rootProject.name = "Kustomize" 2 | enableFeaturePreview("TYPESAFE_PROJECT_ACCESSORS") 3 | 4 | pluginManagement { 5 | repositories { 6 | google { 7 | mavenContent { 8 | includeGroupAndSubgroups("androidx") 9 | includeGroupAndSubgroups("com.android") 10 | includeGroupAndSubgroups("com.google") 11 | } 12 | } 13 | mavenCentral() 14 | gradlePluginPortal() 15 | } 16 | } 17 | 18 | dependencyResolutionManagement { 19 | repositories { 20 | google { 21 | mavenContent { 22 | includeGroupAndSubgroups("androidx") 23 | includeGroupAndSubgroups("com.android") 24 | includeGroupAndSubgroups("com.google") 25 | } 26 | } 27 | mavenCentral() 28 | } 29 | } 30 | 31 | include(":composeApp") -------------------------------------------------------------------------------- /README.md: -------------------------------------------------------------------------------- 1 | # Kustomize 2 | 3 | Kustomize is a Kotlin Multiplatform project designed as a proof of concept. It showcases how users can customize their user experience by selecting their favorite colors, fonts, and themes. This project aims to demonstrate the potential for user personalization in applications, providing a simple and intuitive interface for making customizations. 4 | 5 | ## Description 6 | 7 | Kustomize allows users to tailor their application's look and feel according to their preferences. By choosing from a variety of colors, fonts, and themes, users can create a personalized experience that suits their tastes. The project leverages Kotlin's multiplatform capabilities to ensure compatibility across different platforms, providing a seamless customization experience. 8 | 9 | ## Links 10 | 11 | - [Design on Figma](https://www.figma.com/community/file/1386770518155212936/kustomize) 12 | 13 | Feel free to explore the design and use it to create your own customized user experiences! 14 | -------------------------------------------------------------------------------- /composeApp/src/androidMain/AndroidManifest.xml: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 11 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/kotlin/App.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.foundation.Image 2 | import androidx.compose.foundation.background 3 | import androidx.compose.foundation.layout.Box 4 | import androidx.compose.foundation.layout.fillMaxSize 5 | import androidx.compose.runtime.Composable 6 | import androidx.compose.ui.Modifier 7 | import androidx.compose.ui.graphics.Color 8 | import androidx.compose.ui.graphics.ImageBitmap 9 | import kustomize.composeapp.generated.resources.Res 10 | import kustomize.composeapp.generated.resources.comet 11 | import kustomize.composeapp.generated.resources.compose_multiplatform 12 | import kustomize.composeapp.generated.resources.testt 13 | import org.jetbrains.compose.resources.imageResource 14 | import org.jetbrains.compose.resources.painterResource 15 | import org.jetbrains.compose.ui.tooling.preview.Preview 16 | 17 | 18 | @Composable 19 | @Preview 20 | fun App( 21 | // typography: androidx.compose.material.Typography 22 | ) { 23 | Box( 24 | modifier = Modifier 25 | .fillMaxSize() 26 | .background(color = Color(0xff292A30)), 27 | contentAlignment = androidx.compose.ui.Alignment.Center 28 | ){ 29 | Image(painterResource(Res.drawable.testt), null) 30 | 31 | } 32 | // MaterialTheme( 33 | //// typography = typography, 34 | // ) { 35 | // 36 | // } 37 | } -------------------------------------------------------------------------------- /iosApp/iosApp/Info.plist: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | CFBundleDevelopmentRegion 6 | $(DEVELOPMENT_LANGUAGE) 7 | CFBundleExecutable 8 | $(EXECUTABLE_NAME) 9 | CFBundleIdentifier 10 | $(PRODUCT_BUNDLE_IDENTIFIER) 11 | CFBundleInfoDictionaryVersion 12 | 6.0 13 | CFBundleName 14 | $(PRODUCT_NAME) 15 | CFBundlePackageType 16 | $(PRODUCT_BUNDLE_PACKAGE_TYPE) 17 | CFBundleShortVersionString 18 | 1.0 19 | CFBundleVersion 20 | 1 21 | LSRequiresIPhoneOS 22 | 23 | CADisableMinimumFrameDurationOnPhone 24 | 25 | UIApplicationSceneManifest 26 | 27 | UIApplicationSupportsMultipleScenes 28 | 29 | 30 | UILaunchScreen 31 | 32 | UIRequiredDeviceCapabilities 33 | 34 | armv7 35 | 36 | UISupportedInterfaceOrientations 37 | 38 | UIInterfaceOrientationPortrait 39 | UIInterfaceOrientationLandscapeLeft 40 | UIInterfaceOrientationLandscapeRight 41 | 42 | UISupportedInterfaceOrientations~ipad 43 | 44 | UIInterfaceOrientationPortrait 45 | UIInterfaceOrientationPortraitUpsideDown 46 | UIInterfaceOrientationLandscapeLeft 47 | UIInterfaceOrientationLandscapeRight 48 | 49 | 50 | 51 | -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/drawable-v24/ic_launcher_foreground.xml: -------------------------------------------------------------------------------- 1 | 7 | 8 | 9 | 15 | 18 | 21 | 22 | 23 | 24 | 30 | -------------------------------------------------------------------------------- /gradle/libs.versions.toml: -------------------------------------------------------------------------------- 1 | [versions] 2 | agp = "8.2.0" 3 | android-compileSdk = "34" 4 | android-minSdk = "24" 5 | android-targetSdk = "34" 6 | androidx-activityCompose = "1.9.0" 7 | androidx-appcompat = "1.6.1" 8 | androidx-constraintlayout = "2.1.4" 9 | androidx-core-ktx = "1.13.1" 10 | androidx-espresso-core = "3.5.1" 11 | androidx-material = "1.12.0" 12 | androidx-test-junit = "1.1.5" 13 | compose-plugin = "1.6.10" 14 | junit = "4.13.2" 15 | kotlin = "2.0.0" 16 | firebaseCrashlyticsBuildtools = "3.0.2" 17 | 18 | [libraries] 19 | kotlin-test = { module = "org.jetbrains.kotlin:kotlin-test", version.ref = "kotlin" } 20 | kotlin-test-junit = { module = "org.jetbrains.kotlin:kotlin-test-junit", version.ref = "kotlin" } 21 | junit = { group = "junit", name = "junit", version.ref = "junit" } 22 | androidx-core-ktx = { group = "androidx.core", name = "core-ktx", version.ref = "androidx-core-ktx" } 23 | androidx-test-junit = { group = "androidx.test.ext", name = "junit", version.ref = "androidx-test-junit" } 24 | androidx-espresso-core = { group = "androidx.test.espresso", name = "espresso-core", version.ref = "androidx-espresso-core" } 25 | androidx-appcompat = { group = "androidx.appcompat", name = "appcompat", version.ref = "androidx-appcompat" } 26 | androidx-material = { group = "com.google.android.material", name = "material", version.ref = "androidx-material" } 27 | androidx-constraintlayout = { group = "androidx.constraintlayout", name = "constraintlayout", version.ref = "androidx-constraintlayout" } 28 | androidx-activity-compose = { module = "androidx.activity:activity-compose", version.ref = "androidx-activityCompose" } 29 | firebase-crashlytics-buildtools = { group = "com.google.firebase", name = "firebase-crashlytics-buildtools", version.ref = "firebaseCrashlyticsBuildtools" } 30 | 31 | [plugins] 32 | androidApplication = { id = "com.android.application", version.ref = "agp" } 33 | androidLibrary = { id = "com.android.library", version.ref = "agp" } 34 | jetbrainsCompose = { id = "org.jetbrains.compose", version.ref = "compose-plugin" } 35 | compose-compiler = { id = "org.jetbrains.kotlin.plugin.compose", version.ref = "kotlin" } 36 | kotlinMultiplatform = { id = "org.jetbrains.kotlin.multiplatform", version.ref = "kotlin" } -------------------------------------------------------------------------------- /gradlew.bat: -------------------------------------------------------------------------------- 1 | @rem 2 | @rem Copyright 2015 the original author or authors. 3 | @rem 4 | @rem Licensed under the Apache License, Version 2.0 (the "License"); 5 | @rem you may not use this file except in compliance with the License. 6 | @rem You may obtain a copy of the License at 7 | @rem 8 | @rem https://www.apache.org/licenses/LICENSE-2.0 9 | @rem 10 | @rem Unless required by applicable law or agreed to in writing, software 11 | @rem distributed under the License is distributed on an "AS IS" BASIS, 12 | @rem WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. 13 | @rem See the License for the specific language governing permissions and 14 | @rem limitations under the License. 15 | @rem 16 | 17 | @if "%DEBUG%"=="" @echo off 18 | @rem ########################################################################## 19 | @rem 20 | @rem Gradle startup script for Windows 21 | @rem 22 | @rem ########################################################################## 23 | 24 | @rem Set local scope for the variables with windows NT shell 25 | if "%OS%"=="Windows_NT" setlocal 26 | 27 | set DIRNAME=%~dp0 28 | if "%DIRNAME%"=="" set DIRNAME=. 29 | @rem This is normally unused 30 | set APP_BASE_NAME=%~n0 31 | set APP_HOME=%DIRNAME% 32 | 33 | @rem Resolve any "." and ".." in APP_HOME to make it shorter. 34 | for %%i in ("%APP_HOME%") do set APP_HOME=%%~fi 35 | 36 | @rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script. 37 | set DEFAULT_JVM_OPTS="-Xmx64m" "-Xms64m" 38 | 39 | @rem Find java.exe 40 | if defined JAVA_HOME goto findJavaFromJavaHome 41 | 42 | set JAVA_EXE=java.exe 43 | %JAVA_EXE% -version >NUL 2>&1 44 | if %ERRORLEVEL% equ 0 goto execute 45 | 46 | echo. 47 | echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. 48 | echo. 49 | echo Please set the JAVA_HOME variable in your environment to match the 50 | echo location of your Java installation. 51 | 52 | goto fail 53 | 54 | :findJavaFromJavaHome 55 | set JAVA_HOME=%JAVA_HOME:"=% 56 | set JAVA_EXE=%JAVA_HOME%/bin/java.exe 57 | 58 | if exist "%JAVA_EXE%" goto execute 59 | 60 | echo. 61 | echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME% 62 | echo. 63 | echo Please set the JAVA_HOME variable in your environment to match the 64 | echo location of your Java installation. 65 | 66 | goto fail 67 | 68 | :execute 69 | @rem Setup the command line 70 | 71 | set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar 72 | 73 | 74 | @rem Execute Gradle 75 | "%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %* 76 | 77 | :end 78 | @rem End local scope for the variables with windows NT shell 79 | if %ERRORLEVEL% equ 0 goto mainEnd 80 | 81 | :fail 82 | rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of 83 | rem the _cmd.exe /c_ return code! 84 | set EXIT_CODE=%ERRORLEVEL% 85 | if %EXIT_CODE% equ 0 set EXIT_CODE=1 86 | if not ""=="%GRADLE_EXIT_CONSOLE%" exit %EXIT_CODE% 87 | exit /b %EXIT_CODE% 88 | 89 | :mainEnd 90 | if "%OS%"=="Windows_NT" endlocal 91 | 92 | :omega 93 | -------------------------------------------------------------------------------- /composeApp/src/androidMain/kotlin/org/faroukabichou/kustomize/MainActivity.kt: -------------------------------------------------------------------------------- 1 | package org.faroukabichou.kustomize 2 | 3 | import App 4 | import android.os.Bundle 5 | import android.util.Base64 6 | import androidx.activity.ComponentActivity 7 | import androidx.activity.compose.setContent 8 | import androidx.compose.ui.text.font.FontFamily 9 | import androidx.compose.ui.text.googlefonts.Font 10 | import androidx.compose.ui.text.googlefonts.GoogleFont 11 | 12 | class MainActivity : ComponentActivity() { 13 | override fun onCreate(savedInstanceState: Bundle?) { 14 | super.onCreate(savedInstanceState) 15 | 16 | val devCert = "MIIEqDCCA5CgAwIBAgIJANWFuGx90071MA0GCSqGSIb3DQEBBAUAMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTAeFw0wODA0MTUyMzM2NTZaFw0zNTA5MDEyMzM2NTZaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBANbOLggKv+IxTdGNs8/TGFy0PTP6DHThvbbR24kT9ixcOd9W+EaBPWW+wPPKQmsHxajtWjmQwWfna8mZuSeJS48LIgAZlKkpFeVyxW0qMBujb8X8ETrWy550NaFtI6t9+u7hZeTfHwqNvacKhp1RbE6dBRGWynwMVX8XW8N1+UjFaq6GCJukT4qmpN2afb8sCjUigq0GuMwYXrFVee74bQgLHWGJwPmvmLHC69EH6kWr22ijx4OKXlSIx2xT1AsSHee70w5iDBiK4aph27yH3TxkXy9V89TDdexAcKk/cVHYNnDBapcavl7y0RiQ4biu8ymM8Ga/nmzhRKya6G0cGw8CAQOjgfwwgfkwHQYDVR0OBBYEFI0cxb6VTEM8YYY6FbBMvAPyT+CyMIHJBgNVHSMEgcEwgb6AFI0cxb6VTEM8YYY6FbBMvAPyT+CyoYGapIGXMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbYIJANWFuGx90071MAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEEBQADggEBABnTDPEF+3iSP0wNfdIjIz1AlnrPzgAIHVvXxunW7SBrDhEglQZBbKJEk5kT0mtKoOD1JMrSu1xuTKEBahWRbqHsXclaXjoBADb0kkjVEJu/Lh5hgYZnOjvlba8Ld7HCKePCVePoTJBdI4fvugnL8TsgK05aIskyY0hKI9L8KfqfGTl1lzOv2KoWD0KWwtAWPoGChZxmQ+nBli+gwYMzM1vAkP+aayLe0a1EQimlOalO762r0GXO0ks+UeXde2Z4e+8S/pf7pITEI/tP+MxJTALw9QUWEv9lKTk+jkbqxbsh8nfBUapfKqYn0eidpwq2AzVp3juYl7//fKnaPhJD9gs=" 17 | val prodCert = "MIIEQzCCAyugAwIBAgIJAMLgh0ZkSjCNMA0GCSqGSIb3DQEBBAUAMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDAeFw0wODA4MjEyMzEzMzRaFw0zNjAxMDcyMzEzMzRaMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBAKtWLgDYO6IIrgqWbxJOKdoR8qtW0I9Y4sypEwPpt1TTcvZApxsdyxMJZ2JORland2qSGT2y5b" 18 | 19 | val devCertBytes = Base64.decode(devCert, Base64.DEFAULT) 20 | val prodCertBytes = Base64.decode(prodCert, Base64.DEFAULT) 21 | 22 | val certsList: List> = listOf( 23 | listOf(devCertBytes), 24 | listOf(prodCertBytes) 25 | ) 26 | val provider = GoogleFont.Provider( 27 | providerAuthority = "com.google.android.gms.fonts", 28 | providerPackage = "com.google.android.gms", 29 | certificates = certsList 30 | ) 31 | val fontName = GoogleFont("Lobster Two") 32 | val fontFamily = FontFamily( 33 | Font(googleFont = fontName, fontProvider = provider) 34 | ) 35 | setContent { 36 | App( 37 | typography = androidx.compose.material.Typography( 38 | defaultFontFamily = fontFamily 39 | ) 40 | ) 41 | } 42 | } 43 | } -------------------------------------------------------------------------------- /composeApp/src/commonMain/composeResources/font/font_certs.xml: -------------------------------------------------------------------------------- 1 | 2 | 17 | 18 | 19 | @array/com_google_android_gms_fonts_certs_dev 20 | @array/com_google_android_gms_fonts_certs_prod 21 | 22 | 23 | 24 | MIIEqDCCA5CgAwIBAgIJANWFuGx90071MA0GCSqGSIb3DQEBBAUAMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTAeFw0wODA0MTUyMzM2NTZaFw0zNTA5MDEyMzM2NTZaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBANbOLggKv+IxTdGNs8/TGFy0PTP6DHThvbbR24kT9ixcOd9W+EaBPWW+wPPKQmsHxajtWjmQwWfna8mZuSeJS48LIgAZlKkpFeVyxW0qMBujb8X8ETrWy550NaFtI6t9+u7hZeTfHwqNvacKhp1RbE6dBRGWynwMVX8XW8N1+UjFaq6GCJukT4qmpN2afb8sCjUigq0GuMwYXrFVee74bQgLHWGJwPmvmLHC69EH6kWr22ijx4OKXlSIx2xT1AsSHee70w5iDBiK4aph27yH3TxkXy9V89TDdexAcKk/cVHYNnDBapcavl7y0RiQ4biu8ymM8Ga/nmzhRKya6G0cGw8CAQOjgfwwgfkwHQYDVR0OBBYEFI0cxb6VTEM8YYY6FbBMvAPyT+CyMIHJBgNVHSMEgcEwgb6AFI0cxb6VTEM8YYY6FbBMvAPyT+CyoYGapIGXMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbYIJANWFuGx90071MAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEEBQADggEBABnTDPEF+3iSP0wNfdIjIz1AlnrPzgAIHVvXxunW7SBrDhEglQZBbKJEk5kT0mtKoOD1JMrSu1xuTKEBahWRbqHsXclaXjoBADb0kkjVEJu/Lh5hgYZnOjvlba8Ld7HCKePCVePoTJBdI4fvugnL8TsgK05aIskyY0hKI9L8KfqfGTl1lzOv2KoWD0KWwtAWPoGChZxmQ+nBli+gwYMzM1vAkP+aayLe0a1EQimlOalO762r0GXO0ks+UeXde2Z4e+8S/pf7pITEI/tP+MxJTALw9QUWEv9lKTk+jkbqxbsh8nfBUapfKqYn0eidpwq2AzVp3juYl7//fKnaPhJD9gs= 25 | 26 | 27 | 28 | 29 | MIIEQzCCAyugAwIBAgIJAMLgh0ZkSjCNMA0GCSqGSIb3DQEBBAUAMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDAeFw0wODA4MjEyMzEzMzRaFw0zNjAxMDcyMzEzMzRaMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBAKtWLgDYO6IIrgqWbxJOKdoR8qtW0I9Y4sypEwPpt1TTcvZApxsdyxMJZ2JORland2qSGT2y5b+3JKkedxiLDmpHpDsz2WCbdxgxRczfey5YZnTJ4VZbH0xqWVW/8lGmPav5xVwnIiJS6HXk+BVKZF+JcWjAsb/GEuq/eFdpuzSqeYTcfi6idkyugwfYwXFU1+5fZKUaRKYCwkkFQVfcAs1fXA5V+++FGfvjJ/CxURaSxaBvGdGDhfXE28LWuT9ozCl5xw4Yq5OGazvV24mZVSoOO0yZ31j7kYvtwYK6NeADwbSxDdJEqO4k//0zOHKrUiGYXtqw/A0LFFtqoZKFjnkCAQOjgdkwgdYwHQYDVR0OBBYEFMd9jMIhF1Ylmn/Tgt9r45jk14alMIGmBgNVHSMEgZ4wgZuAFMd9jMIhF1Ylmn/Tgt9r45jk14aloXikdjB0MQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLR29vZ2xlIEluYy4xEDAOBgNVBAsTB0FuZHJvaWQxEDAOBgNVBAMTB0FuZHJvaWSCCQDC4IdGZEowjTAMBgNVHRMEBTADAQH/MA0GCSqGSIb3DQEBBAUAA4IBAQBt0lLO74UwLDYKqs6Tm8/yzKkEu116FmH4rkaymUIE0P9KaMftGlMexFlaYjzmB2OxZyl6euNXEsQH8gjwyxCUKRJNexBiGcCEyj6z+a1fuHHvkiaai+KL8W1EyNmgjmyy8AW7P+LLlkR+ho5zEHatRbM/YAnqGcFh5iZBqpknHf1SKMXFh4dd239FJ1jWYfbMDMy3NS5CTMQ2XFI1MvcyUTdZPErjQfTbQe3aDQsQcafEQPD+nqActifKZ0Np0IS9L9kR/wbNvyz6ENwPiTrjV2KRkEjH78ZMcUQXg0L3BYHJ3lc69Vs5Ddf9uUGGMYldX3WfMBEmh/9iFBDAaTCK 30 | 31 | 32 | -------------------------------------------------------------------------------- /composeApp/build.gradle.kts: -------------------------------------------------------------------------------- 1 | import org.jetbrains.compose.desktop.application.dsl.TargetFormat 2 | import org.jetbrains.kotlin.gradle.ExperimentalKotlinGradlePluginApi 3 | import org.jetbrains.kotlin.gradle.dsl.JvmTarget 4 | import org.jetbrains.kotlin.gradle.targets.js.dsl.ExperimentalWasmDsl 5 | import org.jetbrains.kotlin.gradle.targets.js.webpack.KotlinWebpackConfig 6 | 7 | plugins { 8 | alias(libs.plugins.kotlinMultiplatform) 9 | alias(libs.plugins.androidApplication) 10 | alias(libs.plugins.jetbrainsCompose) 11 | alias(libs.plugins.compose.compiler) 12 | } 13 | 14 | kotlin { 15 | @OptIn(ExperimentalWasmDsl::class) 16 | wasmJs { 17 | moduleName = "composeApp" 18 | browser { 19 | commonWebpackConfig { 20 | outputFileName = "composeApp.js" 21 | devServer = (devServer ?: KotlinWebpackConfig.DevServer()).apply { 22 | static = (static ?: mutableListOf()).apply { 23 | // Serve sources to debug inside browser 24 | add(project.projectDir.path) 25 | } 26 | } 27 | } 28 | } 29 | binaries.executable() 30 | } 31 | 32 | androidTarget { 33 | @OptIn(ExperimentalKotlinGradlePluginApi::class) 34 | compilerOptions { 35 | jvmTarget.set(JvmTarget.JVM_11) 36 | } 37 | } 38 | 39 | jvm("desktop") 40 | 41 | listOf( 42 | iosX64(), 43 | iosArm64(), 44 | iosSimulatorArm64() 45 | ).forEach { iosTarget -> 46 | iosTarget.binaries.framework { 47 | baseName = "ComposeApp" 48 | isStatic = true 49 | } 50 | } 51 | 52 | sourceSets { 53 | val desktopMain by getting 54 | 55 | androidMain.dependencies { 56 | implementation(compose.preview) 57 | implementation(libs.androidx.activity.compose) 58 | implementation("androidx.compose.ui:ui-text-google-fonts:1.6.8") 59 | } 60 | commonMain.dependencies { 61 | implementation(compose.runtime) 62 | implementation(compose.foundation) 63 | implementation(compose.material) 64 | implementation(compose.ui) 65 | implementation(compose.components.resources) 66 | implementation(compose.components.uiToolingPreview) 67 | } 68 | desktopMain.dependencies { 69 | implementation(compose.desktop.currentOs) 70 | } 71 | } 72 | } 73 | 74 | android { 75 | namespace = "org.faroukabichou.kustomize" 76 | compileSdk = libs.versions.android.compileSdk.get().toInt() 77 | 78 | sourceSets["main"].manifest.srcFile("src/androidMain/AndroidManifest.xml") 79 | sourceSets["main"].res.srcDirs("src/androidMain/res") 80 | sourceSets["main"].resources.srcDirs("src/commonMain/resources") 81 | 82 | defaultConfig { 83 | applicationId = "org.faroukabichou.kustomize" 84 | minSdk = libs.versions.android.minSdk.get().toInt() 85 | targetSdk = libs.versions.android.targetSdk.get().toInt() 86 | versionCode = 1 87 | versionName = "1.0" 88 | } 89 | packaging { 90 | resources { 91 | excludes += "/META-INF/{AL2.0,LGPL2.1}" 92 | } 93 | } 94 | buildTypes { 95 | getByName("release") { 96 | isMinifyEnabled = false 97 | } 98 | } 99 | compileOptions { 100 | sourceCompatibility = JavaVersion.VERSION_11 101 | targetCompatibility = JavaVersion.VERSION_11 102 | } 103 | buildFeatures { 104 | compose = true 105 | } 106 | dependencies { 107 | debugImplementation(compose.uiTooling) 108 | } 109 | } 110 | dependencies { 111 | implementation(libs.firebase.crashlytics.buildtools) 112 | } 113 | 114 | compose.desktop { 115 | application { 116 | mainClass = "MainKt" 117 | 118 | nativeDistributions { 119 | targetFormats(TargetFormat.Dmg, TargetFormat.Msi, TargetFormat.Deb) 120 | packageName = "org.faroukabichou.kustomize" 121 | packageVersion = "1.0.0" 122 | } 123 | } 124 | } 125 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/composeResources/drawable/compose-multiplatform.xml: -------------------------------------------------------------------------------- 1 | 6 | 10 | 14 | 18 | 24 | 30 | 36 | -------------------------------------------------------------------------------- /composeApp/src/androidMain/res/drawable/ic_launcher_background.xml: -------------------------------------------------------------------------------- 1 | 2 | 7 | 10 | 15 | 20 | 25 | 30 | 35 | 40 | 45 | 50 | 55 | 60 | 65 | 70 | 75 | 80 | 85 | 90 | 95 | 100 | 105 | 110 | 115 | 120 | 125 | 130 | 135 | 140 | 145 | 150 | 155 | 160 | 165 | 170 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/composeResources/drawable/testt.svg: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | -------------------------------------------------------------------------------- /gradlew: -------------------------------------------------------------------------------- 1 | #!/bin/sh 2 | 3 | # 4 | # Copyright © 2015-2021 the original authors. 5 | # 6 | # Licensed under the Apache License, Version 2.0 (the "License"); 7 | # you may not use this file except in compliance with the License. 8 | # You may obtain a copy of the License at 9 | # 10 | # https://www.apache.org/licenses/LICENSE-2.0 11 | # 12 | # Unless required by applicable law or agreed to in writing, software 13 | # distributed under the License is distributed on an "AS IS" BASIS, 14 | # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. 15 | # See the License for the specific language governing permissions and 16 | # limitations under the License. 17 | # 18 | 19 | ############################################################################## 20 | # 21 | # Gradle start up script for POSIX generated by Gradle. 22 | # 23 | # Important for running: 24 | # 25 | # (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is 26 | # noncompliant, but you have some other compliant shell such as ksh or 27 | # bash, then to run this script, type that shell name before the whole 28 | # command line, like: 29 | # 30 | # ksh Gradle 31 | # 32 | # Busybox and similar reduced shells will NOT work, because this script 33 | # requires all of these POSIX shell features: 34 | # * functions; 35 | # * expansions «$var», «${var}», «${var:-default}», «${var+SET}», 36 | # «${var#prefix}», «${var%suffix}», and «$( cmd )»; 37 | # * compound commands having a testable exit status, especially «case»; 38 | # * various built-in commands including «command», «set», and «ulimit». 39 | # 40 | # Important for patching: 41 | # 42 | # (2) This script targets any POSIX shell, so it avoids extensions provided 43 | # by Bash, Ksh, etc; in particular arrays are avoided. 44 | # 45 | # The "traditional" practice of packing multiple parameters into a 46 | # space-separated string is a well documented source of bugs and security 47 | # problems, so this is (mostly) avoided, by progressively accumulating 48 | # options in "$@", and eventually passing that to Java. 49 | # 50 | # Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS, 51 | # and GRADLE_OPTS) rely on word-splitting, this is performed explicitly; 52 | # see the in-line comments for details. 53 | # 54 | # There are tweaks for specific operating systems such as AIX, CygWin, 55 | # Darwin, MinGW, and NonStop. 56 | # 57 | # (3) This script is generated from the Groovy template 58 | # https://github.com/gradle/gradle/blob/HEAD/subprojects/plugins/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt 59 | # within the Gradle project. 60 | # 61 | # You can find Gradle at https://github.com/gradle/gradle/. 62 | # 63 | ############################################################################## 64 | 65 | # Attempt to set APP_HOME 66 | 67 | # Resolve links: $0 may be a link 68 | app_path=$0 69 | 70 | # Need this for daisy-chained symlinks. 71 | while 72 | APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path 73 | [ -h "$app_path" ] 74 | do 75 | ls=$( ls -ld "$app_path" ) 76 | link=${ls#*' -> '} 77 | case $link in #( 78 | /*) app_path=$link ;; #( 79 | *) app_path=$APP_HOME$link ;; 80 | esac 81 | done 82 | 83 | # This is normally unused 84 | # shellcheck disable=SC2034 85 | APP_BASE_NAME=${0##*/} 86 | # Discard cd standard output in case $CDPATH is set (https://github.com/gradle/gradle/issues/25036) 87 | APP_HOME=$( cd "${APP_HOME:-./}" > /dev/null && pwd -P ) || exit 88 | 89 | # Use the maximum available, or set MAX_FD != -1 to use that value. 90 | MAX_FD=maximum 91 | 92 | warn () { 93 | echo "$*" 94 | } >&2 95 | 96 | die () { 97 | echo 98 | echo "$*" 99 | echo 100 | exit 1 101 | } >&2 102 | 103 | # OS specific support (must be 'true' or 'false'). 104 | cygwin=false 105 | msys=false 106 | darwin=false 107 | nonstop=false 108 | case "$( uname )" in #( 109 | CYGWIN* ) cygwin=true ;; #( 110 | Darwin* ) darwin=true ;; #( 111 | MSYS* | MINGW* ) msys=true ;; #( 112 | NONSTOP* ) nonstop=true ;; 113 | esac 114 | 115 | CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar 116 | 117 | 118 | # Determine the Java command to use to start the JVM. 119 | if [ -n "$JAVA_HOME" ] ; then 120 | if [ -x "$JAVA_HOME/jre/sh/java" ] ; then 121 | # IBM's JDK on AIX uses strange locations for the executables 122 | JAVACMD=$JAVA_HOME/jre/sh/java 123 | else 124 | JAVACMD=$JAVA_HOME/bin/java 125 | fi 126 | if [ ! -x "$JAVACMD" ] ; then 127 | die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME 128 | 129 | Please set the JAVA_HOME variable in your environment to match the 130 | location of your Java installation." 131 | fi 132 | else 133 | JAVACMD=java 134 | if ! command -v java >/dev/null 2>&1 135 | then 136 | die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. 137 | 138 | Please set the JAVA_HOME variable in your environment to match the 139 | location of your Java installation." 140 | fi 141 | fi 142 | 143 | # Increase the maximum file descriptors if we can. 144 | if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then 145 | case $MAX_FD in #( 146 | max*) 147 | # In POSIX sh, ulimit -H is undefined. That's why the result is checked to see if it worked. 148 | # shellcheck disable=SC2039,SC3045 149 | MAX_FD=$( ulimit -H -n ) || 150 | warn "Could not query maximum file descriptor limit" 151 | esac 152 | case $MAX_FD in #( 153 | '' | soft) :;; #( 154 | *) 155 | # In POSIX sh, ulimit -n is undefined. That's why the result is checked to see if it worked. 156 | # shellcheck disable=SC2039,SC3045 157 | ulimit -n "$MAX_FD" || 158 | warn "Could not set maximum file descriptor limit to $MAX_FD" 159 | esac 160 | fi 161 | 162 | # Collect all arguments for the java command, stacking in reverse order: 163 | # * args from the command line 164 | # * the main class name 165 | # * -classpath 166 | # * -D...appname settings 167 | # * --module-path (only if needed) 168 | # * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables. 169 | 170 | # For Cygwin or MSYS, switch paths to Windows format before running java 171 | if "$cygwin" || "$msys" ; then 172 | APP_HOME=$( cygpath --path --mixed "$APP_HOME" ) 173 | CLASSPATH=$( cygpath --path --mixed "$CLASSPATH" ) 174 | 175 | JAVACMD=$( cygpath --unix "$JAVACMD" ) 176 | 177 | # Now convert the arguments - kludge to limit ourselves to /bin/sh 178 | for arg do 179 | if 180 | case $arg in #( 181 | -*) false ;; # don't mess with options #( 182 | /?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath 183 | [ -e "$t" ] ;; #( 184 | *) false ;; 185 | esac 186 | then 187 | arg=$( cygpath --path --ignore --mixed "$arg" ) 188 | fi 189 | # Roll the args list around exactly as many times as the number of 190 | # args, so each arg winds up back in the position where it started, but 191 | # possibly modified. 192 | # 193 | # NB: a `for` loop captures its iteration list before it begins, so 194 | # changing the positional parameters here affects neither the number of 195 | # iterations, nor the values presented in `arg`. 196 | shift # remove old arg 197 | set -- "$@" "$arg" # push replacement arg 198 | done 199 | fi 200 | 201 | 202 | # Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script. 203 | DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"' 204 | 205 | # Collect all arguments for the java command: 206 | # * DEFAULT_JVM_OPTS, JAVA_OPTS, JAVA_OPTS, and optsEnvironmentVar are not allowed to contain shell fragments, 207 | # and any embedded shellness will be escaped. 208 | # * For example: A user cannot expect ${Hostname} to be expanded, as it is an environment variable and will be 209 | # treated as '${Hostname}' itself on the command line. 210 | 211 | set -- \ 212 | "-Dorg.gradle.appname=$APP_BASE_NAME" \ 213 | -classpath "$CLASSPATH" \ 214 | org.gradle.wrapper.GradleWrapperMain \ 215 | "$@" 216 | 217 | # Stop when "xargs" is not available. 218 | if ! command -v xargs >/dev/null 2>&1 219 | then 220 | die "xargs is not available" 221 | fi 222 | 223 | # Use "xargs" to parse quoted args. 224 | # 225 | # With -n1 it outputs one arg per line, with the quotes and backslashes removed. 226 | # 227 | # In Bash we could simply go: 228 | # 229 | # readarray ARGS < <( xargs -n1 <<<"$var" ) && 230 | # set -- "${ARGS[@]}" "$@" 231 | # 232 | # but POSIX shell has neither arrays nor command substitution, so instead we 233 | # post-process each arg (as a line of input to sed) to backslash-escape any 234 | # character that might be a shell metacharacter, then use eval to reverse 235 | # that process (while maintaining the separation between arguments), and wrap 236 | # the whole thing up as a single "set" statement. 237 | # 238 | # This will of course break if any of these variables contains a newline or 239 | # an unmatched quote. 240 | # 241 | 242 | eval "set -- $( 243 | printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" | 244 | xargs -n1 | 245 | sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' | 246 | tr '\n' ' ' 247 | )" '"$@"' 248 | 249 | exec "$JAVACMD" "$@" 250 | -------------------------------------------------------------------------------- /iosApp/iosApp.xcodeproj/project.pbxproj: -------------------------------------------------------------------------------- 1 | // !$*UTF8*$! 2 | { 3 | archiveVersion = 1; 4 | classes = { 5 | }; 6 | objectVersion = 56; 7 | objects = { 8 | 9 | /* Begin PBXBuildFile section */ 10 | 058557BB273AAA24004C7B11 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 058557BA273AAA24004C7B11 /* Assets.xcassets */; }; 11 | 058557D9273AAEEB004C7B11 /* Preview Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */; }; 12 | 2152FB042600AC8F00CF470E /* iOSApp.swift in Sources */ = {isa = PBXBuildFile; fileRef = 2152FB032600AC8F00CF470E /* iOSApp.swift */; }; 13 | 7555FF83242A565900829871 /* ContentView.swift in Sources */ = {isa = PBXBuildFile; fileRef = 7555FF82242A565900829871 /* ContentView.swift */; }; 14 | /* End PBXBuildFile section */ 15 | 16 | /* Begin PBXFileReference section */ 17 | 058557BA273AAA24004C7B11 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = Assets.xcassets; sourceTree = ""; }; 18 | 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = "Preview Assets.xcassets"; sourceTree = ""; }; 19 | 2152FB032600AC8F00CF470E /* iOSApp.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = iOSApp.swift; sourceTree = ""; }; 20 | 7555FF7B242A565900829871 /* Kustomize.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = Kustomize.app; sourceTree = BUILT_PRODUCTS_DIR; }; 21 | 7555FF82242A565900829871 /* ContentView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ContentView.swift; sourceTree = ""; }; 22 | 7555FF8C242A565B00829871 /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; path = Info.plist; sourceTree = ""; }; 23 | AB3632DC29227652001CCB65 /* Config.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Config.xcconfig; sourceTree = ""; }; 24 | /* End PBXFileReference section */ 25 | 26 | /* Begin PBXFrameworksBuildPhase section */ 27 | B92378962B6B1156000C7307 /* Frameworks */ = { 28 | isa = PBXFrameworksBuildPhase; 29 | buildActionMask = 2147483647; 30 | files = ( 31 | ); 32 | runOnlyForDeploymentPostprocessing = 0; 33 | }; 34 | /* End PBXFrameworksBuildPhase section */ 35 | 36 | /* Begin PBXGroup section */ 37 | 058557D7273AAEEB004C7B11 /* Preview Content */ = { 38 | isa = PBXGroup; 39 | children = ( 40 | 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */, 41 | ); 42 | path = "Preview Content"; 43 | sourceTree = ""; 44 | }; 45 | 42799AB246E5F90AF97AA0EF /* Frameworks */ = { 46 | isa = PBXGroup; 47 | children = ( 48 | ); 49 | name = Frameworks; 50 | sourceTree = ""; 51 | }; 52 | 7555FF72242A565900829871 = { 53 | isa = PBXGroup; 54 | children = ( 55 | AB1DB47929225F7C00F7AF9C /* Configuration */, 56 | 7555FF7D242A565900829871 /* iosApp */, 57 | 7555FF7C242A565900829871 /* Products */, 58 | 42799AB246E5F90AF97AA0EF /* Frameworks */, 59 | ); 60 | sourceTree = ""; 61 | }; 62 | 7555FF7C242A565900829871 /* Products */ = { 63 | isa = PBXGroup; 64 | children = ( 65 | 7555FF7B242A565900829871 /* Kustomize.app */, 66 | ); 67 | name = Products; 68 | sourceTree = ""; 69 | }; 70 | 7555FF7D242A565900829871 /* iosApp */ = { 71 | isa = PBXGroup; 72 | children = ( 73 | 058557BA273AAA24004C7B11 /* Assets.xcassets */, 74 | 7555FF82242A565900829871 /* ContentView.swift */, 75 | 7555FF8C242A565B00829871 /* Info.plist */, 76 | 2152FB032600AC8F00CF470E /* iOSApp.swift */, 77 | 058557D7273AAEEB004C7B11 /* Preview Content */, 78 | ); 79 | path = iosApp; 80 | sourceTree = ""; 81 | }; 82 | AB1DB47929225F7C00F7AF9C /* Configuration */ = { 83 | isa = PBXGroup; 84 | children = ( 85 | AB3632DC29227652001CCB65 /* Config.xcconfig */, 86 | ); 87 | path = Configuration; 88 | sourceTree = ""; 89 | }; 90 | /* End PBXGroup section */ 91 | 92 | /* Begin PBXNativeTarget section */ 93 | 7555FF7A242A565900829871 /* iosApp */ = { 94 | isa = PBXNativeTarget; 95 | buildConfigurationList = 7555FFA5242A565B00829871 /* Build configuration list for PBXNativeTarget "iosApp" */; 96 | buildPhases = ( 97 | F36B1CEB2AD83DDC00CB74D5 /* Compile Kotlin Framework */, 98 | 7555FF77242A565900829871 /* Sources */, 99 | B92378962B6B1156000C7307 /* Frameworks */, 100 | 7555FF79242A565900829871 /* Resources */, 101 | ); 102 | buildRules = ( 103 | ); 104 | dependencies = ( 105 | ); 106 | name = iosApp; 107 | packageProductDependencies = ( 108 | ); 109 | productName = iosApp; 110 | productReference = 7555FF7B242A565900829871 /* Kustomize.app */; 111 | productType = "com.apple.product-type.application"; 112 | }; 113 | /* End PBXNativeTarget section */ 114 | 115 | /* Begin PBXProject section */ 116 | 7555FF73242A565900829871 /* Project object */ = { 117 | isa = PBXProject; 118 | attributes = { 119 | BuildIndependentTargetsInParallel = YES; 120 | LastSwiftUpdateCheck = 1130; 121 | LastUpgradeCheck = 1540; 122 | ORGANIZATIONNAME = orgName; 123 | TargetAttributes = { 124 | 7555FF7A242A565900829871 = { 125 | CreatedOnToolsVersion = 11.3.1; 126 | }; 127 | }; 128 | }; 129 | buildConfigurationList = 7555FF76242A565900829871 /* Build configuration list for PBXProject "iosApp" */; 130 | compatibilityVersion = "Xcode 14.0"; 131 | developmentRegion = en; 132 | hasScannedForEncodings = 0; 133 | knownRegions = ( 134 | en, 135 | Base, 136 | ); 137 | mainGroup = 7555FF72242A565900829871; 138 | packageReferences = ( 139 | ); 140 | productRefGroup = 7555FF7C242A565900829871 /* Products */; 141 | projectDirPath = ""; 142 | projectRoot = ""; 143 | targets = ( 144 | 7555FF7A242A565900829871 /* iosApp */, 145 | ); 146 | }; 147 | /* End PBXProject section */ 148 | 149 | /* Begin PBXResourcesBuildPhase section */ 150 | 7555FF79242A565900829871 /* Resources */ = { 151 | isa = PBXResourcesBuildPhase; 152 | buildActionMask = 2147483647; 153 | files = ( 154 | 058557D9273AAEEB004C7B11 /* Preview Assets.xcassets in Resources */, 155 | 058557BB273AAA24004C7B11 /* Assets.xcassets in Resources */, 156 | ); 157 | runOnlyForDeploymentPostprocessing = 0; 158 | }; 159 | /* End PBXResourcesBuildPhase section */ 160 | 161 | /* Begin PBXShellScriptBuildPhase section */ 162 | F36B1CEB2AD83DDC00CB74D5 /* Compile Kotlin Framework */ = { 163 | isa = PBXShellScriptBuildPhase; 164 | buildActionMask = 2147483647; 165 | files = ( 166 | ); 167 | inputFileListPaths = ( 168 | ); 169 | inputPaths = ( 170 | ); 171 | name = "Compile Kotlin Framework"; 172 | outputFileListPaths = ( 173 | ); 174 | outputPaths = ( 175 | ); 176 | runOnlyForDeploymentPostprocessing = 0; 177 | shellPath = /bin/sh; 178 | shellScript = "if [ \"YES\" = \"$OVERRIDE_KOTLIN_BUILD_IDE_SUPPORTED\" ]; then\n echo \"Skipping Gradle build task invocation due to OVERRIDE_KOTLIN_BUILD_IDE_SUPPORTED environment variable set to \\\"YES\\\"\"\n exit 0\nfi\ncd \"$SRCROOT/..\"\n./gradlew :composeApp:embedAndSignAppleFrameworkForXcode\n"; 179 | }; 180 | /* End PBXShellScriptBuildPhase section */ 181 | 182 | /* Begin PBXSourcesBuildPhase section */ 183 | 7555FF77242A565900829871 /* Sources */ = { 184 | isa = PBXSourcesBuildPhase; 185 | buildActionMask = 2147483647; 186 | files = ( 187 | 2152FB042600AC8F00CF470E /* iOSApp.swift in Sources */, 188 | 7555FF83242A565900829871 /* ContentView.swift in Sources */, 189 | ); 190 | runOnlyForDeploymentPostprocessing = 0; 191 | }; 192 | /* End PBXSourcesBuildPhase section */ 193 | 194 | /* Begin XCBuildConfiguration section */ 195 | 7555FFA3242A565B00829871 /* Debug */ = { 196 | isa = XCBuildConfiguration; 197 | baseConfigurationReference = AB3632DC29227652001CCB65 /* Config.xcconfig */; 198 | buildSettings = { 199 | ALWAYS_SEARCH_USER_PATHS = NO; 200 | CLANG_ANALYZER_NONNULL = YES; 201 | CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; 202 | CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; 203 | CLANG_CXX_LIBRARY = "libc++"; 204 | CLANG_ENABLE_MODULES = YES; 205 | CLANG_ENABLE_OBJC_ARC = YES; 206 | CLANG_ENABLE_OBJC_WEAK = YES; 207 | CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; 208 | CLANG_WARN_BOOL_CONVERSION = YES; 209 | CLANG_WARN_COMMA = YES; 210 | CLANG_WARN_CONSTANT_CONVERSION = YES; 211 | CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; 212 | CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; 213 | CLANG_WARN_DOCUMENTATION_COMMENTS = YES; 214 | CLANG_WARN_EMPTY_BODY = YES; 215 | CLANG_WARN_ENUM_CONVERSION = YES; 216 | CLANG_WARN_INFINITE_RECURSION = YES; 217 | CLANG_WARN_INT_CONVERSION = YES; 218 | CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; 219 | CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES; 220 | CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; 221 | CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; 222 | CLANG_WARN_QUOTED_INCLUDE_IN_FRAMEWORK_HEADER = YES; 223 | CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; 224 | CLANG_WARN_STRICT_PROTOTYPES = YES; 225 | CLANG_WARN_SUSPICIOUS_MOVE = YES; 226 | CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE; 227 | CLANG_WARN_UNREACHABLE_CODE = YES; 228 | CLANG_WARN__DUPLICATE_METHOD_MATCH = YES; 229 | COPY_PHASE_STRIP = NO; 230 | DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; 231 | ENABLE_STRICT_OBJC_MSGSEND = YES; 232 | ENABLE_TESTABILITY = YES; 233 | ENABLE_USER_SCRIPT_SANDBOXING = NO; 234 | GCC_C_LANGUAGE_STANDARD = gnu11; 235 | GCC_DYNAMIC_NO_PIC = NO; 236 | GCC_NO_COMMON_BLOCKS = YES; 237 | GCC_OPTIMIZATION_LEVEL = 0; 238 | GCC_PREPROCESSOR_DEFINITIONS = ( 239 | "DEBUG=1", 240 | "$(inherited)", 241 | ); 242 | GCC_WARN_64_TO_32_BIT_CONVERSION = YES; 243 | GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; 244 | GCC_WARN_UNDECLARED_SELECTOR = YES; 245 | GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; 246 | GCC_WARN_UNUSED_FUNCTION = YES; 247 | GCC_WARN_UNUSED_VARIABLE = YES; 248 | IPHONEOS_DEPLOYMENT_TARGET = 15.3; 249 | MTL_ENABLE_DEBUG_INFO = INCLUDE_SOURCE; 250 | MTL_FAST_MATH = YES; 251 | ONLY_ACTIVE_ARCH = YES; 252 | SDKROOT = iphoneos; 253 | SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG; 254 | SWIFT_OPTIMIZATION_LEVEL = "-Onone"; 255 | }; 256 | name = Debug; 257 | }; 258 | 7555FFA4242A565B00829871 /* Release */ = { 259 | isa = XCBuildConfiguration; 260 | baseConfigurationReference = AB3632DC29227652001CCB65 /* Config.xcconfig */; 261 | buildSettings = { 262 | ALWAYS_SEARCH_USER_PATHS = NO; 263 | CLANG_ANALYZER_NONNULL = YES; 264 | CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; 265 | CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; 266 | CLANG_CXX_LIBRARY = "libc++"; 267 | CLANG_ENABLE_MODULES = YES; 268 | CLANG_ENABLE_OBJC_ARC = YES; 269 | CLANG_ENABLE_OBJC_WEAK = YES; 270 | CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; 271 | CLANG_WARN_BOOL_CONVERSION = YES; 272 | CLANG_WARN_COMMA = YES; 273 | CLANG_WARN_CONSTANT_CONVERSION = YES; 274 | CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; 275 | CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; 276 | CLANG_WARN_DOCUMENTATION_COMMENTS = YES; 277 | CLANG_WARN_EMPTY_BODY = YES; 278 | CLANG_WARN_ENUM_CONVERSION = YES; 279 | CLANG_WARN_INFINITE_RECURSION = YES; 280 | CLANG_WARN_INT_CONVERSION = YES; 281 | CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; 282 | CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES; 283 | CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; 284 | CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; 285 | CLANG_WARN_QUOTED_INCLUDE_IN_FRAMEWORK_HEADER = YES; 286 | CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; 287 | CLANG_WARN_STRICT_PROTOTYPES = YES; 288 | CLANG_WARN_SUSPICIOUS_MOVE = YES; 289 | CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE; 290 | CLANG_WARN_UNREACHABLE_CODE = YES; 291 | CLANG_WARN__DUPLICATE_METHOD_MATCH = YES; 292 | COPY_PHASE_STRIP = NO; 293 | DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; 294 | ENABLE_NS_ASSERTIONS = NO; 295 | ENABLE_STRICT_OBJC_MSGSEND = YES; 296 | ENABLE_USER_SCRIPT_SANDBOXING = NO; 297 | GCC_C_LANGUAGE_STANDARD = gnu11; 298 | GCC_NO_COMMON_BLOCKS = YES; 299 | GCC_WARN_64_TO_32_BIT_CONVERSION = YES; 300 | GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; 301 | GCC_WARN_UNDECLARED_SELECTOR = YES; 302 | GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; 303 | GCC_WARN_UNUSED_FUNCTION = YES; 304 | GCC_WARN_UNUSED_VARIABLE = YES; 305 | IPHONEOS_DEPLOYMENT_TARGET = 15.3; 306 | MTL_ENABLE_DEBUG_INFO = NO; 307 | MTL_FAST_MATH = YES; 308 | SDKROOT = iphoneos; 309 | SWIFT_COMPILATION_MODE = wholemodule; 310 | SWIFT_OPTIMIZATION_LEVEL = "-O"; 311 | VALIDATE_PRODUCT = YES; 312 | }; 313 | name = Release; 314 | }; 315 | 7555FFA6242A565B00829871 /* Debug */ = { 316 | isa = XCBuildConfiguration; 317 | buildSettings = { 318 | ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; 319 | CODE_SIGN_IDENTITY = "Apple Development"; 320 | CODE_SIGN_STYLE = Automatic; 321 | DEVELOPMENT_ASSET_PATHS = "\"iosApp/Preview Content\""; 322 | DEVELOPMENT_TEAM = "${TEAM_ID}"; 323 | ENABLE_PREVIEWS = YES; 324 | FRAMEWORK_SEARCH_PATHS = ( 325 | "$(inherited)", 326 | "$(SRCROOT)/../shared/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)\n$(SRCROOT)/../composeApp/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)", 327 | ); 328 | INFOPLIST_FILE = iosApp/Info.plist; 329 | IPHONEOS_DEPLOYMENT_TARGET = 15.3; 330 | LD_RUNPATH_SEARCH_PATHS = ( 331 | "$(inherited)", 332 | "@executable_path/Frameworks", 333 | ); 334 | PRODUCT_BUNDLE_IDENTIFIER = "${BUNDLE_ID}${TEAM_ID}"; 335 | PRODUCT_NAME = "${APP_NAME}"; 336 | PROVISIONING_PROFILE_SPECIFIER = ""; 337 | SWIFT_VERSION = 5.0; 338 | TARGETED_DEVICE_FAMILY = "1,2"; 339 | }; 340 | name = Debug; 341 | }; 342 | 7555FFA7242A565B00829871 /* Release */ = { 343 | isa = XCBuildConfiguration; 344 | buildSettings = { 345 | ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; 346 | CODE_SIGN_IDENTITY = "Apple Development"; 347 | CODE_SIGN_STYLE = Automatic; 348 | DEVELOPMENT_ASSET_PATHS = "\"iosApp/Preview Content\""; 349 | DEVELOPMENT_TEAM = "${TEAM_ID}"; 350 | ENABLE_PREVIEWS = YES; 351 | FRAMEWORK_SEARCH_PATHS = ( 352 | "$(inherited)", 353 | "$(SRCROOT)/../shared/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)\n$(SRCROOT)/../composeApp/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)", 354 | ); 355 | INFOPLIST_FILE = iosApp/Info.plist; 356 | IPHONEOS_DEPLOYMENT_TARGET = 15.3; 357 | LD_RUNPATH_SEARCH_PATHS = ( 358 | "$(inherited)", 359 | "@executable_path/Frameworks", 360 | ); 361 | PRODUCT_BUNDLE_IDENTIFIER = "${BUNDLE_ID}${TEAM_ID}"; 362 | PRODUCT_NAME = "${APP_NAME}"; 363 | PROVISIONING_PROFILE_SPECIFIER = ""; 364 | SWIFT_VERSION = 5.0; 365 | TARGETED_DEVICE_FAMILY = "1,2"; 366 | }; 367 | name = Release; 368 | }; 369 | /* End XCBuildConfiguration section */ 370 | 371 | /* Begin XCConfigurationList section */ 372 | 7555FF76242A565900829871 /* Build configuration list for PBXProject "iosApp" */ = { 373 | isa = XCConfigurationList; 374 | buildConfigurations = ( 375 | 7555FFA3242A565B00829871 /* Debug */, 376 | 7555FFA4242A565B00829871 /* Release */, 377 | ); 378 | defaultConfigurationIsVisible = 0; 379 | defaultConfigurationName = Release; 380 | }; 381 | 7555FFA5242A565B00829871 /* Build configuration list for PBXNativeTarget "iosApp" */ = { 382 | isa = XCConfigurationList; 383 | buildConfigurations = ( 384 | 7555FFA6242A565B00829871 /* Debug */, 385 | 7555FFA7242A565B00829871 /* Release */, 386 | ); 387 | defaultConfigurationIsVisible = 0; 388 | defaultConfigurationName = Release; 389 | }; 390 | /* End XCConfigurationList section */ 391 | }; 392 | rootObject = 7555FF73242A565900829871 /* Project object */; 393 | } -------------------------------------------------------------------------------- /composeApp/src/commonMain/kotlin/Comet.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.runtime.Composable 2 | import androidx.compose.runtime.remember 3 | import androidx.compose.ui.graphics.* 4 | import androidx.compose.ui.graphics.vector.ImageVector 5 | import androidx.compose.ui.graphics.vector.PathBuilder 6 | import androidx.compose.ui.graphics.vector.group 7 | import androidx.compose.ui.graphics.vector.path 8 | import androidx.compose.ui.unit.dp 9 | 10 | 11 | @Composable 12 | fun CometShape(): ImageVector { 13 | return remember { 14 | ImageVector.Builder( 15 | name = "Compose svg test", 16 | defaultWidth = 325.dp, 17 | defaultHeight = 345.dp, 18 | viewportWidth = 325f, 19 | viewportHeight = 345f 20 | ).apply { 21 | group { 22 | CometPart{ 23 | moveTo(175.312f, 104.793f) 24 | lineTo(137.428f, 164.038f) 25 | lineTo(231.727f, 77.3515f) 26 | lineTo(204.622f, 74.4054f) 27 | lineTo(175.312f, 104.793f) 28 | close() 29 | } 30 | } 31 | group { 32 | CometPart{ 33 | moveTo(189.759f, 89.3399f) 34 | lineTo(101.789f, 217.853f) 35 | lineTo(218.515f, 77.0974f) 36 | lineTo(189.759f, 89.3399f) 37 | close() 38 | } 39 | } 40 | group { 41 | CometPart{ 42 | moveTo(202.86f, 75.3962f) 43 | lineTo(148.873f, 163.154f) 44 | lineTo(218.516f, 77.0978f) 45 | lineTo(202.86f, 75.3962f) 46 | close() 47 | } 48 | } 49 | group { 50 | CometPart{ 51 | moveTo(227.101f, 106.85f) 52 | lineTo(189.217f, 166.095f) 53 | lineTo(283.516f, 79.4086f) 54 | lineTo(256.411f, 76.4626f) 55 | lineTo(227.101f, 106.85f) 56 | close() 57 | } 58 | } 59 | group { 60 | CometPart{ 61 | moveTo(241.548f, 91.397f) 62 | lineTo(153.578f, 219.91f) 63 | lineTo(270.304f, 79.1546f) 64 | lineTo(241.548f, 91.397f) 65 | close() 66 | } 67 | } 68 | group { 69 | CometPart{ 70 | moveTo(254.649f, 77.4533f) 71 | lineTo(200.662f, 165.211f) 72 | lineTo(270.305f, 79.1549f) 73 | lineTo(254.649f, 77.4533f) 74 | close() 75 | } 76 | } 77 | group { 78 | CometPart{ 79 | moveTo(148.785f, 93.2451f) 80 | lineTo(110.9f, 152.49f) 81 | lineTo(205.2f, 65.8039f) 82 | lineTo(178.095f, 62.8578f) 83 | lineTo(148.785f, 93.2451f) 84 | close() 85 | } 86 | } 87 | group { 88 | CometPart{ 89 | moveTo(143.093f, 82.8897f) 90 | lineTo(55.123f, 211.403f) 91 | lineTo(171.849f, 70.6472f) 92 | lineTo(143.093f, 82.8897f) 93 | close() 94 | } 95 | } 96 | group { 97 | CometPart{ 98 | moveTo(166.024f, 62.2199f) 99 | lineTo(112.037f, 149.978f) 100 | lineTo(181.68f, 63.9215f) 101 | lineTo(166.024f, 62.2199f) 102 | close() 103 | } 104 | } 105 | group { 106 | CometPart{ 107 | moveTo(142.089f, 92.8545f) 108 | lineTo(104.205f, 152.1f) 109 | lineTo(198.505f, 65.4132f) 110 | lineTo(171.399f, 62.4672f) 111 | lineTo(142.089f, 92.8545f) 112 | close() 113 | } 114 | } 115 | group { 116 | CometPart{ 117 | moveTo(143.607f, 103.479f) 118 | lineTo(105.723f, 162.724f) 119 | lineTo(200.022f, 76.0375f) 120 | lineTo(172.917f, 73.0915f) 121 | lineTo(143.607f, 103.479f) 122 | close() 123 | } 124 | } 125 | group { 126 | CometPart{ 127 | moveTo(211.322f, 70.8285f) 128 | lineTo(214.717f, 35.4265f) 129 | lineTo(191.893f, 96.5885f) 130 | lineTo(205.042f, 91.366f) 131 | lineTo(211.322f, 70.8285f) 132 | close() 133 | } 134 | } 135 | group { 136 | CometPart{ 137 | moveTo(211.322f, 70.8285f) 138 | lineTo(214.717f, 35.4265f) 139 | lineTo(191.893f, 96.5885f) 140 | lineTo(205.042f, 91.366f) 141 | lineTo(211.322f, 70.8285f) 142 | close() 143 | } 144 | } 145 | group { 146 | CometPart{ 147 | moveTo(202.974f, 71.2079f) 148 | lineTo(206.369f, 35.8059f) 149 | lineTo(183.545f, 96.9679f) 150 | lineTo(196.695f, 91.7454f) 151 | lineTo(202.974f, 71.2079f) 152 | close() 153 | } 154 | } 155 | group { 156 | CometPart{ 157 | moveTo(147.781f, 96.5081f) 158 | lineTo(59.8105f, 225.021f) 159 | lineTo(176.537f, 84.2657f) 160 | lineTo(147.781f, 96.5081f) 161 | close() 162 | } 163 | } 164 | group { 165 | CometPart{ 166 | moveTo(152.122f, 73.9709f) 167 | lineTo(98.1348f, 161.729f) 168 | lineTo(167.777f, 75.6725f) 169 | lineTo(152.122f, 73.9709f) 170 | close() 171 | } 172 | } 173 | group { 174 | CometPart{ 175 | moveTo(133.197f, 123.764f) 176 | lineTo(95.3125f, 183.01f) 177 | lineTo(189.612f, 96.3232f) 178 | lineTo(162.507f, 93.3771f) 179 | lineTo(133.197f, 123.764f) 180 | close() 181 | } 182 | } 183 | group { 184 | CometPart{ 185 | moveTo(147.644f, 108.312f) 186 | lineTo(59.6738f, 236.825f) 187 | lineTo(176.4f, 96.0694f) 188 | lineTo(147.644f, 108.312f) 189 | close() 190 | } 191 | } 192 | group { 193 | CometPart{ 194 | moveTo(160.745f, 94.3681f) 195 | lineTo(106.758f, 182.126f) 196 | lineTo(176.4f, 96.0697f) 197 | lineTo(160.745f, 94.3681f) 198 | close() 199 | } 200 | } 201 | group { 202 | CometPart{ 203 | moveTo(160.745f, 94.3681f) 204 | lineTo(106.758f, 182.126f) 205 | lineTo(176.4f, 96.0697f) 206 | lineTo(160.745f, 94.3681f) 207 | close() 208 | } 209 | } 210 | group { 211 | CometPart{ 212 | moveTo(160.745f, 94.3681f) 213 | lineTo(106.758f, 182.126f) 214 | lineTo(176.4f, 96.0697f) 215 | lineTo(160.745f, 94.3681f) 216 | close() 217 | } 218 | } 219 | group { 220 | CometPart{ 221 | moveTo(144.397f, 91.4365f) 222 | lineTo(90.4102f, 179.195f) 223 | lineTo(160.053f, 93.1381f) 224 | lineTo(144.397f, 91.4365f) 225 | close() 226 | } 227 | } 228 | group { 229 | CometPart{ 230 | moveTo(137.565f, 100.922f) 231 | lineTo(83.5781f, 188.68f) 232 | lineTo(153.221f, 102.624f) 233 | lineTo(137.565f, 100.922f) 234 | close() 235 | } 236 | } 237 | group { 238 | CometPart{ 239 | moveTo(136.428f, 114.582f) 240 | lineTo(82.4414f, 202.34f) 241 | lineTo(152.084f, 116.284f) 242 | lineTo(136.428f, 114.582f) 243 | close() 244 | } 245 | } 246 | group { 247 | CometPart{ 248 | moveTo(148.19f, 126.724f) 249 | lineTo(94.2031f, 214.482f) 250 | lineTo(163.846f, 128.426f) 251 | lineTo(148.19f, 126.724f) 252 | close() 253 | } 254 | } 255 | group { 256 | CometPart{ 257 | moveTo(170.759f, 95.3069f) 258 | lineTo(132.875f, 154.552f) 259 | lineTo(227.175f, 67.8656f) 260 | lineTo(200.069f, 64.9196f) 261 | lineTo(170.759f, 95.3069f) 262 | close() 263 | } 264 | } 265 | group { 266 | CometPart{ 267 | moveTo(185.206f, 79.854f) 268 | lineTo(97.2363f, 208.367f) 269 | lineTo(213.963f, 67.6116f) 270 | lineTo(185.206f, 79.854f) 271 | close() 272 | } 273 | } 274 | group { 275 | CometPart{ 276 | moveTo(166.78f, 78.5356f) 277 | lineTo(112.793f, 166.294f) 278 | lineTo(182.436f, 80.2372f) 279 | lineTo(166.78f, 78.5356f) 280 | close() 281 | } 282 | } 283 | group { 284 | CometPart{ 285 | moveTo(163.173f, 132.112f) 286 | lineTo(125.289f, 191.358f) 287 | lineTo(219.589f, 104.671f) 288 | lineTo(192.483f, 101.725f) 289 | lineTo(163.173f, 132.112f) 290 | close() 291 | } 292 | } 293 | group { 294 | CometPart{ 295 | moveTo(177.62f, 116.659f) 296 | lineTo(89.6504f, 245.173f) 297 | lineTo(206.377f, 104.417f) 298 | lineTo(177.62f, 116.659f) 299 | close() 300 | } 301 | } 302 | group { 303 | CometPart{ 304 | moveTo(190.721f, 102.716f) 305 | lineTo(136.734f, 190.474f) 306 | lineTo(206.377f, 104.417f) 307 | lineTo(190.721f, 102.716f) 308 | close() 309 | } 310 | } 311 | group { 312 | CometPart{ 313 | moveTo(181.386f, 129.076f) 314 | lineTo(143.502f, 188.322f) 315 | lineTo(237.802f, 101.635f) 316 | lineTo(210.696f, 98.6891f) 317 | lineTo(181.386f, 129.076f) 318 | close() 319 | } 320 | } 321 | group { 322 | CometPart{ 323 | moveTo(195.833f, 113.624f) 324 | lineTo(107.863f, 242.137f) 325 | lineTo(224.59f, 101.381f) 326 | lineTo(195.833f, 113.624f) 327 | close() 328 | } 329 | } 330 | group { 331 | CometPart{ 332 | moveTo(208.934f, 99.6799f) 333 | lineTo(154.947f, 187.438f) 334 | lineTo(224.59f, 101.381f) 335 | lineTo(208.934f, 99.6799f) 336 | close() 337 | } 338 | } 339 | group { 340 | CometPart{ 341 | moveTo(205.671f, 104.793f) 342 | lineTo(167.787f, 164.038f) 343 | lineTo(262.087f, 77.3517f) 344 | lineTo(234.981f, 74.4057f) 345 | lineTo(205.671f, 104.793f) 346 | close() 347 | } 348 | } 349 | group { 350 | CometPart{ 351 | moveTo(220.118f, 89.3401f) 352 | lineTo(132.148f, 217.853f) 353 | lineTo(248.875f, 77.0977f) 354 | lineTo(220.118f, 89.3401f) 355 | close() 356 | } 357 | } 358 | group { 359 | CometPart{ 360 | moveTo(233.219f, 75.3962f) 361 | lineTo(179.232f, 163.154f) 362 | lineTo(248.875f, 77.0978f) 363 | lineTo(233.219f, 75.3962f) 364 | close() 365 | } 366 | } 367 | group { 368 | CometPart{ 369 | moveTo(217.814f, 123.006f) 370 | lineTo(179.93f, 182.251f) 371 | lineTo(274.229f, 95.5644f) 372 | lineTo(247.124f, 92.6183f) 373 | lineTo(217.814f, 123.006f) 374 | close() 375 | } 376 | } 377 | group { 378 | CometPart{ 379 | moveTo(228.466f, 99.9343f) 380 | lineTo(140.496f, 228.448f) 381 | lineTo(257.222f, 87.6919f) 382 | lineTo(228.466f, 99.9343f) 383 | close() 384 | } 385 | } 386 | group { 387 | CometPart{ 388 | moveTo(245.362f, 93.6091f) 389 | lineTo(191.375f, 181.367f) 390 | lineTo(261.018f, 95.3107f) 391 | lineTo(245.362f, 93.6091f) 392 | close() 393 | } 394 | } 395 | group { 396 | CometPart{ 397 | moveTo(188.537f, 98.4949f) 398 | lineTo(150.652f, 157.74f) 399 | lineTo(244.952f, 71.0536f) 400 | lineTo(217.846f, 68.1076f) 401 | lineTo(188.537f, 98.4949f) 402 | close() 403 | } 404 | } 405 | group { 406 | CometPart{ 407 | moveTo(198.677f, 64.4959f) 408 | lineTo(110.707f, 193.009f) 409 | lineTo(227.433f, 52.2534f) 410 | lineTo(198.677f, 64.4959f) 411 | close() 412 | } 413 | } 414 | group { 415 | CometPart{ 416 | moveTo(223.225f, 56.9479f) 417 | lineTo(169.238f, 144.706f) 418 | lineTo(238.881f, 58.6495f) 419 | lineTo(223.225f, 56.9479f) 420 | close() 421 | } 422 | } 423 | group { 424 | CometPart{ 425 | moveTo(136.285f, 196.967f) 426 | lineTo(98.4004f, 256.212f) 427 | lineTo(192.7f, 169.526f) 428 | lineTo(165.595f, 166.58f) 429 | lineTo(136.285f, 196.967f) 430 | close() 431 | } 432 | } 433 | group { 434 | CometPart{ 435 | moveTo(150.732f, 181.514f) 436 | lineTo(62.7617f, 310.027f) 437 | lineTo(179.488f, 169.272f) 438 | lineTo(150.732f, 181.514f) 439 | close() 440 | } 441 | } 442 | group { 443 | CometPart{ 444 | moveTo(163.833f, 167.57f) 445 | lineTo(109.846f, 255.328f) 446 | lineTo(179.488f, 169.272f) 447 | lineTo(163.833f, 167.57f) 448 | close() 449 | } 450 | } 451 | group { 452 | CometPart{ 453 | moveTo(172.564f, 195.905f) 454 | lineTo(134.68f, 255.151f) 455 | lineTo(228.979f, 168.464f) 456 | lineTo(201.874f, 165.518f) 457 | lineTo(172.564f, 195.905f) 458 | close() 459 | } 460 | } 461 | group { 462 | CometPart{ 463 | moveTo(187.011f, 180.452f) 464 | lineTo(99.041f, 308.966f) 465 | lineTo(215.767f, 168.21f) 466 | lineTo(187.011f, 180.452f) 467 | close() 468 | } 469 | } 470 | group { 471 | CometPart{ 472 | moveTo(200.112f, 166.508f) 473 | lineTo(146.125f, 254.267f) 474 | lineTo(215.768f, 168.21f) 475 | lineTo(200.112f, 166.508f) 476 | close() 477 | } 478 | } 479 | group { 480 | CometPart{ 481 | moveTo(161.326f, 187.361f) 482 | lineTo(123.441f, 246.606f) 483 | lineTo(217.741f, 159.92f) 484 | lineTo(190.636f, 156.974f) 485 | lineTo(161.326f, 187.361f) 486 | close() 487 | } 488 | } 489 | group { 490 | CometPart{ 491 | moveTo(175.773f, 171.908f) 492 | lineTo(87.8027f, 300.421f) 493 | lineTo(204.529f, 159.666f) 494 | lineTo(175.773f, 171.908f) 495 | close() 496 | } 497 | } 498 | group { 499 | CometPart{ 500 | moveTo(188.874f, 157.964f) 501 | lineTo(134.887f, 245.722f) 502 | lineTo(204.529f, 159.666f) 503 | lineTo(188.874f, 157.964f) 504 | close() 505 | } 506 | } 507 | group { 508 | CometPart{ 509 | moveTo(183.132f, 150.985f) 510 | lineTo(145.248f, 210.231f) 511 | lineTo(239.548f, 123.544f) 512 | lineTo(212.442f, 120.598f) 513 | lineTo(183.132f, 150.985f) 514 | close() 515 | } 516 | } 517 | group { 518 | CometPart{ 519 | moveTo(197.579f, 135.533f) 520 | lineTo(109.609f, 264.046f) 521 | lineTo(226.336f, 123.29f) 522 | lineTo(197.579f, 135.533f) 523 | close() 524 | } 525 | } 526 | group { 527 | CometPart{ 528 | moveTo(210.678f, 121.589f) 529 | lineTo(156.691f, 209.347f) 530 | lineTo(226.334f, 123.29f) 531 | lineTo(210.678f, 121.589f) 532 | close() 533 | } 534 | } 535 | group { 536 | CometPart{ 537 | moveTo(108.523f, 180.363f) 538 | lineTo(70.6387f, 239.608f) 539 | lineTo(164.938f, 152.922f) 540 | lineTo(137.833f, 149.976f) 541 | lineTo(108.523f, 180.363f) 542 | close() 543 | } 544 | } 545 | group { 546 | CometPart{ 547 | moveTo(122.97f, 164.91f) 548 | lineTo(35f, 293.424f) 549 | lineTo(151.726f, 152.668f) 550 | lineTo(122.97f, 164.91f) 551 | close() 552 | } 553 | } 554 | group { 555 | CometPart{ 556 | moveTo(136.069f, 150.966f) 557 | lineTo(82.082f, 238.725f) 558 | lineTo(151.725f, 152.668f) 559 | lineTo(136.069f, 150.966f) 560 | close() 561 | } 562 | } 563 | group { 564 | CometPart{ 565 | moveTo(233.853f, 125.014f) 566 | lineTo(195.969f, 184.26f) 567 | lineTo(290.268f, 97.5729f) 568 | lineTo(263.163f, 94.6269f) 569 | lineTo(233.853f, 125.014f) 570 | close() 571 | } 572 | } 573 | group { 574 | CometPart{ 575 | moveTo(248.3f, 109.561f) 576 | lineTo(160.33f, 238.074f) 577 | lineTo(277.056f, 97.3189f) 578 | lineTo(248.3f, 109.561f) 579 | close() 580 | } 581 | } 582 | group { 583 | CometPart{ 584 | moveTo(261.401f, 95.6174f) 585 | lineTo(207.414f, 183.375f) 586 | lineTo(277.057f, 97.319f) 587 | lineTo(261.401f, 95.6174f) 588 | close() 589 | } 590 | } 591 | }.build() 592 | } 593 | } 594 | 595 | inline fun ImageVector.Builder.CometPart( 596 | content: PathBuilder.() -> Unit, 597 | ) { 598 | path( 599 | fill = SolidColor(Color(0xFFA771FF)), 600 | fillAlpha = 1.0f, 601 | stroke = null, 602 | strokeAlpha = 1.0f, 603 | strokeLineWidth = 1.0f, 604 | strokeLineCap = StrokeCap.Butt, 605 | strokeLineJoin = StrokeJoin.Miter, 606 | strokeLineMiter = 1.0f, 607 | pathFillType = PathFillType.NonZero, 608 | pathBuilder = content 609 | ) 610 | } 611 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/composeResources/drawable/comet.svg: -------------------------------------------------------------------------------- 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 | 367 | 368 | 369 | 370 | 371 | 372 | 373 | 374 | 375 | 376 | 377 | 378 | 379 | 380 | 381 | 382 | 383 | 384 | 385 | 386 | 387 | 388 | 389 | 390 | 391 | 392 | 393 | 394 | 395 | 396 | 397 | 398 | 399 | 400 | 401 | 402 | 403 | 404 | 405 | 406 | 407 | 408 | 409 | 410 | 411 | 412 | 413 | 414 | 415 | 416 | 417 | 418 | 419 | 420 | 421 | 422 | 423 | 424 | 425 | 426 | 427 | 428 | 429 | 430 | 431 | 432 | 433 | 434 | 435 | 436 | 437 | 438 | 439 | 440 | 441 | 442 | 443 | 444 | 445 | 446 | 447 | 448 | 449 | 450 | 451 | 452 | 453 | 454 | 455 | 456 | 457 | 458 | 459 | 460 | 461 | 462 | 463 | 464 | 465 | 466 | 467 | 468 | 469 | 470 | 471 | 472 | 473 | 474 | 475 | 476 | 477 | 478 | 479 | 480 | 481 | 482 | 483 | 484 | 485 | 486 | 487 | 488 | 489 | 490 | 491 | 492 | 493 | -------------------------------------------------------------------------------- /composeApp/src/commonMain/kotlin/Compose svg test.kt: -------------------------------------------------------------------------------- 1 | import androidx.compose.runtime.Composable 2 | import androidx.compose.runtime.remember 3 | import androidx.compose.ui.graphics.SolidColor 4 | import androidx.compose.ui.graphics.Color 5 | import androidx.compose.ui.graphics.StrokeCap 6 | import androidx.compose.ui.graphics.StrokeJoin 7 | import androidx.compose.ui.graphics.vector.ImageVector 8 | import androidx.compose.ui.graphics.vector.group 9 | import androidx.compose.ui.graphics.PathFillType 10 | import androidx.compose.ui.graphics.vector.path 11 | import androidx.compose.ui.unit.dp 12 | 13 | 14 | @Composable 15 | fun sgrawrgwr(): ImageVector { 16 | return remember { 17 | ImageVector.Builder( 18 | name = "Compose svg test", 19 | defaultWidth = 325.dp, 20 | defaultHeight = 345.dp, 21 | viewportWidth = 325f, 22 | viewportHeight = 345f 23 | ).apply { 24 | group { 25 | path( 26 | fill = SolidColor(Color(0xFFA771FF)), 27 | fillAlpha = 1.0f, 28 | stroke = null, 29 | strokeAlpha = 1.0f, 30 | strokeLineWidth = 1.0f, 31 | strokeLineCap = StrokeCap.Butt, 32 | strokeLineJoin = StrokeJoin.Miter, 33 | strokeLineMiter = 1.0f, 34 | pathFillType = PathFillType.NonZero 35 | ) { 36 | moveTo(175.312f, 104.793f) 37 | lineTo(137.428f, 164.038f) 38 | lineTo(231.727f, 77.3515f) 39 | lineTo(204.622f, 74.4054f) 40 | lineTo(175.312f, 104.793f) 41 | close() 42 | } 43 | } 44 | group { 45 | path( 46 | fill = SolidColor(Color(0xFFA771FF)), 47 | fillAlpha = 1.0f, 48 | stroke = null, 49 | strokeAlpha = 1.0f, 50 | strokeLineWidth = 1.0f, 51 | strokeLineCap = StrokeCap.Butt, 52 | strokeLineJoin = StrokeJoin.Miter, 53 | strokeLineMiter = 1.0f, 54 | pathFillType = PathFillType.NonZero 55 | ) { 56 | moveTo(189.759f, 89.3399f) 57 | lineTo(101.789f, 217.853f) 58 | lineTo(218.515f, 77.0974f) 59 | lineTo(189.759f, 89.3399f) 60 | close() 61 | } 62 | } 63 | group { 64 | path( 65 | fill = SolidColor(Color(0xFFA771FF)), 66 | fillAlpha = 1.0f, 67 | stroke = null, 68 | strokeAlpha = 1.0f, 69 | strokeLineWidth = 1.0f, 70 | strokeLineCap = StrokeCap.Butt, 71 | strokeLineJoin = StrokeJoin.Miter, 72 | strokeLineMiter = 1.0f, 73 | pathFillType = PathFillType.NonZero 74 | ) { 75 | moveTo(202.86f, 75.3962f) 76 | lineTo(148.873f, 163.154f) 77 | lineTo(218.516f, 77.0978f) 78 | lineTo(202.86f, 75.3962f) 79 | close() 80 | } 81 | } 82 | group { 83 | path( 84 | fill = SolidColor(Color(0xFFA771FF)), 85 | fillAlpha = 1.0f, 86 | stroke = null, 87 | strokeAlpha = 1.0f, 88 | strokeLineWidth = 1.0f, 89 | strokeLineCap = StrokeCap.Butt, 90 | strokeLineJoin = StrokeJoin.Miter, 91 | strokeLineMiter = 1.0f, 92 | pathFillType = PathFillType.NonZero 93 | ) { 94 | moveTo(227.101f, 106.85f) 95 | lineTo(189.217f, 166.095f) 96 | lineTo(283.516f, 79.4086f) 97 | lineTo(256.411f, 76.4626f) 98 | lineTo(227.101f, 106.85f) 99 | close() 100 | } 101 | } 102 | group { 103 | path( 104 | fill = SolidColor(Color(0xFFA771FF)), 105 | fillAlpha = 1.0f, 106 | stroke = null, 107 | strokeAlpha = 1.0f, 108 | strokeLineWidth = 1.0f, 109 | strokeLineCap = StrokeCap.Butt, 110 | strokeLineJoin = StrokeJoin.Miter, 111 | strokeLineMiter = 1.0f, 112 | pathFillType = PathFillType.NonZero 113 | ) { 114 | moveTo(241.548f, 91.397f) 115 | lineTo(153.578f, 219.91f) 116 | lineTo(270.304f, 79.1546f) 117 | lineTo(241.548f, 91.397f) 118 | close() 119 | } 120 | } 121 | group { 122 | path( 123 | fill = SolidColor(Color(0xFFA771FF)), 124 | fillAlpha = 1.0f, 125 | stroke = null, 126 | strokeAlpha = 1.0f, 127 | strokeLineWidth = 1.0f, 128 | strokeLineCap = StrokeCap.Butt, 129 | strokeLineJoin = StrokeJoin.Miter, 130 | strokeLineMiter = 1.0f, 131 | pathFillType = PathFillType.NonZero 132 | ) { 133 | moveTo(254.649f, 77.4533f) 134 | lineTo(200.662f, 165.211f) 135 | lineTo(270.305f, 79.1549f) 136 | lineTo(254.649f, 77.4533f) 137 | close() 138 | } 139 | } 140 | group { 141 | path( 142 | fill = SolidColor(Color(0xFFA771FF)), 143 | fillAlpha = 1.0f, 144 | stroke = null, 145 | strokeAlpha = 1.0f, 146 | strokeLineWidth = 1.0f, 147 | strokeLineCap = StrokeCap.Butt, 148 | strokeLineJoin = StrokeJoin.Miter, 149 | strokeLineMiter = 1.0f, 150 | pathFillType = PathFillType.NonZero 151 | ) { 152 | moveTo(148.785f, 93.2451f) 153 | lineTo(110.9f, 152.49f) 154 | lineTo(205.2f, 65.8039f) 155 | lineTo(178.095f, 62.8578f) 156 | lineTo(148.785f, 93.2451f) 157 | close() 158 | } 159 | } 160 | group { 161 | path( 162 | fill = SolidColor(Color(0xFFA771FF)), 163 | fillAlpha = 1.0f, 164 | stroke = null, 165 | strokeAlpha = 1.0f, 166 | strokeLineWidth = 1.0f, 167 | strokeLineCap = StrokeCap.Butt, 168 | strokeLineJoin = StrokeJoin.Miter, 169 | strokeLineMiter = 1.0f, 170 | pathFillType = PathFillType.NonZero 171 | ) { 172 | moveTo(143.093f, 82.8897f) 173 | lineTo(55.123f, 211.403f) 174 | lineTo(171.849f, 70.6472f) 175 | lineTo(143.093f, 82.8897f) 176 | close() 177 | } 178 | } 179 | group { 180 | path( 181 | fill = SolidColor(Color(0xFFA771FF)), 182 | fillAlpha = 1.0f, 183 | stroke = null, 184 | strokeAlpha = 1.0f, 185 | strokeLineWidth = 1.0f, 186 | strokeLineCap = StrokeCap.Butt, 187 | strokeLineJoin = StrokeJoin.Miter, 188 | strokeLineMiter = 1.0f, 189 | pathFillType = PathFillType.NonZero 190 | ) { 191 | moveTo(166.024f, 62.2199f) 192 | lineTo(112.037f, 149.978f) 193 | lineTo(181.68f, 63.9215f) 194 | lineTo(166.024f, 62.2199f) 195 | close() 196 | } 197 | } 198 | group { 199 | path( 200 | fill = SolidColor(Color(0xFFA771FF)), 201 | fillAlpha = 1.0f, 202 | stroke = null, 203 | strokeAlpha = 1.0f, 204 | strokeLineWidth = 1.0f, 205 | strokeLineCap = StrokeCap.Butt, 206 | strokeLineJoin = StrokeJoin.Miter, 207 | strokeLineMiter = 1.0f, 208 | pathFillType = PathFillType.NonZero 209 | ) { 210 | moveTo(142.089f, 92.8545f) 211 | lineTo(104.205f, 152.1f) 212 | lineTo(198.505f, 65.4132f) 213 | lineTo(171.399f, 62.4672f) 214 | lineTo(142.089f, 92.8545f) 215 | close() 216 | } 217 | } 218 | group { 219 | path( 220 | fill = SolidColor(Color(0xFFA771FF)), 221 | fillAlpha = 1.0f, 222 | stroke = null, 223 | strokeAlpha = 1.0f, 224 | strokeLineWidth = 1.0f, 225 | strokeLineCap = StrokeCap.Butt, 226 | strokeLineJoin = StrokeJoin.Miter, 227 | strokeLineMiter = 1.0f, 228 | pathFillType = PathFillType.NonZero 229 | ) { 230 | moveTo(143.607f, 103.479f) 231 | lineTo(105.723f, 162.724f) 232 | lineTo(200.022f, 76.0375f) 233 | lineTo(172.917f, 73.0915f) 234 | lineTo(143.607f, 103.479f) 235 | close() 236 | } 237 | } 238 | group { 239 | path( 240 | fill = SolidColor(Color(0xFFA771FF)), 241 | fillAlpha = 1.0f, 242 | stroke = null, 243 | strokeAlpha = 1.0f, 244 | strokeLineWidth = 1.0f, 245 | strokeLineCap = StrokeCap.Butt, 246 | strokeLineJoin = StrokeJoin.Miter, 247 | strokeLineMiter = 1.0f, 248 | pathFillType = PathFillType.NonZero 249 | ) { 250 | moveTo(211.322f, 70.8285f) 251 | lineTo(214.717f, 35.4265f) 252 | lineTo(191.893f, 96.5885f) 253 | lineTo(205.042f, 91.366f) 254 | lineTo(211.322f, 70.8285f) 255 | close() 256 | } 257 | } 258 | group { 259 | path( 260 | fill = SolidColor(Color(0xFFA771FF)), 261 | fillAlpha = 1.0f, 262 | stroke = null, 263 | strokeAlpha = 1.0f, 264 | strokeLineWidth = 1.0f, 265 | strokeLineCap = StrokeCap.Butt, 266 | strokeLineJoin = StrokeJoin.Miter, 267 | strokeLineMiter = 1.0f, 268 | pathFillType = PathFillType.NonZero 269 | ) { 270 | moveTo(211.322f, 70.8285f) 271 | lineTo(214.717f, 35.4265f) 272 | lineTo(191.893f, 96.5885f) 273 | lineTo(205.042f, 91.366f) 274 | lineTo(211.322f, 70.8285f) 275 | close() 276 | } 277 | } 278 | group { 279 | path( 280 | fill = SolidColor(Color(0xFFA771FF)), 281 | fillAlpha = 1.0f, 282 | stroke = null, 283 | strokeAlpha = 1.0f, 284 | strokeLineWidth = 1.0f, 285 | strokeLineCap = StrokeCap.Butt, 286 | strokeLineJoin = StrokeJoin.Miter, 287 | strokeLineMiter = 1.0f, 288 | pathFillType = PathFillType.NonZero 289 | ) { 290 | moveTo(202.974f, 71.2079f) 291 | lineTo(206.369f, 35.8059f) 292 | lineTo(183.545f, 96.9679f) 293 | lineTo(196.695f, 91.7454f) 294 | lineTo(202.974f, 71.2079f) 295 | close() 296 | } 297 | } 298 | group { 299 | path( 300 | fill = SolidColor(Color(0xFFA771FF)), 301 | fillAlpha = 1.0f, 302 | stroke = null, 303 | strokeAlpha = 1.0f, 304 | strokeLineWidth = 1.0f, 305 | strokeLineCap = StrokeCap.Butt, 306 | strokeLineJoin = StrokeJoin.Miter, 307 | strokeLineMiter = 1.0f, 308 | pathFillType = PathFillType.NonZero 309 | ) { 310 | moveTo(147.781f, 96.5081f) 311 | lineTo(59.8105f, 225.021f) 312 | lineTo(176.537f, 84.2657f) 313 | lineTo(147.781f, 96.5081f) 314 | close() 315 | } 316 | } 317 | group { 318 | path( 319 | fill = SolidColor(Color(0xFFA771FF)), 320 | fillAlpha = 1.0f, 321 | stroke = null, 322 | strokeAlpha = 1.0f, 323 | strokeLineWidth = 1.0f, 324 | strokeLineCap = StrokeCap.Butt, 325 | strokeLineJoin = StrokeJoin.Miter, 326 | strokeLineMiter = 1.0f, 327 | pathFillType = PathFillType.NonZero 328 | ) { 329 | moveTo(152.122f, 73.9709f) 330 | lineTo(98.1348f, 161.729f) 331 | lineTo(167.777f, 75.6725f) 332 | lineTo(152.122f, 73.9709f) 333 | close() 334 | } 335 | } 336 | group { 337 | path( 338 | fill = SolidColor(Color(0xFFA771FF)), 339 | fillAlpha = 1.0f, 340 | stroke = null, 341 | strokeAlpha = 1.0f, 342 | strokeLineWidth = 1.0f, 343 | strokeLineCap = StrokeCap.Butt, 344 | strokeLineJoin = StrokeJoin.Miter, 345 | strokeLineMiter = 1.0f, 346 | pathFillType = PathFillType.NonZero 347 | ) { 348 | moveTo(133.197f, 123.764f) 349 | lineTo(95.3125f, 183.01f) 350 | lineTo(189.612f, 96.3232f) 351 | lineTo(162.507f, 93.3771f) 352 | lineTo(133.197f, 123.764f) 353 | close() 354 | } 355 | } 356 | group { 357 | path( 358 | fill = SolidColor(Color(0xFFA771FF)), 359 | fillAlpha = 1.0f, 360 | stroke = null, 361 | strokeAlpha = 1.0f, 362 | strokeLineWidth = 1.0f, 363 | strokeLineCap = StrokeCap.Butt, 364 | strokeLineJoin = StrokeJoin.Miter, 365 | strokeLineMiter = 1.0f, 366 | pathFillType = PathFillType.NonZero 367 | ) { 368 | moveTo(147.644f, 108.312f) 369 | lineTo(59.6738f, 236.825f) 370 | lineTo(176.4f, 96.0694f) 371 | lineTo(147.644f, 108.312f) 372 | close() 373 | } 374 | } 375 | group { 376 | path( 377 | fill = SolidColor(Color(0xFFA771FF)), 378 | fillAlpha = 1.0f, 379 | stroke = null, 380 | strokeAlpha = 1.0f, 381 | strokeLineWidth = 1.0f, 382 | strokeLineCap = StrokeCap.Butt, 383 | strokeLineJoin = StrokeJoin.Miter, 384 | strokeLineMiter = 1.0f, 385 | pathFillType = PathFillType.NonZero 386 | ) { 387 | moveTo(160.745f, 94.3681f) 388 | lineTo(106.758f, 182.126f) 389 | lineTo(176.4f, 96.0697f) 390 | lineTo(160.745f, 94.3681f) 391 | close() 392 | } 393 | } 394 | group { 395 | path( 396 | fill = SolidColor(Color(0xFFA771FF)), 397 | fillAlpha = 1.0f, 398 | stroke = null, 399 | strokeAlpha = 1.0f, 400 | strokeLineWidth = 1.0f, 401 | strokeLineCap = StrokeCap.Butt, 402 | strokeLineJoin = StrokeJoin.Miter, 403 | strokeLineMiter = 1.0f, 404 | pathFillType = PathFillType.NonZero 405 | ) { 406 | moveTo(160.745f, 94.3681f) 407 | lineTo(106.758f, 182.126f) 408 | lineTo(176.4f, 96.0697f) 409 | lineTo(160.745f, 94.3681f) 410 | close() 411 | } 412 | } 413 | group { 414 | path( 415 | fill = SolidColor(Color(0xFFA771FF)), 416 | fillAlpha = 1.0f, 417 | stroke = null, 418 | strokeAlpha = 1.0f, 419 | strokeLineWidth = 1.0f, 420 | strokeLineCap = StrokeCap.Butt, 421 | strokeLineJoin = StrokeJoin.Miter, 422 | strokeLineMiter = 1.0f, 423 | pathFillType = PathFillType.NonZero 424 | ) { 425 | moveTo(160.745f, 94.3681f) 426 | lineTo(106.758f, 182.126f) 427 | lineTo(176.4f, 96.0697f) 428 | lineTo(160.745f, 94.3681f) 429 | close() 430 | } 431 | } 432 | group { 433 | path( 434 | fill = SolidColor(Color(0xFFA771FF)), 435 | fillAlpha = 1.0f, 436 | stroke = null, 437 | strokeAlpha = 1.0f, 438 | strokeLineWidth = 1.0f, 439 | strokeLineCap = StrokeCap.Butt, 440 | strokeLineJoin = StrokeJoin.Miter, 441 | strokeLineMiter = 1.0f, 442 | pathFillType = PathFillType.NonZero 443 | ) { 444 | moveTo(144.397f, 91.4365f) 445 | lineTo(90.4102f, 179.195f) 446 | lineTo(160.053f, 93.1381f) 447 | lineTo(144.397f, 91.4365f) 448 | close() 449 | } 450 | } 451 | group { 452 | path( 453 | fill = SolidColor(Color(0xFFA771FF)), 454 | fillAlpha = 1.0f, 455 | stroke = null, 456 | strokeAlpha = 1.0f, 457 | strokeLineWidth = 1.0f, 458 | strokeLineCap = StrokeCap.Butt, 459 | strokeLineJoin = StrokeJoin.Miter, 460 | strokeLineMiter = 1.0f, 461 | pathFillType = PathFillType.NonZero 462 | ) { 463 | moveTo(137.565f, 100.922f) 464 | lineTo(83.5781f, 188.68f) 465 | lineTo(153.221f, 102.624f) 466 | lineTo(137.565f, 100.922f) 467 | close() 468 | } 469 | } 470 | group { 471 | path( 472 | fill = SolidColor(Color(0xFFA771FF)), 473 | fillAlpha = 1.0f, 474 | stroke = null, 475 | strokeAlpha = 1.0f, 476 | strokeLineWidth = 1.0f, 477 | strokeLineCap = StrokeCap.Butt, 478 | strokeLineJoin = StrokeJoin.Miter, 479 | strokeLineMiter = 1.0f, 480 | pathFillType = PathFillType.NonZero 481 | ) { 482 | moveTo(136.428f, 114.582f) 483 | lineTo(82.4414f, 202.34f) 484 | lineTo(152.084f, 116.284f) 485 | lineTo(136.428f, 114.582f) 486 | close() 487 | } 488 | } 489 | group { 490 | path( 491 | fill = SolidColor(Color(0xFFA771FF)), 492 | fillAlpha = 1.0f, 493 | stroke = null, 494 | strokeAlpha = 1.0f, 495 | strokeLineWidth = 1.0f, 496 | strokeLineCap = StrokeCap.Butt, 497 | strokeLineJoin = StrokeJoin.Miter, 498 | strokeLineMiter = 1.0f, 499 | pathFillType = PathFillType.NonZero 500 | ) { 501 | moveTo(148.19f, 126.724f) 502 | lineTo(94.2031f, 214.482f) 503 | lineTo(163.846f, 128.426f) 504 | lineTo(148.19f, 126.724f) 505 | close() 506 | } 507 | } 508 | group { 509 | path( 510 | fill = SolidColor(Color(0xFFA771FF)), 511 | fillAlpha = 1.0f, 512 | stroke = null, 513 | strokeAlpha = 1.0f, 514 | strokeLineWidth = 1.0f, 515 | strokeLineCap = StrokeCap.Butt, 516 | strokeLineJoin = StrokeJoin.Miter, 517 | strokeLineMiter = 1.0f, 518 | pathFillType = PathFillType.NonZero 519 | ) { 520 | moveTo(170.759f, 95.3069f) 521 | lineTo(132.875f, 154.552f) 522 | lineTo(227.175f, 67.8656f) 523 | lineTo(200.069f, 64.9196f) 524 | lineTo(170.759f, 95.3069f) 525 | close() 526 | } 527 | } 528 | group { 529 | path( 530 | fill = SolidColor(Color(0xFFA771FF)), 531 | fillAlpha = 1.0f, 532 | stroke = null, 533 | strokeAlpha = 1.0f, 534 | strokeLineWidth = 1.0f, 535 | strokeLineCap = StrokeCap.Butt, 536 | strokeLineJoin = StrokeJoin.Miter, 537 | strokeLineMiter = 1.0f, 538 | pathFillType = PathFillType.NonZero 539 | ) { 540 | moveTo(185.206f, 79.854f) 541 | lineTo(97.2363f, 208.367f) 542 | lineTo(213.963f, 67.6116f) 543 | lineTo(185.206f, 79.854f) 544 | close() 545 | } 546 | } 547 | group { 548 | path( 549 | fill = SolidColor(Color(0xFFA771FF)), 550 | fillAlpha = 1.0f, 551 | stroke = null, 552 | strokeAlpha = 1.0f, 553 | strokeLineWidth = 1.0f, 554 | strokeLineCap = StrokeCap.Butt, 555 | strokeLineJoin = StrokeJoin.Miter, 556 | strokeLineMiter = 1.0f, 557 | pathFillType = PathFillType.NonZero 558 | ) { 559 | moveTo(166.78f, 78.5356f) 560 | lineTo(112.793f, 166.294f) 561 | lineTo(182.436f, 80.2372f) 562 | lineTo(166.78f, 78.5356f) 563 | close() 564 | } 565 | } 566 | group { 567 | path( 568 | fill = SolidColor(Color(0xFFA771FF)), 569 | fillAlpha = 1.0f, 570 | stroke = null, 571 | strokeAlpha = 1.0f, 572 | strokeLineWidth = 1.0f, 573 | strokeLineCap = StrokeCap.Butt, 574 | strokeLineJoin = StrokeJoin.Miter, 575 | strokeLineMiter = 1.0f, 576 | pathFillType = PathFillType.NonZero 577 | ) { 578 | moveTo(163.173f, 132.112f) 579 | lineTo(125.289f, 191.358f) 580 | lineTo(219.589f, 104.671f) 581 | lineTo(192.483f, 101.725f) 582 | lineTo(163.173f, 132.112f) 583 | close() 584 | } 585 | } 586 | group { 587 | path( 588 | fill = SolidColor(Color(0xFFA771FF)), 589 | fillAlpha = 1.0f, 590 | stroke = null, 591 | strokeAlpha = 1.0f, 592 | strokeLineWidth = 1.0f, 593 | strokeLineCap = StrokeCap.Butt, 594 | strokeLineJoin = StrokeJoin.Miter, 595 | strokeLineMiter = 1.0f, 596 | pathFillType = PathFillType.NonZero 597 | ) { 598 | moveTo(177.62f, 116.659f) 599 | lineTo(89.6504f, 245.173f) 600 | lineTo(206.377f, 104.417f) 601 | lineTo(177.62f, 116.659f) 602 | close() 603 | } 604 | } 605 | group { 606 | path( 607 | fill = SolidColor(Color(0xFFA771FF)), 608 | fillAlpha = 1.0f, 609 | stroke = null, 610 | strokeAlpha = 1.0f, 611 | strokeLineWidth = 1.0f, 612 | strokeLineCap = StrokeCap.Butt, 613 | strokeLineJoin = StrokeJoin.Miter, 614 | strokeLineMiter = 1.0f, 615 | pathFillType = PathFillType.NonZero 616 | ) { 617 | moveTo(190.721f, 102.716f) 618 | lineTo(136.734f, 190.474f) 619 | lineTo(206.377f, 104.417f) 620 | lineTo(190.721f, 102.716f) 621 | close() 622 | } 623 | } 624 | group { 625 | path( 626 | fill = SolidColor(Color(0xFFA771FF)), 627 | fillAlpha = 1.0f, 628 | stroke = null, 629 | strokeAlpha = 1.0f, 630 | strokeLineWidth = 1.0f, 631 | strokeLineCap = StrokeCap.Butt, 632 | strokeLineJoin = StrokeJoin.Miter, 633 | strokeLineMiter = 1.0f, 634 | pathFillType = PathFillType.NonZero 635 | ) { 636 | moveTo(181.386f, 129.076f) 637 | lineTo(143.502f, 188.322f) 638 | lineTo(237.802f, 101.635f) 639 | lineTo(210.696f, 98.6891f) 640 | lineTo(181.386f, 129.076f) 641 | close() 642 | } 643 | } 644 | group { 645 | path( 646 | fill = SolidColor(Color(0xFFA771FF)), 647 | fillAlpha = 1.0f, 648 | stroke = null, 649 | strokeAlpha = 1.0f, 650 | strokeLineWidth = 1.0f, 651 | strokeLineCap = StrokeCap.Butt, 652 | strokeLineJoin = StrokeJoin.Miter, 653 | strokeLineMiter = 1.0f, 654 | pathFillType = PathFillType.NonZero 655 | ) { 656 | moveTo(195.833f, 113.624f) 657 | lineTo(107.863f, 242.137f) 658 | lineTo(224.59f, 101.381f) 659 | lineTo(195.833f, 113.624f) 660 | close() 661 | } 662 | } 663 | group { 664 | path( 665 | fill = SolidColor(Color(0xFFA771FF)), 666 | fillAlpha = 1.0f, 667 | stroke = null, 668 | strokeAlpha = 1.0f, 669 | strokeLineWidth = 1.0f, 670 | strokeLineCap = StrokeCap.Butt, 671 | strokeLineJoin = StrokeJoin.Miter, 672 | strokeLineMiter = 1.0f, 673 | pathFillType = PathFillType.NonZero 674 | ) { 675 | moveTo(208.934f, 99.6799f) 676 | lineTo(154.947f, 187.438f) 677 | lineTo(224.59f, 101.381f) 678 | lineTo(208.934f, 99.6799f) 679 | close() 680 | } 681 | } 682 | group { 683 | path( 684 | fill = SolidColor(Color(0xFFA771FF)), 685 | fillAlpha = 1.0f, 686 | stroke = null, 687 | strokeAlpha = 1.0f, 688 | strokeLineWidth = 1.0f, 689 | strokeLineCap = StrokeCap.Butt, 690 | strokeLineJoin = StrokeJoin.Miter, 691 | strokeLineMiter = 1.0f, 692 | pathFillType = PathFillType.NonZero 693 | ) { 694 | moveTo(205.671f, 104.793f) 695 | lineTo(167.787f, 164.038f) 696 | lineTo(262.087f, 77.3517f) 697 | lineTo(234.981f, 74.4057f) 698 | lineTo(205.671f, 104.793f) 699 | close() 700 | } 701 | } 702 | group { 703 | path( 704 | fill = SolidColor(Color(0xFFA771FF)), 705 | fillAlpha = 1.0f, 706 | stroke = null, 707 | strokeAlpha = 1.0f, 708 | strokeLineWidth = 1.0f, 709 | strokeLineCap = StrokeCap.Butt, 710 | strokeLineJoin = StrokeJoin.Miter, 711 | strokeLineMiter = 1.0f, 712 | pathFillType = PathFillType.NonZero 713 | ) { 714 | moveTo(220.118f, 89.3401f) 715 | lineTo(132.148f, 217.853f) 716 | lineTo(248.875f, 77.0977f) 717 | lineTo(220.118f, 89.3401f) 718 | close() 719 | } 720 | } 721 | group { 722 | path( 723 | fill = SolidColor(Color(0xFFA771FF)), 724 | fillAlpha = 1.0f, 725 | stroke = null, 726 | strokeAlpha = 1.0f, 727 | strokeLineWidth = 1.0f, 728 | strokeLineCap = StrokeCap.Butt, 729 | strokeLineJoin = StrokeJoin.Miter, 730 | strokeLineMiter = 1.0f, 731 | pathFillType = PathFillType.NonZero 732 | ) { 733 | moveTo(233.219f, 75.3962f) 734 | lineTo(179.232f, 163.154f) 735 | lineTo(248.875f, 77.0978f) 736 | lineTo(233.219f, 75.3962f) 737 | close() 738 | } 739 | } 740 | group { 741 | path( 742 | fill = SolidColor(Color(0xFFA771FF)), 743 | fillAlpha = 1.0f, 744 | stroke = null, 745 | strokeAlpha = 1.0f, 746 | strokeLineWidth = 1.0f, 747 | strokeLineCap = StrokeCap.Butt, 748 | strokeLineJoin = StrokeJoin.Miter, 749 | strokeLineMiter = 1.0f, 750 | pathFillType = PathFillType.NonZero 751 | ) { 752 | moveTo(217.814f, 123.006f) 753 | lineTo(179.93f, 182.251f) 754 | lineTo(274.229f, 95.5644f) 755 | lineTo(247.124f, 92.6183f) 756 | lineTo(217.814f, 123.006f) 757 | close() 758 | } 759 | } 760 | group { 761 | path( 762 | fill = SolidColor(Color(0xFFA771FF)), 763 | fillAlpha = 1.0f, 764 | stroke = null, 765 | strokeAlpha = 1.0f, 766 | strokeLineWidth = 1.0f, 767 | strokeLineCap = StrokeCap.Butt, 768 | strokeLineJoin = StrokeJoin.Miter, 769 | strokeLineMiter = 1.0f, 770 | pathFillType = PathFillType.NonZero 771 | ) { 772 | moveTo(228.466f, 99.9343f) 773 | lineTo(140.496f, 228.448f) 774 | lineTo(257.222f, 87.6919f) 775 | lineTo(228.466f, 99.9343f) 776 | close() 777 | } 778 | } 779 | group { 780 | path( 781 | fill = SolidColor(Color(0xFFA771FF)), 782 | fillAlpha = 1.0f, 783 | stroke = null, 784 | strokeAlpha = 1.0f, 785 | strokeLineWidth = 1.0f, 786 | strokeLineCap = StrokeCap.Butt, 787 | strokeLineJoin = StrokeJoin.Miter, 788 | strokeLineMiter = 1.0f, 789 | pathFillType = PathFillType.NonZero 790 | ) { 791 | moveTo(245.362f, 93.6091f) 792 | lineTo(191.375f, 181.367f) 793 | lineTo(261.018f, 95.3107f) 794 | lineTo(245.362f, 93.6091f) 795 | close() 796 | } 797 | } 798 | group { 799 | path( 800 | fill = SolidColor(Color(0xFFA771FF)), 801 | fillAlpha = 1.0f, 802 | stroke = null, 803 | strokeAlpha = 1.0f, 804 | strokeLineWidth = 1.0f, 805 | strokeLineCap = StrokeCap.Butt, 806 | strokeLineJoin = StrokeJoin.Miter, 807 | strokeLineMiter = 1.0f, 808 | pathFillType = PathFillType.NonZero 809 | ) { 810 | moveTo(188.537f, 98.4949f) 811 | lineTo(150.652f, 157.74f) 812 | lineTo(244.952f, 71.0536f) 813 | lineTo(217.846f, 68.1076f) 814 | lineTo(188.537f, 98.4949f) 815 | close() 816 | } 817 | } 818 | group { 819 | path( 820 | fill = SolidColor(Color(0xFFA771FF)), 821 | fillAlpha = 1.0f, 822 | stroke = null, 823 | strokeAlpha = 1.0f, 824 | strokeLineWidth = 1.0f, 825 | strokeLineCap = StrokeCap.Butt, 826 | strokeLineJoin = StrokeJoin.Miter, 827 | strokeLineMiter = 1.0f, 828 | pathFillType = PathFillType.NonZero 829 | ) { 830 | moveTo(198.677f, 64.4959f) 831 | lineTo(110.707f, 193.009f) 832 | lineTo(227.433f, 52.2534f) 833 | lineTo(198.677f, 64.4959f) 834 | close() 835 | } 836 | } 837 | group { 838 | path( 839 | fill = SolidColor(Color(0xFFA771FF)), 840 | fillAlpha = 1.0f, 841 | stroke = null, 842 | strokeAlpha = 1.0f, 843 | strokeLineWidth = 1.0f, 844 | strokeLineCap = StrokeCap.Butt, 845 | strokeLineJoin = StrokeJoin.Miter, 846 | strokeLineMiter = 1.0f, 847 | pathFillType = PathFillType.NonZero 848 | ) { 849 | moveTo(223.225f, 56.9479f) 850 | lineTo(169.238f, 144.706f) 851 | lineTo(238.881f, 58.6495f) 852 | lineTo(223.225f, 56.9479f) 853 | close() 854 | } 855 | } 856 | group { 857 | path( 858 | fill = SolidColor(Color(0xFFA771FF)), 859 | fillAlpha = 1.0f, 860 | stroke = null, 861 | strokeAlpha = 1.0f, 862 | strokeLineWidth = 1.0f, 863 | strokeLineCap = StrokeCap.Butt, 864 | strokeLineJoin = StrokeJoin.Miter, 865 | strokeLineMiter = 1.0f, 866 | pathFillType = PathFillType.NonZero 867 | ) { 868 | moveTo(136.285f, 196.967f) 869 | lineTo(98.4004f, 256.212f) 870 | lineTo(192.7f, 169.526f) 871 | lineTo(165.595f, 166.58f) 872 | lineTo(136.285f, 196.967f) 873 | close() 874 | } 875 | } 876 | group { 877 | path( 878 | fill = SolidColor(Color(0xFFA771FF)), 879 | fillAlpha = 1.0f, 880 | stroke = null, 881 | strokeAlpha = 1.0f, 882 | strokeLineWidth = 1.0f, 883 | strokeLineCap = StrokeCap.Butt, 884 | strokeLineJoin = StrokeJoin.Miter, 885 | strokeLineMiter = 1.0f, 886 | pathFillType = PathFillType.NonZero 887 | ) { 888 | moveTo(150.732f, 181.514f) 889 | lineTo(62.7617f, 310.027f) 890 | lineTo(179.488f, 169.272f) 891 | lineTo(150.732f, 181.514f) 892 | close() 893 | } 894 | } 895 | group { 896 | path( 897 | fill = SolidColor(Color(0xFFA771FF)), 898 | fillAlpha = 1.0f, 899 | stroke = null, 900 | strokeAlpha = 1.0f, 901 | strokeLineWidth = 1.0f, 902 | strokeLineCap = StrokeCap.Butt, 903 | strokeLineJoin = StrokeJoin.Miter, 904 | strokeLineMiter = 1.0f, 905 | pathFillType = PathFillType.NonZero 906 | ) { 907 | moveTo(163.833f, 167.57f) 908 | lineTo(109.846f, 255.328f) 909 | lineTo(179.488f, 169.272f) 910 | lineTo(163.833f, 167.57f) 911 | close() 912 | } 913 | } 914 | group { 915 | path( 916 | fill = SolidColor(Color(0xFFA771FF)), 917 | fillAlpha = 1.0f, 918 | stroke = null, 919 | strokeAlpha = 1.0f, 920 | strokeLineWidth = 1.0f, 921 | strokeLineCap = StrokeCap.Butt, 922 | strokeLineJoin = StrokeJoin.Miter, 923 | strokeLineMiter = 1.0f, 924 | pathFillType = PathFillType.NonZero 925 | ) { 926 | moveTo(172.564f, 195.905f) 927 | lineTo(134.68f, 255.151f) 928 | lineTo(228.979f, 168.464f) 929 | lineTo(201.874f, 165.518f) 930 | lineTo(172.564f, 195.905f) 931 | close() 932 | } 933 | } 934 | group { 935 | path( 936 | fill = SolidColor(Color(0xFFA771FF)), 937 | fillAlpha = 1.0f, 938 | stroke = null, 939 | strokeAlpha = 1.0f, 940 | strokeLineWidth = 1.0f, 941 | strokeLineCap = StrokeCap.Butt, 942 | strokeLineJoin = StrokeJoin.Miter, 943 | strokeLineMiter = 1.0f, 944 | pathFillType = PathFillType.NonZero 945 | ) { 946 | moveTo(187.011f, 180.452f) 947 | lineTo(99.041f, 308.966f) 948 | lineTo(215.767f, 168.21f) 949 | lineTo(187.011f, 180.452f) 950 | close() 951 | } 952 | } 953 | group { 954 | path( 955 | fill = SolidColor(Color(0xFFA771FF)), 956 | fillAlpha = 1.0f, 957 | stroke = null, 958 | strokeAlpha = 1.0f, 959 | strokeLineWidth = 1.0f, 960 | strokeLineCap = StrokeCap.Butt, 961 | strokeLineJoin = StrokeJoin.Miter, 962 | strokeLineMiter = 1.0f, 963 | pathFillType = PathFillType.NonZero 964 | ) { 965 | moveTo(200.112f, 166.508f) 966 | lineTo(146.125f, 254.267f) 967 | lineTo(215.768f, 168.21f) 968 | lineTo(200.112f, 166.508f) 969 | close() 970 | } 971 | } 972 | group { 973 | path( 974 | fill = SolidColor(Color(0xFFA771FF)), 975 | fillAlpha = 1.0f, 976 | stroke = null, 977 | strokeAlpha = 1.0f, 978 | strokeLineWidth = 1.0f, 979 | strokeLineCap = StrokeCap.Butt, 980 | strokeLineJoin = StrokeJoin.Miter, 981 | strokeLineMiter = 1.0f, 982 | pathFillType = PathFillType.NonZero 983 | ) { 984 | moveTo(161.326f, 187.361f) 985 | lineTo(123.441f, 246.606f) 986 | lineTo(217.741f, 159.92f) 987 | lineTo(190.636f, 156.974f) 988 | lineTo(161.326f, 187.361f) 989 | close() 990 | } 991 | } 992 | group { 993 | path( 994 | fill = SolidColor(Color(0xFFA771FF)), 995 | fillAlpha = 1.0f, 996 | stroke = null, 997 | strokeAlpha = 1.0f, 998 | strokeLineWidth = 1.0f, 999 | strokeLineCap = StrokeCap.Butt, 1000 | strokeLineJoin = StrokeJoin.Miter, 1001 | strokeLineMiter = 1.0f, 1002 | pathFillType = PathFillType.NonZero 1003 | ) { 1004 | moveTo(175.773f, 171.908f) 1005 | lineTo(87.8027f, 300.421f) 1006 | lineTo(204.529f, 159.666f) 1007 | lineTo(175.773f, 171.908f) 1008 | close() 1009 | } 1010 | } 1011 | group { 1012 | path( 1013 | fill = SolidColor(Color(0xFFA771FF)), 1014 | fillAlpha = 1.0f, 1015 | stroke = null, 1016 | strokeAlpha = 1.0f, 1017 | strokeLineWidth = 1.0f, 1018 | strokeLineCap = StrokeCap.Butt, 1019 | strokeLineJoin = StrokeJoin.Miter, 1020 | strokeLineMiter = 1.0f, 1021 | pathFillType = PathFillType.NonZero 1022 | ) { 1023 | moveTo(188.874f, 157.964f) 1024 | lineTo(134.887f, 245.722f) 1025 | lineTo(204.529f, 159.666f) 1026 | lineTo(188.874f, 157.964f) 1027 | close() 1028 | } 1029 | } 1030 | group { 1031 | path( 1032 | fill = SolidColor(Color(0xFFA771FF)), 1033 | fillAlpha = 1.0f, 1034 | stroke = null, 1035 | strokeAlpha = 1.0f, 1036 | strokeLineWidth = 1.0f, 1037 | strokeLineCap = StrokeCap.Butt, 1038 | strokeLineJoin = StrokeJoin.Miter, 1039 | strokeLineMiter = 1.0f, 1040 | pathFillType = PathFillType.NonZero 1041 | ) { 1042 | moveTo(183.132f, 150.985f) 1043 | lineTo(145.248f, 210.231f) 1044 | lineTo(239.548f, 123.544f) 1045 | lineTo(212.442f, 120.598f) 1046 | lineTo(183.132f, 150.985f) 1047 | close() 1048 | } 1049 | } 1050 | group { 1051 | path( 1052 | fill = SolidColor(Color(0xFFA771FF)), 1053 | fillAlpha = 1.0f, 1054 | stroke = null, 1055 | strokeAlpha = 1.0f, 1056 | strokeLineWidth = 1.0f, 1057 | strokeLineCap = StrokeCap.Butt, 1058 | strokeLineJoin = StrokeJoin.Miter, 1059 | strokeLineMiter = 1.0f, 1060 | pathFillType = PathFillType.NonZero 1061 | ) { 1062 | moveTo(197.579f, 135.533f) 1063 | lineTo(109.609f, 264.046f) 1064 | lineTo(226.336f, 123.29f) 1065 | lineTo(197.579f, 135.533f) 1066 | close() 1067 | } 1068 | } 1069 | group { 1070 | path( 1071 | fill = SolidColor(Color(0xFFA771FF)), 1072 | fillAlpha = 1.0f, 1073 | stroke = null, 1074 | strokeAlpha = 1.0f, 1075 | strokeLineWidth = 1.0f, 1076 | strokeLineCap = StrokeCap.Butt, 1077 | strokeLineJoin = StrokeJoin.Miter, 1078 | strokeLineMiter = 1.0f, 1079 | pathFillType = PathFillType.NonZero 1080 | ) { 1081 | moveTo(210.678f, 121.589f) 1082 | lineTo(156.691f, 209.347f) 1083 | lineTo(226.334f, 123.29f) 1084 | lineTo(210.678f, 121.589f) 1085 | close() 1086 | } 1087 | } 1088 | group { 1089 | path( 1090 | fill = SolidColor(Color(0xFFA771FF)), 1091 | fillAlpha = 1.0f, 1092 | stroke = null, 1093 | strokeAlpha = 1.0f, 1094 | strokeLineWidth = 1.0f, 1095 | strokeLineCap = StrokeCap.Butt, 1096 | strokeLineJoin = StrokeJoin.Miter, 1097 | strokeLineMiter = 1.0f, 1098 | pathFillType = PathFillType.NonZero 1099 | ) { 1100 | moveTo(108.523f, 180.363f) 1101 | lineTo(70.6387f, 239.608f) 1102 | lineTo(164.938f, 152.922f) 1103 | lineTo(137.833f, 149.976f) 1104 | lineTo(108.523f, 180.363f) 1105 | close() 1106 | } 1107 | } 1108 | group { 1109 | path( 1110 | fill = SolidColor(Color(0xFFA771FF)), 1111 | fillAlpha = 1.0f, 1112 | stroke = null, 1113 | strokeAlpha = 1.0f, 1114 | strokeLineWidth = 1.0f, 1115 | strokeLineCap = StrokeCap.Butt, 1116 | strokeLineJoin = StrokeJoin.Miter, 1117 | strokeLineMiter = 1.0f, 1118 | pathFillType = PathFillType.NonZero 1119 | ) { 1120 | moveTo(122.97f, 164.91f) 1121 | lineTo(35f, 293.424f) 1122 | lineTo(151.726f, 152.668f) 1123 | lineTo(122.97f, 164.91f) 1124 | close() 1125 | } 1126 | } 1127 | group { 1128 | path( 1129 | fill = SolidColor(Color(0xFFA771FF)), 1130 | fillAlpha = 1.0f, 1131 | stroke = null, 1132 | strokeAlpha = 1.0f, 1133 | strokeLineWidth = 1.0f, 1134 | strokeLineCap = StrokeCap.Butt, 1135 | strokeLineJoin = StrokeJoin.Miter, 1136 | strokeLineMiter = 1.0f, 1137 | pathFillType = PathFillType.NonZero 1138 | ) { 1139 | moveTo(136.069f, 150.966f) 1140 | lineTo(82.082f, 238.725f) 1141 | lineTo(151.725f, 152.668f) 1142 | lineTo(136.069f, 150.966f) 1143 | close() 1144 | } 1145 | } 1146 | group { 1147 | path( 1148 | fill = SolidColor(Color(0xFFA771FF)), 1149 | fillAlpha = 1.0f, 1150 | stroke = null, 1151 | strokeAlpha = 1.0f, 1152 | strokeLineWidth = 1.0f, 1153 | strokeLineCap = StrokeCap.Butt, 1154 | strokeLineJoin = StrokeJoin.Miter, 1155 | strokeLineMiter = 1.0f, 1156 | pathFillType = PathFillType.NonZero 1157 | ) { 1158 | moveTo(233.853f, 125.014f) 1159 | lineTo(195.969f, 184.26f) 1160 | lineTo(290.268f, 97.5729f) 1161 | lineTo(263.163f, 94.6269f) 1162 | lineTo(233.853f, 125.014f) 1163 | close() 1164 | } 1165 | } 1166 | group { 1167 | path( 1168 | fill = SolidColor(Color(0xFFA771FF)), 1169 | fillAlpha = 1.0f, 1170 | stroke = null, 1171 | strokeAlpha = 1.0f, 1172 | strokeLineWidth = 1.0f, 1173 | strokeLineCap = StrokeCap.Butt, 1174 | strokeLineJoin = StrokeJoin.Miter, 1175 | strokeLineMiter = 1.0f, 1176 | pathFillType = PathFillType.NonZero 1177 | ) { 1178 | moveTo(248.3f, 109.561f) 1179 | lineTo(160.33f, 238.074f) 1180 | lineTo(277.056f, 97.3189f) 1181 | lineTo(248.3f, 109.561f) 1182 | close() 1183 | } 1184 | } 1185 | group { 1186 | path( 1187 | fill = SolidColor(Color(0xFFA771FF)), 1188 | fillAlpha = 1.0f, 1189 | stroke = null, 1190 | strokeAlpha = 1.0f, 1191 | strokeLineWidth = 1.0f, 1192 | strokeLineCap = StrokeCap.Butt, 1193 | strokeLineJoin = StrokeJoin.Miter, 1194 | strokeLineMiter = 1.0f, 1195 | pathFillType = PathFillType.NonZero 1196 | ) { 1197 | moveTo(261.401f, 95.6174f) 1198 | lineTo(207.414f, 183.375f) 1199 | lineTo(277.057f, 97.319f) 1200 | lineTo(261.401f, 95.6174f) 1201 | close() 1202 | } 1203 | } 1204 | }.build() 1205 | } 1206 | } 1207 | 1208 | --------------------------------------------------------------------------------