├── iosApp
├── Configuration
│ └── Config.xcconfig
├── iosApp
│ ├── Assets.xcassets
│ │ ├── Contents.json
│ │ ├── AppIcon.appiconset
│ │ │ ├── app-icon-1024.png
│ │ │ └── Contents.json
│ │ └── AccentColor.colorset
│ │ │ └── Contents.json
│ ├── Preview Content
│ │ └── Preview Assets.xcassets
│ │ │ └── Contents.json
│ ├── iOSApp.swift
│ ├── ContentView.swift
│ └── Info.plist
└── iosApp.xcodeproj
│ └── project.pbxproj
├── composeApp
├── src
│ ├── androidMain
│ │ ├── res
│ │ │ ├── values
│ │ │ │ └── strings.xml
│ │ │ ├── mipmap-hdpi
│ │ │ │ ├── ic_launcher.png
│ │ │ │ └── ic_launcher_round.png
│ │ │ ├── mipmap-mdpi
│ │ │ │ ├── ic_launcher.png
│ │ │ │ └── ic_launcher_round.png
│ │ │ ├── mipmap-xhdpi
│ │ │ │ ├── ic_launcher.png
│ │ │ │ └── ic_launcher_round.png
│ │ │ ├── mipmap-xxhdpi
│ │ │ │ ├── ic_launcher.png
│ │ │ │ └── ic_launcher_round.png
│ │ │ ├── mipmap-xxxhdpi
│ │ │ │ ├── ic_launcher.png
│ │ │ │ └── ic_launcher_round.png
│ │ │ ├── mipmap-anydpi-v26
│ │ │ │ ├── ic_launcher.xml
│ │ │ │ └── ic_launcher_round.xml
│ │ │ ├── drawable-v24
│ │ │ │ └── ic_launcher_foreground.xml
│ │ │ └── drawable
│ │ │ │ └── ic_launcher_background.xml
│ │ ├── kotlin
│ │ │ ├── Platform.android.kt
│ │ │ └── org
│ │ │ │ └── faroukabichou
│ │ │ │ └── kustomize
│ │ │ │ └── MainActivity.kt
│ │ └── AndroidManifest.xml
│ ├── commonMain
│ │ ├── kotlin
│ │ │ ├── Platform.kt
│ │ │ ├── Greeting.kt
│ │ │ ├── App.kt
│ │ │ ├── Comet.kt
│ │ │ └── Compose svg test.kt
│ │ └── composeResources
│ │ │ ├── font
│ │ │ └── font_certs.xml
│ │ │ └── drawable
│ │ │ ├── compose-multiplatform.xml
│ │ │ ├── testt.svg
│ │ │ └── comet.svg
│ ├── wasmJsMain
│ │ ├── resources
│ │ │ ├── styles.css
│ │ │ └── index.html
│ │ └── kotlin
│ │ │ ├── Platform.wasmJs.kt
│ │ │ └── main.kt
│ ├── iosMain
│ │ └── kotlin
│ │ │ ├── MainViewController.kt
│ │ │ └── Platform.ios.kt
│ └── desktopMain
│ │ └── kotlin
│ │ ├── Platform.jvm.kt
│ │ └── main.kt
└── build.gradle.kts
├── gradle
├── wrapper
│ ├── gradle-wrapper.jar
│ └── gradle-wrapper.properties
└── libs.versions.toml
├── .idea
├── vcs.xml
├── compiler.xml
├── .gitignore
├── deploymentTargetDropDown.xml
├── artifacts
│ ├── composeApp_desktop.xml
│ └── composeApp_wasm_js.xml
├── misc.xml
└── gradle.xml
├── gradle.properties
├── local.properties
├── .gitignore
├── settings.gradle.kts
├── README.md
├── gradlew.bat
└── gradlew
/iosApp/Configuration/Config.xcconfig:
--------------------------------------------------------------------------------
1 | TEAM_ID=
2 | BUNDLE_ID=org.faroukabichou.kustomize.Kustomize
3 | APP_NAME=Kustomize
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/values/strings.xml:
--------------------------------------------------------------------------------
1 |
2 | Kustomize
3 |
--------------------------------------------------------------------------------
/gradle/wrapper/gradle-wrapper.jar:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/gradle/wrapper/gradle-wrapper.jar
--------------------------------------------------------------------------------
/iosApp/iosApp/Assets.xcassets/Contents.json:
--------------------------------------------------------------------------------
1 | {
2 | "info" : {
3 | "author" : "xcode",
4 | "version" : 1
5 | }
6 | }
--------------------------------------------------------------------------------
/composeApp/src/commonMain/kotlin/Platform.kt:
--------------------------------------------------------------------------------
1 | interface Platform {
2 | val name: String
3 | }
4 |
5 | expect fun getPlatform(): Platform
--------------------------------------------------------------------------------
/iosApp/iosApp/Preview Content/Preview Assets.xcassets/Contents.json:
--------------------------------------------------------------------------------
1 | {
2 | "info" : {
3 | "author" : "xcode",
4 | "version" : 1
5 | }
6 | }
--------------------------------------------------------------------------------
/composeApp/src/wasmJsMain/resources/styles.css:
--------------------------------------------------------------------------------
1 | html, body {
2 | width: 100%;
3 | height: 100%;
4 | margin: 0;
5 | padding: 0;
6 | overflow: hidden;
7 | }
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher.png
--------------------------------------------------------------------------------
/composeApp/src/iosMain/kotlin/MainViewController.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.ui.window.ComposeUIViewController
2 |
3 | fun MainViewController() = ComposeUIViewController { App() }
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher_round.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-hdpi/ic_launcher_round.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher_round.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-mdpi/ic_launcher_round.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher_round.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xhdpi/ic_launcher_round.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher_round.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxhdpi/ic_launcher_round.png
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher_round.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/composeApp/src/androidMain/res/mipmap-xxxhdpi/ic_launcher_round.png
--------------------------------------------------------------------------------
/iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/app-icon-1024.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/FaroukAbichou/Kustomize/HEAD/iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/app-icon-1024.png
--------------------------------------------------------------------------------
/.idea/vcs.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
6 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/kotlin/Greeting.kt:
--------------------------------------------------------------------------------
1 | class Greeting {
2 | private val platform = getPlatform()
3 |
4 | fun greet(): String {
5 | return "Hello, ${platform.name}!"
6 | }
7 | }
--------------------------------------------------------------------------------
/.idea/compiler.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
6 |
--------------------------------------------------------------------------------
/composeApp/src/wasmJsMain/kotlin/Platform.wasmJs.kt:
--------------------------------------------------------------------------------
1 | class WasmPlatform: Platform {
2 | override val name: String = "Web with Kotlin/Wasm"
3 | }
4 |
5 | actual fun getPlatform(): Platform = WasmPlatform()
--------------------------------------------------------------------------------
/iosApp/iosApp/iOSApp.swift:
--------------------------------------------------------------------------------
1 | import SwiftUI
2 |
3 | @main
4 | struct iOSApp: App {
5 | var body: some Scene {
6 | WindowGroup {
7 | ContentView()
8 | }
9 | }
10 | }
--------------------------------------------------------------------------------
/.idea/.gitignore:
--------------------------------------------------------------------------------
1 | # Default ignored files
2 | /shelf/
3 | /workspace.xml
4 | # Editor-based HTTP Client requests
5 | /httpRequests/
6 | # Datasource local storage ignored files
7 | /dataSources/
8 | /dataSources.local.xml
9 |
--------------------------------------------------------------------------------
/composeApp/src/desktopMain/kotlin/Platform.jvm.kt:
--------------------------------------------------------------------------------
1 | class JVMPlatform: Platform {
2 | override val name: String = "Java ${System.getProperty("java.version")}"
3 | }
4 |
5 | actual fun getPlatform(): Platform = JVMPlatform()
--------------------------------------------------------------------------------
/iosApp/iosApp/Assets.xcassets/AccentColor.colorset/Contents.json:
--------------------------------------------------------------------------------
1 | {
2 | "colors" : [
3 | {
4 | "idiom" : "universal"
5 | }
6 | ],
7 | "info" : {
8 | "author" : "xcode",
9 | "version" : 1
10 | }
11 | }
--------------------------------------------------------------------------------
/composeApp/src/androidMain/kotlin/Platform.android.kt:
--------------------------------------------------------------------------------
1 | import android.os.Build
2 |
3 | class AndroidPlatform : Platform {
4 | override val name: String = "Android ${Build.VERSION.SDK_INT}"
5 | }
6 |
7 | actual fun getPlatform(): Platform = AndroidPlatform()
--------------------------------------------------------------------------------
/composeApp/src/iosMain/kotlin/Platform.ios.kt:
--------------------------------------------------------------------------------
1 | import platform.UIKit.UIDevice
2 |
3 | class IOSPlatform: Platform {
4 | override val name: String = UIDevice.currentDevice.systemName() + " " + UIDevice.currentDevice.systemVersion
5 | }
6 |
7 | actual fun getPlatform(): Platform = IOSPlatform()
--------------------------------------------------------------------------------
/.idea/deploymentTargetDropDown.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
6 |
7 |
8 |
9 |
10 |
--------------------------------------------------------------------------------
/gradle/wrapper/gradle-wrapper.properties:
--------------------------------------------------------------------------------
1 | distributionBase=GRADLE_USER_HOME
2 | distributionPath=wrapper/dists
3 | distributionUrl=https\://services.gradle.org/distributions/gradle-8.7-bin.zip
4 | networkTimeout=10000
5 | validateDistributionUrl=true
6 | zipStoreBase=GRADLE_USER_HOME
7 | zipStorePath=wrapper/dists
8 |
--------------------------------------------------------------------------------
/composeApp/src/desktopMain/kotlin/main.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.ui.window.Window
2 | import androidx.compose.ui.window.application
3 |
4 | fun main() = application {
5 | Window(
6 | onCloseRequest = ::exitApplication,
7 | title = "Kustomize",
8 | ) {
9 | App()
10 | }
11 | }
--------------------------------------------------------------------------------
/gradle.properties:
--------------------------------------------------------------------------------
1 | kotlin.code.style=official
2 |
3 | #Gradle
4 | org.gradle.jvmargs=-Xmx2048M -Dfile.encoding=UTF-8 -Dkotlin.daemon.jvm.options\="-Xmx2048M"
5 |
6 | #Android
7 | android.nonTransitiveRClass=true
8 | android.useAndroidX=true
9 |
10 | #Kotlin Multiplatform
11 | kotlin.mpp.enableCInteropCommonization=true
--------------------------------------------------------------------------------
/local.properties:
--------------------------------------------------------------------------------
1 | ## This file must *NOT* be checked into Version Control Systems,
2 | # as it contains information specific to your local configuration.
3 | #
4 | # Location of the SDK. This is only used by Gradle.
5 | # For customization when using a Version Control System, please read the
6 | # header note.
7 |
8 | sdk.dir=
9 |
--------------------------------------------------------------------------------
/composeApp/src/wasmJsMain/kotlin/main.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.ui.ExperimentalComposeUiApi
2 | import androidx.compose.ui.window.ComposeViewport
3 | import kotlinx.browser.document
4 |
5 | @OptIn(ExperimentalComposeUiApi::class)
6 | fun main() {
7 | ComposeViewport(document.body!!) {
8 | App()
9 | }
10 | }
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-anydpi-v26/ic_launcher.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
--------------------------------------------------------------------------------
/iosApp/iosApp/Assets.xcassets/AppIcon.appiconset/Contents.json:
--------------------------------------------------------------------------------
1 | {
2 | "images" : [
3 | {
4 | "filename" : "app-icon-1024.png",
5 | "idiom" : "universal",
6 | "platform" : "ios",
7 | "size" : "1024x1024"
8 | }
9 | ],
10 | "info" : {
11 | "author" : "xcode",
12 | "version" : 1
13 | }
14 | }
15 |
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/mipmap-anydpi-v26/ic_launcher_round.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
--------------------------------------------------------------------------------
/.idea/artifacts/composeApp_desktop.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 | $PROJECT_DIR$/composeApp/build/libs
4 |
5 |
6 |
7 |
8 |
--------------------------------------------------------------------------------
/.idea/artifacts/composeApp_wasm_js.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 | $PROJECT_DIR$/composeApp/build/libs
4 |
5 |
6 |
7 |
8 |
--------------------------------------------------------------------------------
/composeApp/src/wasmJsMain/resources/index.html:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
6 | Kustomize
7 |
8 |
9 |
10 |
11 |
12 |
--------------------------------------------------------------------------------
/.idea/misc.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
6 |
7 |
8 |
9 |
--------------------------------------------------------------------------------
/iosApp/iosApp/ContentView.swift:
--------------------------------------------------------------------------------
1 | import UIKit
2 | import SwiftUI
3 | import ComposeApp
4 |
5 | struct ComposeView: UIViewControllerRepresentable {
6 | func makeUIViewController(context: Context) -> UIViewController {
7 | MainViewControllerKt.MainViewController()
8 | }
9 |
10 | func updateUIViewController(_ uiViewController: UIViewController, context: Context) {}
11 | }
12 |
13 | struct ContentView: View {
14 | var body: some View {
15 | ComposeView()
16 | .ignoresSafeArea(.keyboard) // Compose has own keyboard handler
17 | }
18 | }
19 |
20 |
21 |
22 |
--------------------------------------------------------------------------------
/.idea/gradle.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 |
16 |
17 |
--------------------------------------------------------------------------------
/.gitignore:
--------------------------------------------------------------------------------
1 | .gradle
2 | build/
3 | !gradle/wrapper/gradle-wrapper.jar
4 | !**/src/main/**/build/
5 | !**/src/test/**/build/
6 |
7 | ### IntelliJ IDEA ###
8 | .idea/modules.xml
9 | .idea/jarRepositories.xml
10 | .idea/compiler.xml
11 | .idea/libraries/
12 | *.iws
13 | *.iml
14 | *.ipr
15 | out/
16 | !**/src/main/**/out/
17 | !**/src/test/**/out/
18 |
19 | ### Eclipse ###
20 | .apt_generated
21 | .classpath
22 | .factorypath
23 | .project
24 | .settings
25 | .springBeans
26 | .sts4-cache
27 | bin/
28 | !**/src/main/**/bin/
29 | !**/src/test/**/bin/
30 |
31 | ### NetBeans ###
32 | /nbproject/private/
33 | /nbbuild/
34 | /dist/
35 | /nbdist/
36 | /.nb-gradle/
37 |
38 | ### VS Code ###
39 | .vscode/
40 |
41 | ### Mac OS ###
42 | .DS_Store
--------------------------------------------------------------------------------
/settings.gradle.kts:
--------------------------------------------------------------------------------
1 | rootProject.name = "Kustomize"
2 | enableFeaturePreview("TYPESAFE_PROJECT_ACCESSORS")
3 |
4 | pluginManagement {
5 | repositories {
6 | google {
7 | mavenContent {
8 | includeGroupAndSubgroups("androidx")
9 | includeGroupAndSubgroups("com.android")
10 | includeGroupAndSubgroups("com.google")
11 | }
12 | }
13 | mavenCentral()
14 | gradlePluginPortal()
15 | }
16 | }
17 |
18 | dependencyResolutionManagement {
19 | repositories {
20 | google {
21 | mavenContent {
22 | includeGroupAndSubgroups("androidx")
23 | includeGroupAndSubgroups("com.android")
24 | includeGroupAndSubgroups("com.google")
25 | }
26 | }
27 | mavenCentral()
28 | }
29 | }
30 |
31 | include(":composeApp")
--------------------------------------------------------------------------------
/README.md:
--------------------------------------------------------------------------------
1 | # Kustomize
2 |
3 | Kustomize is a Kotlin Multiplatform project designed as a proof of concept. It showcases how users can customize their user experience by selecting their favorite colors, fonts, and themes. This project aims to demonstrate the potential for user personalization in applications, providing a simple and intuitive interface for making customizations.
4 |
5 | ## Description
6 |
7 | Kustomize allows users to tailor their application's look and feel according to their preferences. By choosing from a variety of colors, fonts, and themes, users can create a personalized experience that suits their tastes. The project leverages Kotlin's multiplatform capabilities to ensure compatibility across different platforms, providing a seamless customization experience.
8 |
9 | ## Links
10 |
11 | - [Design on Figma](https://www.figma.com/community/file/1386770518155212936/kustomize)
12 |
13 | Feel free to explore the design and use it to create your own customized user experiences!
14 |
--------------------------------------------------------------------------------
/composeApp/src/androidMain/AndroidManifest.xml:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
11 |
15 |
16 |
17 |
18 |
19 |
20 |
21 |
22 |
23 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/kotlin/App.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.foundation.Image
2 | import androidx.compose.foundation.background
3 | import androidx.compose.foundation.layout.Box
4 | import androidx.compose.foundation.layout.fillMaxSize
5 | import androidx.compose.runtime.Composable
6 | import androidx.compose.ui.Modifier
7 | import androidx.compose.ui.graphics.Color
8 | import androidx.compose.ui.graphics.ImageBitmap
9 | import kustomize.composeapp.generated.resources.Res
10 | import kustomize.composeapp.generated.resources.comet
11 | import kustomize.composeapp.generated.resources.compose_multiplatform
12 | import kustomize.composeapp.generated.resources.testt
13 | import org.jetbrains.compose.resources.imageResource
14 | import org.jetbrains.compose.resources.painterResource
15 | import org.jetbrains.compose.ui.tooling.preview.Preview
16 |
17 |
18 | @Composable
19 | @Preview
20 | fun App(
21 | // typography: androidx.compose.material.Typography
22 | ) {
23 | Box(
24 | modifier = Modifier
25 | .fillMaxSize()
26 | .background(color = Color(0xff292A30)),
27 | contentAlignment = androidx.compose.ui.Alignment.Center
28 | ){
29 | Image(painterResource(Res.drawable.testt), null)
30 |
31 | }
32 | // MaterialTheme(
33 | //// typography = typography,
34 | // ) {
35 | //
36 | // }
37 | }
--------------------------------------------------------------------------------
/iosApp/iosApp/Info.plist:
--------------------------------------------------------------------------------
1 |
2 |
3 |
4 |
5 | CFBundleDevelopmentRegion
6 | $(DEVELOPMENT_LANGUAGE)
7 | CFBundleExecutable
8 | $(EXECUTABLE_NAME)
9 | CFBundleIdentifier
10 | $(PRODUCT_BUNDLE_IDENTIFIER)
11 | CFBundleInfoDictionaryVersion
12 | 6.0
13 | CFBundleName
14 | $(PRODUCT_NAME)
15 | CFBundlePackageType
16 | $(PRODUCT_BUNDLE_PACKAGE_TYPE)
17 | CFBundleShortVersionString
18 | 1.0
19 | CFBundleVersion
20 | 1
21 | LSRequiresIPhoneOS
22 |
23 | CADisableMinimumFrameDurationOnPhone
24 |
25 | UIApplicationSceneManifest
26 |
27 | UIApplicationSupportsMultipleScenes
28 |
29 |
30 | UILaunchScreen
31 |
32 | UIRequiredDeviceCapabilities
33 |
34 | armv7
35 |
36 | UISupportedInterfaceOrientations
37 |
38 | UIInterfaceOrientationPortrait
39 | UIInterfaceOrientationLandscapeLeft
40 | UIInterfaceOrientationLandscapeRight
41 |
42 | UISupportedInterfaceOrientations~ipad
43 |
44 | UIInterfaceOrientationPortrait
45 | UIInterfaceOrientationPortraitUpsideDown
46 | UIInterfaceOrientationLandscapeLeft
47 | UIInterfaceOrientationLandscapeRight
48 |
49 |
50 |
51 |
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/drawable-v24/ic_launcher_foreground.xml:
--------------------------------------------------------------------------------
1 |
7 |
8 |
9 |
15 |
18 |
21 |
22 |
23 |
24 |
30 |
--------------------------------------------------------------------------------
/gradle/libs.versions.toml:
--------------------------------------------------------------------------------
1 | [versions]
2 | agp = "8.2.0"
3 | android-compileSdk = "34"
4 | android-minSdk = "24"
5 | android-targetSdk = "34"
6 | androidx-activityCompose = "1.9.0"
7 | androidx-appcompat = "1.6.1"
8 | androidx-constraintlayout = "2.1.4"
9 | androidx-core-ktx = "1.13.1"
10 | androidx-espresso-core = "3.5.1"
11 | androidx-material = "1.12.0"
12 | androidx-test-junit = "1.1.5"
13 | compose-plugin = "1.6.10"
14 | junit = "4.13.2"
15 | kotlin = "2.0.0"
16 | firebaseCrashlyticsBuildtools = "3.0.2"
17 |
18 | [libraries]
19 | kotlin-test = { module = "org.jetbrains.kotlin:kotlin-test", version.ref = "kotlin" }
20 | kotlin-test-junit = { module = "org.jetbrains.kotlin:kotlin-test-junit", version.ref = "kotlin" }
21 | junit = { group = "junit", name = "junit", version.ref = "junit" }
22 | androidx-core-ktx = { group = "androidx.core", name = "core-ktx", version.ref = "androidx-core-ktx" }
23 | androidx-test-junit = { group = "androidx.test.ext", name = "junit", version.ref = "androidx-test-junit" }
24 | androidx-espresso-core = { group = "androidx.test.espresso", name = "espresso-core", version.ref = "androidx-espresso-core" }
25 | androidx-appcompat = { group = "androidx.appcompat", name = "appcompat", version.ref = "androidx-appcompat" }
26 | androidx-material = { group = "com.google.android.material", name = "material", version.ref = "androidx-material" }
27 | androidx-constraintlayout = { group = "androidx.constraintlayout", name = "constraintlayout", version.ref = "androidx-constraintlayout" }
28 | androidx-activity-compose = { module = "androidx.activity:activity-compose", version.ref = "androidx-activityCompose" }
29 | firebase-crashlytics-buildtools = { group = "com.google.firebase", name = "firebase-crashlytics-buildtools", version.ref = "firebaseCrashlyticsBuildtools" }
30 |
31 | [plugins]
32 | androidApplication = { id = "com.android.application", version.ref = "agp" }
33 | androidLibrary = { id = "com.android.library", version.ref = "agp" }
34 | jetbrainsCompose = { id = "org.jetbrains.compose", version.ref = "compose-plugin" }
35 | compose-compiler = { id = "org.jetbrains.kotlin.plugin.compose", version.ref = "kotlin" }
36 | kotlinMultiplatform = { id = "org.jetbrains.kotlin.multiplatform", version.ref = "kotlin" }
--------------------------------------------------------------------------------
/gradlew.bat:
--------------------------------------------------------------------------------
1 | @rem
2 | @rem Copyright 2015 the original author or authors.
3 | @rem
4 | @rem Licensed under the Apache License, Version 2.0 (the "License");
5 | @rem you may not use this file except in compliance with the License.
6 | @rem You may obtain a copy of the License at
7 | @rem
8 | @rem https://www.apache.org/licenses/LICENSE-2.0
9 | @rem
10 | @rem Unless required by applicable law or agreed to in writing, software
11 | @rem distributed under the License is distributed on an "AS IS" BASIS,
12 | @rem WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
13 | @rem See the License for the specific language governing permissions and
14 | @rem limitations under the License.
15 | @rem
16 |
17 | @if "%DEBUG%"=="" @echo off
18 | @rem ##########################################################################
19 | @rem
20 | @rem Gradle startup script for Windows
21 | @rem
22 | @rem ##########################################################################
23 |
24 | @rem Set local scope for the variables with windows NT shell
25 | if "%OS%"=="Windows_NT" setlocal
26 |
27 | set DIRNAME=%~dp0
28 | if "%DIRNAME%"=="" set DIRNAME=.
29 | @rem This is normally unused
30 | set APP_BASE_NAME=%~n0
31 | set APP_HOME=%DIRNAME%
32 |
33 | @rem Resolve any "." and ".." in APP_HOME to make it shorter.
34 | for %%i in ("%APP_HOME%") do set APP_HOME=%%~fi
35 |
36 | @rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
37 | set DEFAULT_JVM_OPTS="-Xmx64m" "-Xms64m"
38 |
39 | @rem Find java.exe
40 | if defined JAVA_HOME goto findJavaFromJavaHome
41 |
42 | set JAVA_EXE=java.exe
43 | %JAVA_EXE% -version >NUL 2>&1
44 | if %ERRORLEVEL% equ 0 goto execute
45 |
46 | echo.
47 | echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
48 | echo.
49 | echo Please set the JAVA_HOME variable in your environment to match the
50 | echo location of your Java installation.
51 |
52 | goto fail
53 |
54 | :findJavaFromJavaHome
55 | set JAVA_HOME=%JAVA_HOME:"=%
56 | set JAVA_EXE=%JAVA_HOME%/bin/java.exe
57 |
58 | if exist "%JAVA_EXE%" goto execute
59 |
60 | echo.
61 | echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME%
62 | echo.
63 | echo Please set the JAVA_HOME variable in your environment to match the
64 | echo location of your Java installation.
65 |
66 | goto fail
67 |
68 | :execute
69 | @rem Setup the command line
70 |
71 | set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar
72 |
73 |
74 | @rem Execute Gradle
75 | "%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %*
76 |
77 | :end
78 | @rem End local scope for the variables with windows NT shell
79 | if %ERRORLEVEL% equ 0 goto mainEnd
80 |
81 | :fail
82 | rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of
83 | rem the _cmd.exe /c_ return code!
84 | set EXIT_CODE=%ERRORLEVEL%
85 | if %EXIT_CODE% equ 0 set EXIT_CODE=1
86 | if not ""=="%GRADLE_EXIT_CONSOLE%" exit %EXIT_CODE%
87 | exit /b %EXIT_CODE%
88 |
89 | :mainEnd
90 | if "%OS%"=="Windows_NT" endlocal
91 |
92 | :omega
93 |
--------------------------------------------------------------------------------
/composeApp/src/androidMain/kotlin/org/faroukabichou/kustomize/MainActivity.kt:
--------------------------------------------------------------------------------
1 | package org.faroukabichou.kustomize
2 |
3 | import App
4 | import android.os.Bundle
5 | import android.util.Base64
6 | import androidx.activity.ComponentActivity
7 | import androidx.activity.compose.setContent
8 | import androidx.compose.ui.text.font.FontFamily
9 | import androidx.compose.ui.text.googlefonts.Font
10 | import androidx.compose.ui.text.googlefonts.GoogleFont
11 |
12 | class MainActivity : ComponentActivity() {
13 | override fun onCreate(savedInstanceState: Bundle?) {
14 | super.onCreate(savedInstanceState)
15 |
16 | val devCert = "MIIEqDCCA5CgAwIBAgIJANWFuGx90071MA0GCSqGSIb3DQEBBAUAMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTAeFw0wODA0MTUyMzM2NTZaFw0zNTA5MDEyMzM2NTZaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBANbOLggKv+IxTdGNs8/TGFy0PTP6DHThvbbR24kT9ixcOd9W+EaBPWW+wPPKQmsHxajtWjmQwWfna8mZuSeJS48LIgAZlKkpFeVyxW0qMBujb8X8ETrWy550NaFtI6t9+u7hZeTfHwqNvacKhp1RbE6dBRGWynwMVX8XW8N1+UjFaq6GCJukT4qmpN2afb8sCjUigq0GuMwYXrFVee74bQgLHWGJwPmvmLHC69EH6kWr22ijx4OKXlSIx2xT1AsSHee70w5iDBiK4aph27yH3TxkXy9V89TDdexAcKk/cVHYNnDBapcavl7y0RiQ4biu8ymM8Ga/nmzhRKya6G0cGw8CAQOjgfwwgfkwHQYDVR0OBBYEFI0cxb6VTEM8YYY6FbBMvAPyT+CyMIHJBgNVHSMEgcEwgb6AFI0cxb6VTEM8YYY6FbBMvAPyT+CyoYGapIGXMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbYIJANWFuGx90071MAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEEBQADggEBABnTDPEF+3iSP0wNfdIjIz1AlnrPzgAIHVvXxunW7SBrDhEglQZBbKJEk5kT0mtKoOD1JMrSu1xuTKEBahWRbqHsXclaXjoBADb0kkjVEJu/Lh5hgYZnOjvlba8Ld7HCKePCVePoTJBdI4fvugnL8TsgK05aIskyY0hKI9L8KfqfGTl1lzOv2KoWD0KWwtAWPoGChZxmQ+nBli+gwYMzM1vAkP+aayLe0a1EQimlOalO762r0GXO0ks+UeXde2Z4e+8S/pf7pITEI/tP+MxJTALw9QUWEv9lKTk+jkbqxbsh8nfBUapfKqYn0eidpwq2AzVp3juYl7//fKnaPhJD9gs="
17 | val prodCert = "MIIEQzCCAyugAwIBAgIJAMLgh0ZkSjCNMA0GCSqGSIb3DQEBBAUAMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDAeFw0wODA4MjEyMzEzMzRaFw0zNjAxMDcyMzEzMzRaMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBAKtWLgDYO6IIrgqWbxJOKdoR8qtW0I9Y4sypEwPpt1TTcvZApxsdyxMJZ2JORland2qSGT2y5b"
18 |
19 | val devCertBytes = Base64.decode(devCert, Base64.DEFAULT)
20 | val prodCertBytes = Base64.decode(prodCert, Base64.DEFAULT)
21 |
22 | val certsList: List> = listOf(
23 | listOf(devCertBytes),
24 | listOf(prodCertBytes)
25 | )
26 | val provider = GoogleFont.Provider(
27 | providerAuthority = "com.google.android.gms.fonts",
28 | providerPackage = "com.google.android.gms",
29 | certificates = certsList
30 | )
31 | val fontName = GoogleFont("Lobster Two")
32 | val fontFamily = FontFamily(
33 | Font(googleFont = fontName, fontProvider = provider)
34 | )
35 | setContent {
36 | App(
37 | typography = androidx.compose.material.Typography(
38 | defaultFontFamily = fontFamily
39 | )
40 | )
41 | }
42 | }
43 | }
--------------------------------------------------------------------------------
/composeApp/src/commonMain/composeResources/font/font_certs.xml:
--------------------------------------------------------------------------------
1 |
2 |
17 |
18 |
19 | - @array/com_google_android_gms_fonts_certs_dev
20 | - @array/com_google_android_gms_fonts_certs_prod
21 |
22 |
23 | -
24 | MIIEqDCCA5CgAwIBAgIJANWFuGx90071MA0GCSqGSIb3DQEBBAUAMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTAeFw0wODA0MTUyMzM2NTZaFw0zNTA5MDEyMzM2NTZaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbTCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBANbOLggKv+IxTdGNs8/TGFy0PTP6DHThvbbR24kT9ixcOd9W+EaBPWW+wPPKQmsHxajtWjmQwWfna8mZuSeJS48LIgAZlKkpFeVyxW0qMBujb8X8ETrWy550NaFtI6t9+u7hZeTfHwqNvacKhp1RbE6dBRGWynwMVX8XW8N1+UjFaq6GCJukT4qmpN2afb8sCjUigq0GuMwYXrFVee74bQgLHWGJwPmvmLHC69EH6kWr22ijx4OKXlSIx2xT1AsSHee70w5iDBiK4aph27yH3TxkXy9V89TDdexAcKk/cVHYNnDBapcavl7y0RiQ4biu8ymM8Ga/nmzhRKya6G0cGw8CAQOjgfwwgfkwHQYDVR0OBBYEFI0cxb6VTEM8YYY6FbBMvAPyT+CyMIHJBgNVHSMEgcEwgb6AFI0cxb6VTEM8YYY6FbBMvAPyT+CyoYGapIGXMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEQMA4GA1UEChMHQW5kcm9pZDEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDEiMCAGCSqGSIb3DQEJARYTYW5kcm9pZEBhbmRyb2lkLmNvbYIJANWFuGx90071MAwGA1UdEwQFMAMBAf8wDQYJKoZIhvcNAQEEBQADggEBABnTDPEF+3iSP0wNfdIjIz1AlnrPzgAIHVvXxunW7SBrDhEglQZBbKJEk5kT0mtKoOD1JMrSu1xuTKEBahWRbqHsXclaXjoBADb0kkjVEJu/Lh5hgYZnOjvlba8Ld7HCKePCVePoTJBdI4fvugnL8TsgK05aIskyY0hKI9L8KfqfGTl1lzOv2KoWD0KWwtAWPoGChZxmQ+nBli+gwYMzM1vAkP+aayLe0a1EQimlOalO762r0GXO0ks+UeXde2Z4e+8S/pf7pITEI/tP+MxJTALw9QUWEv9lKTk+jkbqxbsh8nfBUapfKqYn0eidpwq2AzVp3juYl7//fKnaPhJD9gs=
25 |
26 |
27 |
28 | -
29 | MIIEQzCCAyugAwIBAgIJAMLgh0ZkSjCNMA0GCSqGSIb3DQEBBAUAMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDAeFw0wODA4MjEyMzEzMzRaFw0zNjAxMDcyMzEzMzRaMHQxCzAJBgNVBAYTAlVTMRMwEQYDVQQIEwpDYWxpZm9ybmlhMRYwFAYDVQQHEw1Nb3VudGFpbiBWaWV3MRQwEgYDVQQKEwtHb29nbGUgSW5jLjEQMA4GA1UECxMHQW5kcm9pZDEQMA4GA1UEAxMHQW5kcm9pZDCCASAwDQYJKoZIhvcNAQEBBQADggENADCCAQgCggEBAKtWLgDYO6IIrgqWbxJOKdoR8qtW0I9Y4sypEwPpt1TTcvZApxsdyxMJZ2JORland2qSGT2y5b+3JKkedxiLDmpHpDsz2WCbdxgxRczfey5YZnTJ4VZbH0xqWVW/8lGmPav5xVwnIiJS6HXk+BVKZF+JcWjAsb/GEuq/eFdpuzSqeYTcfi6idkyugwfYwXFU1+5fZKUaRKYCwkkFQVfcAs1fXA5V+++FGfvjJ/CxURaSxaBvGdGDhfXE28LWuT9ozCl5xw4Yq5OGazvV24mZVSoOO0yZ31j7kYvtwYK6NeADwbSxDdJEqO4k//0zOHKrUiGYXtqw/A0LFFtqoZKFjnkCAQOjgdkwgdYwHQYDVR0OBBYEFMd9jMIhF1Ylmn/Tgt9r45jk14alMIGmBgNVHSMEgZ4wgZuAFMd9jMIhF1Ylmn/Tgt9r45jk14aloXikdjB0MQswCQYDVQQGEwJVUzETMBEGA1UECBMKQ2FsaWZvcm5pYTEWMBQGA1UEBxMNTW91bnRhaW4gVmlldzEUMBIGA1UEChMLR29vZ2xlIEluYy4xEDAOBgNVBAsTB0FuZHJvaWQxEDAOBgNVBAMTB0FuZHJvaWSCCQDC4IdGZEowjTAMBgNVHRMEBTADAQH/MA0GCSqGSIb3DQEBBAUAA4IBAQBt0lLO74UwLDYKqs6Tm8/yzKkEu116FmH4rkaymUIE0P9KaMftGlMexFlaYjzmB2OxZyl6euNXEsQH8gjwyxCUKRJNexBiGcCEyj6z+a1fuHHvkiaai+KL8W1EyNmgjmyy8AW7P+LLlkR+ho5zEHatRbM/YAnqGcFh5iZBqpknHf1SKMXFh4dd239FJ1jWYfbMDMy3NS5CTMQ2XFI1MvcyUTdZPErjQfTbQe3aDQsQcafEQPD+nqActifKZ0Np0IS9L9kR/wbNvyz6ENwPiTrjV2KRkEjH78ZMcUQXg0L3BYHJ3lc69Vs5Ddf9uUGGMYldX3WfMBEmh/9iFBDAaTCK
30 |
31 |
32 |
--------------------------------------------------------------------------------
/composeApp/build.gradle.kts:
--------------------------------------------------------------------------------
1 | import org.jetbrains.compose.desktop.application.dsl.TargetFormat
2 | import org.jetbrains.kotlin.gradle.ExperimentalKotlinGradlePluginApi
3 | import org.jetbrains.kotlin.gradle.dsl.JvmTarget
4 | import org.jetbrains.kotlin.gradle.targets.js.dsl.ExperimentalWasmDsl
5 | import org.jetbrains.kotlin.gradle.targets.js.webpack.KotlinWebpackConfig
6 |
7 | plugins {
8 | alias(libs.plugins.kotlinMultiplatform)
9 | alias(libs.plugins.androidApplication)
10 | alias(libs.plugins.jetbrainsCompose)
11 | alias(libs.plugins.compose.compiler)
12 | }
13 |
14 | kotlin {
15 | @OptIn(ExperimentalWasmDsl::class)
16 | wasmJs {
17 | moduleName = "composeApp"
18 | browser {
19 | commonWebpackConfig {
20 | outputFileName = "composeApp.js"
21 | devServer = (devServer ?: KotlinWebpackConfig.DevServer()).apply {
22 | static = (static ?: mutableListOf()).apply {
23 | // Serve sources to debug inside browser
24 | add(project.projectDir.path)
25 | }
26 | }
27 | }
28 | }
29 | binaries.executable()
30 | }
31 |
32 | androidTarget {
33 | @OptIn(ExperimentalKotlinGradlePluginApi::class)
34 | compilerOptions {
35 | jvmTarget.set(JvmTarget.JVM_11)
36 | }
37 | }
38 |
39 | jvm("desktop")
40 |
41 | listOf(
42 | iosX64(),
43 | iosArm64(),
44 | iosSimulatorArm64()
45 | ).forEach { iosTarget ->
46 | iosTarget.binaries.framework {
47 | baseName = "ComposeApp"
48 | isStatic = true
49 | }
50 | }
51 |
52 | sourceSets {
53 | val desktopMain by getting
54 |
55 | androidMain.dependencies {
56 | implementation(compose.preview)
57 | implementation(libs.androidx.activity.compose)
58 | implementation("androidx.compose.ui:ui-text-google-fonts:1.6.8")
59 | }
60 | commonMain.dependencies {
61 | implementation(compose.runtime)
62 | implementation(compose.foundation)
63 | implementation(compose.material)
64 | implementation(compose.ui)
65 | implementation(compose.components.resources)
66 | implementation(compose.components.uiToolingPreview)
67 | }
68 | desktopMain.dependencies {
69 | implementation(compose.desktop.currentOs)
70 | }
71 | }
72 | }
73 |
74 | android {
75 | namespace = "org.faroukabichou.kustomize"
76 | compileSdk = libs.versions.android.compileSdk.get().toInt()
77 |
78 | sourceSets["main"].manifest.srcFile("src/androidMain/AndroidManifest.xml")
79 | sourceSets["main"].res.srcDirs("src/androidMain/res")
80 | sourceSets["main"].resources.srcDirs("src/commonMain/resources")
81 |
82 | defaultConfig {
83 | applicationId = "org.faroukabichou.kustomize"
84 | minSdk = libs.versions.android.minSdk.get().toInt()
85 | targetSdk = libs.versions.android.targetSdk.get().toInt()
86 | versionCode = 1
87 | versionName = "1.0"
88 | }
89 | packaging {
90 | resources {
91 | excludes += "/META-INF/{AL2.0,LGPL2.1}"
92 | }
93 | }
94 | buildTypes {
95 | getByName("release") {
96 | isMinifyEnabled = false
97 | }
98 | }
99 | compileOptions {
100 | sourceCompatibility = JavaVersion.VERSION_11
101 | targetCompatibility = JavaVersion.VERSION_11
102 | }
103 | buildFeatures {
104 | compose = true
105 | }
106 | dependencies {
107 | debugImplementation(compose.uiTooling)
108 | }
109 | }
110 | dependencies {
111 | implementation(libs.firebase.crashlytics.buildtools)
112 | }
113 |
114 | compose.desktop {
115 | application {
116 | mainClass = "MainKt"
117 |
118 | nativeDistributions {
119 | targetFormats(TargetFormat.Dmg, TargetFormat.Msi, TargetFormat.Deb)
120 | packageName = "org.faroukabichou.kustomize"
121 | packageVersion = "1.0.0"
122 | }
123 | }
124 | }
125 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/composeResources/drawable/compose-multiplatform.xml:
--------------------------------------------------------------------------------
1 |
6 |
10 |
14 |
18 |
24 |
30 |
36 |
--------------------------------------------------------------------------------
/composeApp/src/androidMain/res/drawable/ic_launcher_background.xml:
--------------------------------------------------------------------------------
1 |
2 |
7 |
10 |
15 |
20 |
25 |
30 |
35 |
40 |
45 |
50 |
55 |
60 |
65 |
70 |
75 |
80 |
85 |
90 |
95 |
100 |
105 |
110 |
115 |
120 |
125 |
130 |
135 |
140 |
145 |
150 |
155 |
160 |
165 |
170 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/composeResources/drawable/testt.svg:
--------------------------------------------------------------------------------
1 |
82 |
--------------------------------------------------------------------------------
/gradlew:
--------------------------------------------------------------------------------
1 | #!/bin/sh
2 |
3 | #
4 | # Copyright © 2015-2021 the original authors.
5 | #
6 | # Licensed under the Apache License, Version 2.0 (the "License");
7 | # you may not use this file except in compliance with the License.
8 | # You may obtain a copy of the License at
9 | #
10 | # https://www.apache.org/licenses/LICENSE-2.0
11 | #
12 | # Unless required by applicable law or agreed to in writing, software
13 | # distributed under the License is distributed on an "AS IS" BASIS,
14 | # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
15 | # See the License for the specific language governing permissions and
16 | # limitations under the License.
17 | #
18 |
19 | ##############################################################################
20 | #
21 | # Gradle start up script for POSIX generated by Gradle.
22 | #
23 | # Important for running:
24 | #
25 | # (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
26 | # noncompliant, but you have some other compliant shell such as ksh or
27 | # bash, then to run this script, type that shell name before the whole
28 | # command line, like:
29 | #
30 | # ksh Gradle
31 | #
32 | # Busybox and similar reduced shells will NOT work, because this script
33 | # requires all of these POSIX shell features:
34 | # * functions;
35 | # * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
36 | # «${var#prefix}», «${var%suffix}», and «$( cmd )»;
37 | # * compound commands having a testable exit status, especially «case»;
38 | # * various built-in commands including «command», «set», and «ulimit».
39 | #
40 | # Important for patching:
41 | #
42 | # (2) This script targets any POSIX shell, so it avoids extensions provided
43 | # by Bash, Ksh, etc; in particular arrays are avoided.
44 | #
45 | # The "traditional" practice of packing multiple parameters into a
46 | # space-separated string is a well documented source of bugs and security
47 | # problems, so this is (mostly) avoided, by progressively accumulating
48 | # options in "$@", and eventually passing that to Java.
49 | #
50 | # Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
51 | # and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
52 | # see the in-line comments for details.
53 | #
54 | # There are tweaks for specific operating systems such as AIX, CygWin,
55 | # Darwin, MinGW, and NonStop.
56 | #
57 | # (3) This script is generated from the Groovy template
58 | # https://github.com/gradle/gradle/blob/HEAD/subprojects/plugins/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
59 | # within the Gradle project.
60 | #
61 | # You can find Gradle at https://github.com/gradle/gradle/.
62 | #
63 | ##############################################################################
64 |
65 | # Attempt to set APP_HOME
66 |
67 | # Resolve links: $0 may be a link
68 | app_path=$0
69 |
70 | # Need this for daisy-chained symlinks.
71 | while
72 | APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path
73 | [ -h "$app_path" ]
74 | do
75 | ls=$( ls -ld "$app_path" )
76 | link=${ls#*' -> '}
77 | case $link in #(
78 | /*) app_path=$link ;; #(
79 | *) app_path=$APP_HOME$link ;;
80 | esac
81 | done
82 |
83 | # This is normally unused
84 | # shellcheck disable=SC2034
85 | APP_BASE_NAME=${0##*/}
86 | # Discard cd standard output in case $CDPATH is set (https://github.com/gradle/gradle/issues/25036)
87 | APP_HOME=$( cd "${APP_HOME:-./}" > /dev/null && pwd -P ) || exit
88 |
89 | # Use the maximum available, or set MAX_FD != -1 to use that value.
90 | MAX_FD=maximum
91 |
92 | warn () {
93 | echo "$*"
94 | } >&2
95 |
96 | die () {
97 | echo
98 | echo "$*"
99 | echo
100 | exit 1
101 | } >&2
102 |
103 | # OS specific support (must be 'true' or 'false').
104 | cygwin=false
105 | msys=false
106 | darwin=false
107 | nonstop=false
108 | case "$( uname )" in #(
109 | CYGWIN* ) cygwin=true ;; #(
110 | Darwin* ) darwin=true ;; #(
111 | MSYS* | MINGW* ) msys=true ;; #(
112 | NONSTOP* ) nonstop=true ;;
113 | esac
114 |
115 | CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar
116 |
117 |
118 | # Determine the Java command to use to start the JVM.
119 | if [ -n "$JAVA_HOME" ] ; then
120 | if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
121 | # IBM's JDK on AIX uses strange locations for the executables
122 | JAVACMD=$JAVA_HOME/jre/sh/java
123 | else
124 | JAVACMD=$JAVA_HOME/bin/java
125 | fi
126 | if [ ! -x "$JAVACMD" ] ; then
127 | die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
128 |
129 | Please set the JAVA_HOME variable in your environment to match the
130 | location of your Java installation."
131 | fi
132 | else
133 | JAVACMD=java
134 | if ! command -v java >/dev/null 2>&1
135 | then
136 | die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
137 |
138 | Please set the JAVA_HOME variable in your environment to match the
139 | location of your Java installation."
140 | fi
141 | fi
142 |
143 | # Increase the maximum file descriptors if we can.
144 | if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
145 | case $MAX_FD in #(
146 | max*)
147 | # In POSIX sh, ulimit -H is undefined. That's why the result is checked to see if it worked.
148 | # shellcheck disable=SC2039,SC3045
149 | MAX_FD=$( ulimit -H -n ) ||
150 | warn "Could not query maximum file descriptor limit"
151 | esac
152 | case $MAX_FD in #(
153 | '' | soft) :;; #(
154 | *)
155 | # In POSIX sh, ulimit -n is undefined. That's why the result is checked to see if it worked.
156 | # shellcheck disable=SC2039,SC3045
157 | ulimit -n "$MAX_FD" ||
158 | warn "Could not set maximum file descriptor limit to $MAX_FD"
159 | esac
160 | fi
161 |
162 | # Collect all arguments for the java command, stacking in reverse order:
163 | # * args from the command line
164 | # * the main class name
165 | # * -classpath
166 | # * -D...appname settings
167 | # * --module-path (only if needed)
168 | # * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
169 |
170 | # For Cygwin or MSYS, switch paths to Windows format before running java
171 | if "$cygwin" || "$msys" ; then
172 | APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
173 | CLASSPATH=$( cygpath --path --mixed "$CLASSPATH" )
174 |
175 | JAVACMD=$( cygpath --unix "$JAVACMD" )
176 |
177 | # Now convert the arguments - kludge to limit ourselves to /bin/sh
178 | for arg do
179 | if
180 | case $arg in #(
181 | -*) false ;; # don't mess with options #(
182 | /?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath
183 | [ -e "$t" ] ;; #(
184 | *) false ;;
185 | esac
186 | then
187 | arg=$( cygpath --path --ignore --mixed "$arg" )
188 | fi
189 | # Roll the args list around exactly as many times as the number of
190 | # args, so each arg winds up back in the position where it started, but
191 | # possibly modified.
192 | #
193 | # NB: a `for` loop captures its iteration list before it begins, so
194 | # changing the positional parameters here affects neither the number of
195 | # iterations, nor the values presented in `arg`.
196 | shift # remove old arg
197 | set -- "$@" "$arg" # push replacement arg
198 | done
199 | fi
200 |
201 |
202 | # Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
203 | DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
204 |
205 | # Collect all arguments for the java command:
206 | # * DEFAULT_JVM_OPTS, JAVA_OPTS, JAVA_OPTS, and optsEnvironmentVar are not allowed to contain shell fragments,
207 | # and any embedded shellness will be escaped.
208 | # * For example: A user cannot expect ${Hostname} to be expanded, as it is an environment variable and will be
209 | # treated as '${Hostname}' itself on the command line.
210 |
211 | set -- \
212 | "-Dorg.gradle.appname=$APP_BASE_NAME" \
213 | -classpath "$CLASSPATH" \
214 | org.gradle.wrapper.GradleWrapperMain \
215 | "$@"
216 |
217 | # Stop when "xargs" is not available.
218 | if ! command -v xargs >/dev/null 2>&1
219 | then
220 | die "xargs is not available"
221 | fi
222 |
223 | # Use "xargs" to parse quoted args.
224 | #
225 | # With -n1 it outputs one arg per line, with the quotes and backslashes removed.
226 | #
227 | # In Bash we could simply go:
228 | #
229 | # readarray ARGS < <( xargs -n1 <<<"$var" ) &&
230 | # set -- "${ARGS[@]}" "$@"
231 | #
232 | # but POSIX shell has neither arrays nor command substitution, so instead we
233 | # post-process each arg (as a line of input to sed) to backslash-escape any
234 | # character that might be a shell metacharacter, then use eval to reverse
235 | # that process (while maintaining the separation between arguments), and wrap
236 | # the whole thing up as a single "set" statement.
237 | #
238 | # This will of course break if any of these variables contains a newline or
239 | # an unmatched quote.
240 | #
241 |
242 | eval "set -- $(
243 | printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
244 | xargs -n1 |
245 | sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
246 | tr '\n' ' '
247 | )" '"$@"'
248 |
249 | exec "$JAVACMD" "$@"
250 |
--------------------------------------------------------------------------------
/iosApp/iosApp.xcodeproj/project.pbxproj:
--------------------------------------------------------------------------------
1 | // !$*UTF8*$!
2 | {
3 | archiveVersion = 1;
4 | classes = {
5 | };
6 | objectVersion = 56;
7 | objects = {
8 |
9 | /* Begin PBXBuildFile section */
10 | 058557BB273AAA24004C7B11 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 058557BA273AAA24004C7B11 /* Assets.xcassets */; };
11 | 058557D9273AAEEB004C7B11 /* Preview Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */; };
12 | 2152FB042600AC8F00CF470E /* iOSApp.swift in Sources */ = {isa = PBXBuildFile; fileRef = 2152FB032600AC8F00CF470E /* iOSApp.swift */; };
13 | 7555FF83242A565900829871 /* ContentView.swift in Sources */ = {isa = PBXBuildFile; fileRef = 7555FF82242A565900829871 /* ContentView.swift */; };
14 | /* End PBXBuildFile section */
15 |
16 | /* Begin PBXFileReference section */
17 | 058557BA273AAA24004C7B11 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = Assets.xcassets; sourceTree = ""; };
18 | 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = "Preview Assets.xcassets"; sourceTree = ""; };
19 | 2152FB032600AC8F00CF470E /* iOSApp.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = iOSApp.swift; sourceTree = ""; };
20 | 7555FF7B242A565900829871 /* Kustomize.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = Kustomize.app; sourceTree = BUILT_PRODUCTS_DIR; };
21 | 7555FF82242A565900829871 /* ContentView.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = ContentView.swift; sourceTree = ""; };
22 | 7555FF8C242A565B00829871 /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; path = Info.plist; sourceTree = ""; };
23 | AB3632DC29227652001CCB65 /* Config.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Config.xcconfig; sourceTree = ""; };
24 | /* End PBXFileReference section */
25 |
26 | /* Begin PBXFrameworksBuildPhase section */
27 | B92378962B6B1156000C7307 /* Frameworks */ = {
28 | isa = PBXFrameworksBuildPhase;
29 | buildActionMask = 2147483647;
30 | files = (
31 | );
32 | runOnlyForDeploymentPostprocessing = 0;
33 | };
34 | /* End PBXFrameworksBuildPhase section */
35 |
36 | /* Begin PBXGroup section */
37 | 058557D7273AAEEB004C7B11 /* Preview Content */ = {
38 | isa = PBXGroup;
39 | children = (
40 | 058557D8273AAEEB004C7B11 /* Preview Assets.xcassets */,
41 | );
42 | path = "Preview Content";
43 | sourceTree = "";
44 | };
45 | 42799AB246E5F90AF97AA0EF /* Frameworks */ = {
46 | isa = PBXGroup;
47 | children = (
48 | );
49 | name = Frameworks;
50 | sourceTree = "";
51 | };
52 | 7555FF72242A565900829871 = {
53 | isa = PBXGroup;
54 | children = (
55 | AB1DB47929225F7C00F7AF9C /* Configuration */,
56 | 7555FF7D242A565900829871 /* iosApp */,
57 | 7555FF7C242A565900829871 /* Products */,
58 | 42799AB246E5F90AF97AA0EF /* Frameworks */,
59 | );
60 | sourceTree = "";
61 | };
62 | 7555FF7C242A565900829871 /* Products */ = {
63 | isa = PBXGroup;
64 | children = (
65 | 7555FF7B242A565900829871 /* Kustomize.app */,
66 | );
67 | name = Products;
68 | sourceTree = "";
69 | };
70 | 7555FF7D242A565900829871 /* iosApp */ = {
71 | isa = PBXGroup;
72 | children = (
73 | 058557BA273AAA24004C7B11 /* Assets.xcassets */,
74 | 7555FF82242A565900829871 /* ContentView.swift */,
75 | 7555FF8C242A565B00829871 /* Info.plist */,
76 | 2152FB032600AC8F00CF470E /* iOSApp.swift */,
77 | 058557D7273AAEEB004C7B11 /* Preview Content */,
78 | );
79 | path = iosApp;
80 | sourceTree = "";
81 | };
82 | AB1DB47929225F7C00F7AF9C /* Configuration */ = {
83 | isa = PBXGroup;
84 | children = (
85 | AB3632DC29227652001CCB65 /* Config.xcconfig */,
86 | );
87 | path = Configuration;
88 | sourceTree = "";
89 | };
90 | /* End PBXGroup section */
91 |
92 | /* Begin PBXNativeTarget section */
93 | 7555FF7A242A565900829871 /* iosApp */ = {
94 | isa = PBXNativeTarget;
95 | buildConfigurationList = 7555FFA5242A565B00829871 /* Build configuration list for PBXNativeTarget "iosApp" */;
96 | buildPhases = (
97 | F36B1CEB2AD83DDC00CB74D5 /* Compile Kotlin Framework */,
98 | 7555FF77242A565900829871 /* Sources */,
99 | B92378962B6B1156000C7307 /* Frameworks */,
100 | 7555FF79242A565900829871 /* Resources */,
101 | );
102 | buildRules = (
103 | );
104 | dependencies = (
105 | );
106 | name = iosApp;
107 | packageProductDependencies = (
108 | );
109 | productName = iosApp;
110 | productReference = 7555FF7B242A565900829871 /* Kustomize.app */;
111 | productType = "com.apple.product-type.application";
112 | };
113 | /* End PBXNativeTarget section */
114 |
115 | /* Begin PBXProject section */
116 | 7555FF73242A565900829871 /* Project object */ = {
117 | isa = PBXProject;
118 | attributes = {
119 | BuildIndependentTargetsInParallel = YES;
120 | LastSwiftUpdateCheck = 1130;
121 | LastUpgradeCheck = 1540;
122 | ORGANIZATIONNAME = orgName;
123 | TargetAttributes = {
124 | 7555FF7A242A565900829871 = {
125 | CreatedOnToolsVersion = 11.3.1;
126 | };
127 | };
128 | };
129 | buildConfigurationList = 7555FF76242A565900829871 /* Build configuration list for PBXProject "iosApp" */;
130 | compatibilityVersion = "Xcode 14.0";
131 | developmentRegion = en;
132 | hasScannedForEncodings = 0;
133 | knownRegions = (
134 | en,
135 | Base,
136 | );
137 | mainGroup = 7555FF72242A565900829871;
138 | packageReferences = (
139 | );
140 | productRefGroup = 7555FF7C242A565900829871 /* Products */;
141 | projectDirPath = "";
142 | projectRoot = "";
143 | targets = (
144 | 7555FF7A242A565900829871 /* iosApp */,
145 | );
146 | };
147 | /* End PBXProject section */
148 |
149 | /* Begin PBXResourcesBuildPhase section */
150 | 7555FF79242A565900829871 /* Resources */ = {
151 | isa = PBXResourcesBuildPhase;
152 | buildActionMask = 2147483647;
153 | files = (
154 | 058557D9273AAEEB004C7B11 /* Preview Assets.xcassets in Resources */,
155 | 058557BB273AAA24004C7B11 /* Assets.xcassets in Resources */,
156 | );
157 | runOnlyForDeploymentPostprocessing = 0;
158 | };
159 | /* End PBXResourcesBuildPhase section */
160 |
161 | /* Begin PBXShellScriptBuildPhase section */
162 | F36B1CEB2AD83DDC00CB74D5 /* Compile Kotlin Framework */ = {
163 | isa = PBXShellScriptBuildPhase;
164 | buildActionMask = 2147483647;
165 | files = (
166 | );
167 | inputFileListPaths = (
168 | );
169 | inputPaths = (
170 | );
171 | name = "Compile Kotlin Framework";
172 | outputFileListPaths = (
173 | );
174 | outputPaths = (
175 | );
176 | runOnlyForDeploymentPostprocessing = 0;
177 | shellPath = /bin/sh;
178 | shellScript = "if [ \"YES\" = \"$OVERRIDE_KOTLIN_BUILD_IDE_SUPPORTED\" ]; then\n echo \"Skipping Gradle build task invocation due to OVERRIDE_KOTLIN_BUILD_IDE_SUPPORTED environment variable set to \\\"YES\\\"\"\n exit 0\nfi\ncd \"$SRCROOT/..\"\n./gradlew :composeApp:embedAndSignAppleFrameworkForXcode\n";
179 | };
180 | /* End PBXShellScriptBuildPhase section */
181 |
182 | /* Begin PBXSourcesBuildPhase section */
183 | 7555FF77242A565900829871 /* Sources */ = {
184 | isa = PBXSourcesBuildPhase;
185 | buildActionMask = 2147483647;
186 | files = (
187 | 2152FB042600AC8F00CF470E /* iOSApp.swift in Sources */,
188 | 7555FF83242A565900829871 /* ContentView.swift in Sources */,
189 | );
190 | runOnlyForDeploymentPostprocessing = 0;
191 | };
192 | /* End PBXSourcesBuildPhase section */
193 |
194 | /* Begin XCBuildConfiguration section */
195 | 7555FFA3242A565B00829871 /* Debug */ = {
196 | isa = XCBuildConfiguration;
197 | baseConfigurationReference = AB3632DC29227652001CCB65 /* Config.xcconfig */;
198 | buildSettings = {
199 | ALWAYS_SEARCH_USER_PATHS = NO;
200 | CLANG_ANALYZER_NONNULL = YES;
201 | CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE;
202 | CLANG_CXX_LANGUAGE_STANDARD = "gnu++14";
203 | CLANG_CXX_LIBRARY = "libc++";
204 | CLANG_ENABLE_MODULES = YES;
205 | CLANG_ENABLE_OBJC_ARC = YES;
206 | CLANG_ENABLE_OBJC_WEAK = YES;
207 | CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
208 | CLANG_WARN_BOOL_CONVERSION = YES;
209 | CLANG_WARN_COMMA = YES;
210 | CLANG_WARN_CONSTANT_CONVERSION = YES;
211 | CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
212 | CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
213 | CLANG_WARN_DOCUMENTATION_COMMENTS = YES;
214 | CLANG_WARN_EMPTY_BODY = YES;
215 | CLANG_WARN_ENUM_CONVERSION = YES;
216 | CLANG_WARN_INFINITE_RECURSION = YES;
217 | CLANG_WARN_INT_CONVERSION = YES;
218 | CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
219 | CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES;
220 | CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
221 | CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
222 | CLANG_WARN_QUOTED_INCLUDE_IN_FRAMEWORK_HEADER = YES;
223 | CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
224 | CLANG_WARN_STRICT_PROTOTYPES = YES;
225 | CLANG_WARN_SUSPICIOUS_MOVE = YES;
226 | CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE;
227 | CLANG_WARN_UNREACHABLE_CODE = YES;
228 | CLANG_WARN__DUPLICATE_METHOD_MATCH = YES;
229 | COPY_PHASE_STRIP = NO;
230 | DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
231 | ENABLE_STRICT_OBJC_MSGSEND = YES;
232 | ENABLE_TESTABILITY = YES;
233 | ENABLE_USER_SCRIPT_SANDBOXING = NO;
234 | GCC_C_LANGUAGE_STANDARD = gnu11;
235 | GCC_DYNAMIC_NO_PIC = NO;
236 | GCC_NO_COMMON_BLOCKS = YES;
237 | GCC_OPTIMIZATION_LEVEL = 0;
238 | GCC_PREPROCESSOR_DEFINITIONS = (
239 | "DEBUG=1",
240 | "$(inherited)",
241 | );
242 | GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
243 | GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
244 | GCC_WARN_UNDECLARED_SELECTOR = YES;
245 | GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
246 | GCC_WARN_UNUSED_FUNCTION = YES;
247 | GCC_WARN_UNUSED_VARIABLE = YES;
248 | IPHONEOS_DEPLOYMENT_TARGET = 15.3;
249 | MTL_ENABLE_DEBUG_INFO = INCLUDE_SOURCE;
250 | MTL_FAST_MATH = YES;
251 | ONLY_ACTIVE_ARCH = YES;
252 | SDKROOT = iphoneos;
253 | SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG;
254 | SWIFT_OPTIMIZATION_LEVEL = "-Onone";
255 | };
256 | name = Debug;
257 | };
258 | 7555FFA4242A565B00829871 /* Release */ = {
259 | isa = XCBuildConfiguration;
260 | baseConfigurationReference = AB3632DC29227652001CCB65 /* Config.xcconfig */;
261 | buildSettings = {
262 | ALWAYS_SEARCH_USER_PATHS = NO;
263 | CLANG_ANALYZER_NONNULL = YES;
264 | CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE;
265 | CLANG_CXX_LANGUAGE_STANDARD = "gnu++14";
266 | CLANG_CXX_LIBRARY = "libc++";
267 | CLANG_ENABLE_MODULES = YES;
268 | CLANG_ENABLE_OBJC_ARC = YES;
269 | CLANG_ENABLE_OBJC_WEAK = YES;
270 | CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES;
271 | CLANG_WARN_BOOL_CONVERSION = YES;
272 | CLANG_WARN_COMMA = YES;
273 | CLANG_WARN_CONSTANT_CONVERSION = YES;
274 | CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES;
275 | CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR;
276 | CLANG_WARN_DOCUMENTATION_COMMENTS = YES;
277 | CLANG_WARN_EMPTY_BODY = YES;
278 | CLANG_WARN_ENUM_CONVERSION = YES;
279 | CLANG_WARN_INFINITE_RECURSION = YES;
280 | CLANG_WARN_INT_CONVERSION = YES;
281 | CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES;
282 | CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES;
283 | CLANG_WARN_OBJC_LITERAL_CONVERSION = YES;
284 | CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR;
285 | CLANG_WARN_QUOTED_INCLUDE_IN_FRAMEWORK_HEADER = YES;
286 | CLANG_WARN_RANGE_LOOP_ANALYSIS = YES;
287 | CLANG_WARN_STRICT_PROTOTYPES = YES;
288 | CLANG_WARN_SUSPICIOUS_MOVE = YES;
289 | CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE;
290 | CLANG_WARN_UNREACHABLE_CODE = YES;
291 | CLANG_WARN__DUPLICATE_METHOD_MATCH = YES;
292 | COPY_PHASE_STRIP = NO;
293 | DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym";
294 | ENABLE_NS_ASSERTIONS = NO;
295 | ENABLE_STRICT_OBJC_MSGSEND = YES;
296 | ENABLE_USER_SCRIPT_SANDBOXING = NO;
297 | GCC_C_LANGUAGE_STANDARD = gnu11;
298 | GCC_NO_COMMON_BLOCKS = YES;
299 | GCC_WARN_64_TO_32_BIT_CONVERSION = YES;
300 | GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR;
301 | GCC_WARN_UNDECLARED_SELECTOR = YES;
302 | GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE;
303 | GCC_WARN_UNUSED_FUNCTION = YES;
304 | GCC_WARN_UNUSED_VARIABLE = YES;
305 | IPHONEOS_DEPLOYMENT_TARGET = 15.3;
306 | MTL_ENABLE_DEBUG_INFO = NO;
307 | MTL_FAST_MATH = YES;
308 | SDKROOT = iphoneos;
309 | SWIFT_COMPILATION_MODE = wholemodule;
310 | SWIFT_OPTIMIZATION_LEVEL = "-O";
311 | VALIDATE_PRODUCT = YES;
312 | };
313 | name = Release;
314 | };
315 | 7555FFA6242A565B00829871 /* Debug */ = {
316 | isa = XCBuildConfiguration;
317 | buildSettings = {
318 | ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
319 | CODE_SIGN_IDENTITY = "Apple Development";
320 | CODE_SIGN_STYLE = Automatic;
321 | DEVELOPMENT_ASSET_PATHS = "\"iosApp/Preview Content\"";
322 | DEVELOPMENT_TEAM = "${TEAM_ID}";
323 | ENABLE_PREVIEWS = YES;
324 | FRAMEWORK_SEARCH_PATHS = (
325 | "$(inherited)",
326 | "$(SRCROOT)/../shared/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)\n$(SRCROOT)/../composeApp/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)",
327 | );
328 | INFOPLIST_FILE = iosApp/Info.plist;
329 | IPHONEOS_DEPLOYMENT_TARGET = 15.3;
330 | LD_RUNPATH_SEARCH_PATHS = (
331 | "$(inherited)",
332 | "@executable_path/Frameworks",
333 | );
334 | PRODUCT_BUNDLE_IDENTIFIER = "${BUNDLE_ID}${TEAM_ID}";
335 | PRODUCT_NAME = "${APP_NAME}";
336 | PROVISIONING_PROFILE_SPECIFIER = "";
337 | SWIFT_VERSION = 5.0;
338 | TARGETED_DEVICE_FAMILY = "1,2";
339 | };
340 | name = Debug;
341 | };
342 | 7555FFA7242A565B00829871 /* Release */ = {
343 | isa = XCBuildConfiguration;
344 | buildSettings = {
345 | ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon;
346 | CODE_SIGN_IDENTITY = "Apple Development";
347 | CODE_SIGN_STYLE = Automatic;
348 | DEVELOPMENT_ASSET_PATHS = "\"iosApp/Preview Content\"";
349 | DEVELOPMENT_TEAM = "${TEAM_ID}";
350 | ENABLE_PREVIEWS = YES;
351 | FRAMEWORK_SEARCH_PATHS = (
352 | "$(inherited)",
353 | "$(SRCROOT)/../shared/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)\n$(SRCROOT)/../composeApp/build/xcode-frameworks/$(CONFIGURATION)/$(SDK_NAME)",
354 | );
355 | INFOPLIST_FILE = iosApp/Info.plist;
356 | IPHONEOS_DEPLOYMENT_TARGET = 15.3;
357 | LD_RUNPATH_SEARCH_PATHS = (
358 | "$(inherited)",
359 | "@executable_path/Frameworks",
360 | );
361 | PRODUCT_BUNDLE_IDENTIFIER = "${BUNDLE_ID}${TEAM_ID}";
362 | PRODUCT_NAME = "${APP_NAME}";
363 | PROVISIONING_PROFILE_SPECIFIER = "";
364 | SWIFT_VERSION = 5.0;
365 | TARGETED_DEVICE_FAMILY = "1,2";
366 | };
367 | name = Release;
368 | };
369 | /* End XCBuildConfiguration section */
370 |
371 | /* Begin XCConfigurationList section */
372 | 7555FF76242A565900829871 /* Build configuration list for PBXProject "iosApp" */ = {
373 | isa = XCConfigurationList;
374 | buildConfigurations = (
375 | 7555FFA3242A565B00829871 /* Debug */,
376 | 7555FFA4242A565B00829871 /* Release */,
377 | );
378 | defaultConfigurationIsVisible = 0;
379 | defaultConfigurationName = Release;
380 | };
381 | 7555FFA5242A565B00829871 /* Build configuration list for PBXNativeTarget "iosApp" */ = {
382 | isa = XCConfigurationList;
383 | buildConfigurations = (
384 | 7555FFA6242A565B00829871 /* Debug */,
385 | 7555FFA7242A565B00829871 /* Release */,
386 | );
387 | defaultConfigurationIsVisible = 0;
388 | defaultConfigurationName = Release;
389 | };
390 | /* End XCConfigurationList section */
391 | };
392 | rootObject = 7555FF73242A565900829871 /* Project object */;
393 | }
--------------------------------------------------------------------------------
/composeApp/src/commonMain/kotlin/Comet.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.runtime.Composable
2 | import androidx.compose.runtime.remember
3 | import androidx.compose.ui.graphics.*
4 | import androidx.compose.ui.graphics.vector.ImageVector
5 | import androidx.compose.ui.graphics.vector.PathBuilder
6 | import androidx.compose.ui.graphics.vector.group
7 | import androidx.compose.ui.graphics.vector.path
8 | import androidx.compose.ui.unit.dp
9 |
10 |
11 | @Composable
12 | fun CometShape(): ImageVector {
13 | return remember {
14 | ImageVector.Builder(
15 | name = "Compose svg test",
16 | defaultWidth = 325.dp,
17 | defaultHeight = 345.dp,
18 | viewportWidth = 325f,
19 | viewportHeight = 345f
20 | ).apply {
21 | group {
22 | CometPart{
23 | moveTo(175.312f, 104.793f)
24 | lineTo(137.428f, 164.038f)
25 | lineTo(231.727f, 77.3515f)
26 | lineTo(204.622f, 74.4054f)
27 | lineTo(175.312f, 104.793f)
28 | close()
29 | }
30 | }
31 | group {
32 | CometPart{
33 | moveTo(189.759f, 89.3399f)
34 | lineTo(101.789f, 217.853f)
35 | lineTo(218.515f, 77.0974f)
36 | lineTo(189.759f, 89.3399f)
37 | close()
38 | }
39 | }
40 | group {
41 | CometPart{
42 | moveTo(202.86f, 75.3962f)
43 | lineTo(148.873f, 163.154f)
44 | lineTo(218.516f, 77.0978f)
45 | lineTo(202.86f, 75.3962f)
46 | close()
47 | }
48 | }
49 | group {
50 | CometPart{
51 | moveTo(227.101f, 106.85f)
52 | lineTo(189.217f, 166.095f)
53 | lineTo(283.516f, 79.4086f)
54 | lineTo(256.411f, 76.4626f)
55 | lineTo(227.101f, 106.85f)
56 | close()
57 | }
58 | }
59 | group {
60 | CometPart{
61 | moveTo(241.548f, 91.397f)
62 | lineTo(153.578f, 219.91f)
63 | lineTo(270.304f, 79.1546f)
64 | lineTo(241.548f, 91.397f)
65 | close()
66 | }
67 | }
68 | group {
69 | CometPart{
70 | moveTo(254.649f, 77.4533f)
71 | lineTo(200.662f, 165.211f)
72 | lineTo(270.305f, 79.1549f)
73 | lineTo(254.649f, 77.4533f)
74 | close()
75 | }
76 | }
77 | group {
78 | CometPart{
79 | moveTo(148.785f, 93.2451f)
80 | lineTo(110.9f, 152.49f)
81 | lineTo(205.2f, 65.8039f)
82 | lineTo(178.095f, 62.8578f)
83 | lineTo(148.785f, 93.2451f)
84 | close()
85 | }
86 | }
87 | group {
88 | CometPart{
89 | moveTo(143.093f, 82.8897f)
90 | lineTo(55.123f, 211.403f)
91 | lineTo(171.849f, 70.6472f)
92 | lineTo(143.093f, 82.8897f)
93 | close()
94 | }
95 | }
96 | group {
97 | CometPart{
98 | moveTo(166.024f, 62.2199f)
99 | lineTo(112.037f, 149.978f)
100 | lineTo(181.68f, 63.9215f)
101 | lineTo(166.024f, 62.2199f)
102 | close()
103 | }
104 | }
105 | group {
106 | CometPart{
107 | moveTo(142.089f, 92.8545f)
108 | lineTo(104.205f, 152.1f)
109 | lineTo(198.505f, 65.4132f)
110 | lineTo(171.399f, 62.4672f)
111 | lineTo(142.089f, 92.8545f)
112 | close()
113 | }
114 | }
115 | group {
116 | CometPart{
117 | moveTo(143.607f, 103.479f)
118 | lineTo(105.723f, 162.724f)
119 | lineTo(200.022f, 76.0375f)
120 | lineTo(172.917f, 73.0915f)
121 | lineTo(143.607f, 103.479f)
122 | close()
123 | }
124 | }
125 | group {
126 | CometPart{
127 | moveTo(211.322f, 70.8285f)
128 | lineTo(214.717f, 35.4265f)
129 | lineTo(191.893f, 96.5885f)
130 | lineTo(205.042f, 91.366f)
131 | lineTo(211.322f, 70.8285f)
132 | close()
133 | }
134 | }
135 | group {
136 | CometPart{
137 | moveTo(211.322f, 70.8285f)
138 | lineTo(214.717f, 35.4265f)
139 | lineTo(191.893f, 96.5885f)
140 | lineTo(205.042f, 91.366f)
141 | lineTo(211.322f, 70.8285f)
142 | close()
143 | }
144 | }
145 | group {
146 | CometPart{
147 | moveTo(202.974f, 71.2079f)
148 | lineTo(206.369f, 35.8059f)
149 | lineTo(183.545f, 96.9679f)
150 | lineTo(196.695f, 91.7454f)
151 | lineTo(202.974f, 71.2079f)
152 | close()
153 | }
154 | }
155 | group {
156 | CometPart{
157 | moveTo(147.781f, 96.5081f)
158 | lineTo(59.8105f, 225.021f)
159 | lineTo(176.537f, 84.2657f)
160 | lineTo(147.781f, 96.5081f)
161 | close()
162 | }
163 | }
164 | group {
165 | CometPart{
166 | moveTo(152.122f, 73.9709f)
167 | lineTo(98.1348f, 161.729f)
168 | lineTo(167.777f, 75.6725f)
169 | lineTo(152.122f, 73.9709f)
170 | close()
171 | }
172 | }
173 | group {
174 | CometPart{
175 | moveTo(133.197f, 123.764f)
176 | lineTo(95.3125f, 183.01f)
177 | lineTo(189.612f, 96.3232f)
178 | lineTo(162.507f, 93.3771f)
179 | lineTo(133.197f, 123.764f)
180 | close()
181 | }
182 | }
183 | group {
184 | CometPart{
185 | moveTo(147.644f, 108.312f)
186 | lineTo(59.6738f, 236.825f)
187 | lineTo(176.4f, 96.0694f)
188 | lineTo(147.644f, 108.312f)
189 | close()
190 | }
191 | }
192 | group {
193 | CometPart{
194 | moveTo(160.745f, 94.3681f)
195 | lineTo(106.758f, 182.126f)
196 | lineTo(176.4f, 96.0697f)
197 | lineTo(160.745f, 94.3681f)
198 | close()
199 | }
200 | }
201 | group {
202 | CometPart{
203 | moveTo(160.745f, 94.3681f)
204 | lineTo(106.758f, 182.126f)
205 | lineTo(176.4f, 96.0697f)
206 | lineTo(160.745f, 94.3681f)
207 | close()
208 | }
209 | }
210 | group {
211 | CometPart{
212 | moveTo(160.745f, 94.3681f)
213 | lineTo(106.758f, 182.126f)
214 | lineTo(176.4f, 96.0697f)
215 | lineTo(160.745f, 94.3681f)
216 | close()
217 | }
218 | }
219 | group {
220 | CometPart{
221 | moveTo(144.397f, 91.4365f)
222 | lineTo(90.4102f, 179.195f)
223 | lineTo(160.053f, 93.1381f)
224 | lineTo(144.397f, 91.4365f)
225 | close()
226 | }
227 | }
228 | group {
229 | CometPart{
230 | moveTo(137.565f, 100.922f)
231 | lineTo(83.5781f, 188.68f)
232 | lineTo(153.221f, 102.624f)
233 | lineTo(137.565f, 100.922f)
234 | close()
235 | }
236 | }
237 | group {
238 | CometPart{
239 | moveTo(136.428f, 114.582f)
240 | lineTo(82.4414f, 202.34f)
241 | lineTo(152.084f, 116.284f)
242 | lineTo(136.428f, 114.582f)
243 | close()
244 | }
245 | }
246 | group {
247 | CometPart{
248 | moveTo(148.19f, 126.724f)
249 | lineTo(94.2031f, 214.482f)
250 | lineTo(163.846f, 128.426f)
251 | lineTo(148.19f, 126.724f)
252 | close()
253 | }
254 | }
255 | group {
256 | CometPart{
257 | moveTo(170.759f, 95.3069f)
258 | lineTo(132.875f, 154.552f)
259 | lineTo(227.175f, 67.8656f)
260 | lineTo(200.069f, 64.9196f)
261 | lineTo(170.759f, 95.3069f)
262 | close()
263 | }
264 | }
265 | group {
266 | CometPart{
267 | moveTo(185.206f, 79.854f)
268 | lineTo(97.2363f, 208.367f)
269 | lineTo(213.963f, 67.6116f)
270 | lineTo(185.206f, 79.854f)
271 | close()
272 | }
273 | }
274 | group {
275 | CometPart{
276 | moveTo(166.78f, 78.5356f)
277 | lineTo(112.793f, 166.294f)
278 | lineTo(182.436f, 80.2372f)
279 | lineTo(166.78f, 78.5356f)
280 | close()
281 | }
282 | }
283 | group {
284 | CometPart{
285 | moveTo(163.173f, 132.112f)
286 | lineTo(125.289f, 191.358f)
287 | lineTo(219.589f, 104.671f)
288 | lineTo(192.483f, 101.725f)
289 | lineTo(163.173f, 132.112f)
290 | close()
291 | }
292 | }
293 | group {
294 | CometPart{
295 | moveTo(177.62f, 116.659f)
296 | lineTo(89.6504f, 245.173f)
297 | lineTo(206.377f, 104.417f)
298 | lineTo(177.62f, 116.659f)
299 | close()
300 | }
301 | }
302 | group {
303 | CometPart{
304 | moveTo(190.721f, 102.716f)
305 | lineTo(136.734f, 190.474f)
306 | lineTo(206.377f, 104.417f)
307 | lineTo(190.721f, 102.716f)
308 | close()
309 | }
310 | }
311 | group {
312 | CometPart{
313 | moveTo(181.386f, 129.076f)
314 | lineTo(143.502f, 188.322f)
315 | lineTo(237.802f, 101.635f)
316 | lineTo(210.696f, 98.6891f)
317 | lineTo(181.386f, 129.076f)
318 | close()
319 | }
320 | }
321 | group {
322 | CometPart{
323 | moveTo(195.833f, 113.624f)
324 | lineTo(107.863f, 242.137f)
325 | lineTo(224.59f, 101.381f)
326 | lineTo(195.833f, 113.624f)
327 | close()
328 | }
329 | }
330 | group {
331 | CometPart{
332 | moveTo(208.934f, 99.6799f)
333 | lineTo(154.947f, 187.438f)
334 | lineTo(224.59f, 101.381f)
335 | lineTo(208.934f, 99.6799f)
336 | close()
337 | }
338 | }
339 | group {
340 | CometPart{
341 | moveTo(205.671f, 104.793f)
342 | lineTo(167.787f, 164.038f)
343 | lineTo(262.087f, 77.3517f)
344 | lineTo(234.981f, 74.4057f)
345 | lineTo(205.671f, 104.793f)
346 | close()
347 | }
348 | }
349 | group {
350 | CometPart{
351 | moveTo(220.118f, 89.3401f)
352 | lineTo(132.148f, 217.853f)
353 | lineTo(248.875f, 77.0977f)
354 | lineTo(220.118f, 89.3401f)
355 | close()
356 | }
357 | }
358 | group {
359 | CometPart{
360 | moveTo(233.219f, 75.3962f)
361 | lineTo(179.232f, 163.154f)
362 | lineTo(248.875f, 77.0978f)
363 | lineTo(233.219f, 75.3962f)
364 | close()
365 | }
366 | }
367 | group {
368 | CometPart{
369 | moveTo(217.814f, 123.006f)
370 | lineTo(179.93f, 182.251f)
371 | lineTo(274.229f, 95.5644f)
372 | lineTo(247.124f, 92.6183f)
373 | lineTo(217.814f, 123.006f)
374 | close()
375 | }
376 | }
377 | group {
378 | CometPart{
379 | moveTo(228.466f, 99.9343f)
380 | lineTo(140.496f, 228.448f)
381 | lineTo(257.222f, 87.6919f)
382 | lineTo(228.466f, 99.9343f)
383 | close()
384 | }
385 | }
386 | group {
387 | CometPart{
388 | moveTo(245.362f, 93.6091f)
389 | lineTo(191.375f, 181.367f)
390 | lineTo(261.018f, 95.3107f)
391 | lineTo(245.362f, 93.6091f)
392 | close()
393 | }
394 | }
395 | group {
396 | CometPart{
397 | moveTo(188.537f, 98.4949f)
398 | lineTo(150.652f, 157.74f)
399 | lineTo(244.952f, 71.0536f)
400 | lineTo(217.846f, 68.1076f)
401 | lineTo(188.537f, 98.4949f)
402 | close()
403 | }
404 | }
405 | group {
406 | CometPart{
407 | moveTo(198.677f, 64.4959f)
408 | lineTo(110.707f, 193.009f)
409 | lineTo(227.433f, 52.2534f)
410 | lineTo(198.677f, 64.4959f)
411 | close()
412 | }
413 | }
414 | group {
415 | CometPart{
416 | moveTo(223.225f, 56.9479f)
417 | lineTo(169.238f, 144.706f)
418 | lineTo(238.881f, 58.6495f)
419 | lineTo(223.225f, 56.9479f)
420 | close()
421 | }
422 | }
423 | group {
424 | CometPart{
425 | moveTo(136.285f, 196.967f)
426 | lineTo(98.4004f, 256.212f)
427 | lineTo(192.7f, 169.526f)
428 | lineTo(165.595f, 166.58f)
429 | lineTo(136.285f, 196.967f)
430 | close()
431 | }
432 | }
433 | group {
434 | CometPart{
435 | moveTo(150.732f, 181.514f)
436 | lineTo(62.7617f, 310.027f)
437 | lineTo(179.488f, 169.272f)
438 | lineTo(150.732f, 181.514f)
439 | close()
440 | }
441 | }
442 | group {
443 | CometPart{
444 | moveTo(163.833f, 167.57f)
445 | lineTo(109.846f, 255.328f)
446 | lineTo(179.488f, 169.272f)
447 | lineTo(163.833f, 167.57f)
448 | close()
449 | }
450 | }
451 | group {
452 | CometPart{
453 | moveTo(172.564f, 195.905f)
454 | lineTo(134.68f, 255.151f)
455 | lineTo(228.979f, 168.464f)
456 | lineTo(201.874f, 165.518f)
457 | lineTo(172.564f, 195.905f)
458 | close()
459 | }
460 | }
461 | group {
462 | CometPart{
463 | moveTo(187.011f, 180.452f)
464 | lineTo(99.041f, 308.966f)
465 | lineTo(215.767f, 168.21f)
466 | lineTo(187.011f, 180.452f)
467 | close()
468 | }
469 | }
470 | group {
471 | CometPart{
472 | moveTo(200.112f, 166.508f)
473 | lineTo(146.125f, 254.267f)
474 | lineTo(215.768f, 168.21f)
475 | lineTo(200.112f, 166.508f)
476 | close()
477 | }
478 | }
479 | group {
480 | CometPart{
481 | moveTo(161.326f, 187.361f)
482 | lineTo(123.441f, 246.606f)
483 | lineTo(217.741f, 159.92f)
484 | lineTo(190.636f, 156.974f)
485 | lineTo(161.326f, 187.361f)
486 | close()
487 | }
488 | }
489 | group {
490 | CometPart{
491 | moveTo(175.773f, 171.908f)
492 | lineTo(87.8027f, 300.421f)
493 | lineTo(204.529f, 159.666f)
494 | lineTo(175.773f, 171.908f)
495 | close()
496 | }
497 | }
498 | group {
499 | CometPart{
500 | moveTo(188.874f, 157.964f)
501 | lineTo(134.887f, 245.722f)
502 | lineTo(204.529f, 159.666f)
503 | lineTo(188.874f, 157.964f)
504 | close()
505 | }
506 | }
507 | group {
508 | CometPart{
509 | moveTo(183.132f, 150.985f)
510 | lineTo(145.248f, 210.231f)
511 | lineTo(239.548f, 123.544f)
512 | lineTo(212.442f, 120.598f)
513 | lineTo(183.132f, 150.985f)
514 | close()
515 | }
516 | }
517 | group {
518 | CometPart{
519 | moveTo(197.579f, 135.533f)
520 | lineTo(109.609f, 264.046f)
521 | lineTo(226.336f, 123.29f)
522 | lineTo(197.579f, 135.533f)
523 | close()
524 | }
525 | }
526 | group {
527 | CometPart{
528 | moveTo(210.678f, 121.589f)
529 | lineTo(156.691f, 209.347f)
530 | lineTo(226.334f, 123.29f)
531 | lineTo(210.678f, 121.589f)
532 | close()
533 | }
534 | }
535 | group {
536 | CometPart{
537 | moveTo(108.523f, 180.363f)
538 | lineTo(70.6387f, 239.608f)
539 | lineTo(164.938f, 152.922f)
540 | lineTo(137.833f, 149.976f)
541 | lineTo(108.523f, 180.363f)
542 | close()
543 | }
544 | }
545 | group {
546 | CometPart{
547 | moveTo(122.97f, 164.91f)
548 | lineTo(35f, 293.424f)
549 | lineTo(151.726f, 152.668f)
550 | lineTo(122.97f, 164.91f)
551 | close()
552 | }
553 | }
554 | group {
555 | CometPart{
556 | moveTo(136.069f, 150.966f)
557 | lineTo(82.082f, 238.725f)
558 | lineTo(151.725f, 152.668f)
559 | lineTo(136.069f, 150.966f)
560 | close()
561 | }
562 | }
563 | group {
564 | CometPart{
565 | moveTo(233.853f, 125.014f)
566 | lineTo(195.969f, 184.26f)
567 | lineTo(290.268f, 97.5729f)
568 | lineTo(263.163f, 94.6269f)
569 | lineTo(233.853f, 125.014f)
570 | close()
571 | }
572 | }
573 | group {
574 | CometPart{
575 | moveTo(248.3f, 109.561f)
576 | lineTo(160.33f, 238.074f)
577 | lineTo(277.056f, 97.3189f)
578 | lineTo(248.3f, 109.561f)
579 | close()
580 | }
581 | }
582 | group {
583 | CometPart{
584 | moveTo(261.401f, 95.6174f)
585 | lineTo(207.414f, 183.375f)
586 | lineTo(277.057f, 97.319f)
587 | lineTo(261.401f, 95.6174f)
588 | close()
589 | }
590 | }
591 | }.build()
592 | }
593 | }
594 |
595 | inline fun ImageVector.Builder.CometPart(
596 | content: PathBuilder.() -> Unit,
597 | ) {
598 | path(
599 | fill = SolidColor(Color(0xFFA771FF)),
600 | fillAlpha = 1.0f,
601 | stroke = null,
602 | strokeAlpha = 1.0f,
603 | strokeLineWidth = 1.0f,
604 | strokeLineCap = StrokeCap.Butt,
605 | strokeLineJoin = StrokeJoin.Miter,
606 | strokeLineMiter = 1.0f,
607 | pathFillType = PathFillType.NonZero,
608 | pathBuilder = content
609 | )
610 | }
611 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/composeResources/drawable/comet.svg:
--------------------------------------------------------------------------------
1 |
493 |
--------------------------------------------------------------------------------
/composeApp/src/commonMain/kotlin/Compose svg test.kt:
--------------------------------------------------------------------------------
1 | import androidx.compose.runtime.Composable
2 | import androidx.compose.runtime.remember
3 | import androidx.compose.ui.graphics.SolidColor
4 | import androidx.compose.ui.graphics.Color
5 | import androidx.compose.ui.graphics.StrokeCap
6 | import androidx.compose.ui.graphics.StrokeJoin
7 | import androidx.compose.ui.graphics.vector.ImageVector
8 | import androidx.compose.ui.graphics.vector.group
9 | import androidx.compose.ui.graphics.PathFillType
10 | import androidx.compose.ui.graphics.vector.path
11 | import androidx.compose.ui.unit.dp
12 |
13 |
14 | @Composable
15 | fun sgrawrgwr(): ImageVector {
16 | return remember {
17 | ImageVector.Builder(
18 | name = "Compose svg test",
19 | defaultWidth = 325.dp,
20 | defaultHeight = 345.dp,
21 | viewportWidth = 325f,
22 | viewportHeight = 345f
23 | ).apply {
24 | group {
25 | path(
26 | fill = SolidColor(Color(0xFFA771FF)),
27 | fillAlpha = 1.0f,
28 | stroke = null,
29 | strokeAlpha = 1.0f,
30 | strokeLineWidth = 1.0f,
31 | strokeLineCap = StrokeCap.Butt,
32 | strokeLineJoin = StrokeJoin.Miter,
33 | strokeLineMiter = 1.0f,
34 | pathFillType = PathFillType.NonZero
35 | ) {
36 | moveTo(175.312f, 104.793f)
37 | lineTo(137.428f, 164.038f)
38 | lineTo(231.727f, 77.3515f)
39 | lineTo(204.622f, 74.4054f)
40 | lineTo(175.312f, 104.793f)
41 | close()
42 | }
43 | }
44 | group {
45 | path(
46 | fill = SolidColor(Color(0xFFA771FF)),
47 | fillAlpha = 1.0f,
48 | stroke = null,
49 | strokeAlpha = 1.0f,
50 | strokeLineWidth = 1.0f,
51 | strokeLineCap = StrokeCap.Butt,
52 | strokeLineJoin = StrokeJoin.Miter,
53 | strokeLineMiter = 1.0f,
54 | pathFillType = PathFillType.NonZero
55 | ) {
56 | moveTo(189.759f, 89.3399f)
57 | lineTo(101.789f, 217.853f)
58 | lineTo(218.515f, 77.0974f)
59 | lineTo(189.759f, 89.3399f)
60 | close()
61 | }
62 | }
63 | group {
64 | path(
65 | fill = SolidColor(Color(0xFFA771FF)),
66 | fillAlpha = 1.0f,
67 | stroke = null,
68 | strokeAlpha = 1.0f,
69 | strokeLineWidth = 1.0f,
70 | strokeLineCap = StrokeCap.Butt,
71 | strokeLineJoin = StrokeJoin.Miter,
72 | strokeLineMiter = 1.0f,
73 | pathFillType = PathFillType.NonZero
74 | ) {
75 | moveTo(202.86f, 75.3962f)
76 | lineTo(148.873f, 163.154f)
77 | lineTo(218.516f, 77.0978f)
78 | lineTo(202.86f, 75.3962f)
79 | close()
80 | }
81 | }
82 | group {
83 | path(
84 | fill = SolidColor(Color(0xFFA771FF)),
85 | fillAlpha = 1.0f,
86 | stroke = null,
87 | strokeAlpha = 1.0f,
88 | strokeLineWidth = 1.0f,
89 | strokeLineCap = StrokeCap.Butt,
90 | strokeLineJoin = StrokeJoin.Miter,
91 | strokeLineMiter = 1.0f,
92 | pathFillType = PathFillType.NonZero
93 | ) {
94 | moveTo(227.101f, 106.85f)
95 | lineTo(189.217f, 166.095f)
96 | lineTo(283.516f, 79.4086f)
97 | lineTo(256.411f, 76.4626f)
98 | lineTo(227.101f, 106.85f)
99 | close()
100 | }
101 | }
102 | group {
103 | path(
104 | fill = SolidColor(Color(0xFFA771FF)),
105 | fillAlpha = 1.0f,
106 | stroke = null,
107 | strokeAlpha = 1.0f,
108 | strokeLineWidth = 1.0f,
109 | strokeLineCap = StrokeCap.Butt,
110 | strokeLineJoin = StrokeJoin.Miter,
111 | strokeLineMiter = 1.0f,
112 | pathFillType = PathFillType.NonZero
113 | ) {
114 | moveTo(241.548f, 91.397f)
115 | lineTo(153.578f, 219.91f)
116 | lineTo(270.304f, 79.1546f)
117 | lineTo(241.548f, 91.397f)
118 | close()
119 | }
120 | }
121 | group {
122 | path(
123 | fill = SolidColor(Color(0xFFA771FF)),
124 | fillAlpha = 1.0f,
125 | stroke = null,
126 | strokeAlpha = 1.0f,
127 | strokeLineWidth = 1.0f,
128 | strokeLineCap = StrokeCap.Butt,
129 | strokeLineJoin = StrokeJoin.Miter,
130 | strokeLineMiter = 1.0f,
131 | pathFillType = PathFillType.NonZero
132 | ) {
133 | moveTo(254.649f, 77.4533f)
134 | lineTo(200.662f, 165.211f)
135 | lineTo(270.305f, 79.1549f)
136 | lineTo(254.649f, 77.4533f)
137 | close()
138 | }
139 | }
140 | group {
141 | path(
142 | fill = SolidColor(Color(0xFFA771FF)),
143 | fillAlpha = 1.0f,
144 | stroke = null,
145 | strokeAlpha = 1.0f,
146 | strokeLineWidth = 1.0f,
147 | strokeLineCap = StrokeCap.Butt,
148 | strokeLineJoin = StrokeJoin.Miter,
149 | strokeLineMiter = 1.0f,
150 | pathFillType = PathFillType.NonZero
151 | ) {
152 | moveTo(148.785f, 93.2451f)
153 | lineTo(110.9f, 152.49f)
154 | lineTo(205.2f, 65.8039f)
155 | lineTo(178.095f, 62.8578f)
156 | lineTo(148.785f, 93.2451f)
157 | close()
158 | }
159 | }
160 | group {
161 | path(
162 | fill = SolidColor(Color(0xFFA771FF)),
163 | fillAlpha = 1.0f,
164 | stroke = null,
165 | strokeAlpha = 1.0f,
166 | strokeLineWidth = 1.0f,
167 | strokeLineCap = StrokeCap.Butt,
168 | strokeLineJoin = StrokeJoin.Miter,
169 | strokeLineMiter = 1.0f,
170 | pathFillType = PathFillType.NonZero
171 | ) {
172 | moveTo(143.093f, 82.8897f)
173 | lineTo(55.123f, 211.403f)
174 | lineTo(171.849f, 70.6472f)
175 | lineTo(143.093f, 82.8897f)
176 | close()
177 | }
178 | }
179 | group {
180 | path(
181 | fill = SolidColor(Color(0xFFA771FF)),
182 | fillAlpha = 1.0f,
183 | stroke = null,
184 | strokeAlpha = 1.0f,
185 | strokeLineWidth = 1.0f,
186 | strokeLineCap = StrokeCap.Butt,
187 | strokeLineJoin = StrokeJoin.Miter,
188 | strokeLineMiter = 1.0f,
189 | pathFillType = PathFillType.NonZero
190 | ) {
191 | moveTo(166.024f, 62.2199f)
192 | lineTo(112.037f, 149.978f)
193 | lineTo(181.68f, 63.9215f)
194 | lineTo(166.024f, 62.2199f)
195 | close()
196 | }
197 | }
198 | group {
199 | path(
200 | fill = SolidColor(Color(0xFFA771FF)),
201 | fillAlpha = 1.0f,
202 | stroke = null,
203 | strokeAlpha = 1.0f,
204 | strokeLineWidth = 1.0f,
205 | strokeLineCap = StrokeCap.Butt,
206 | strokeLineJoin = StrokeJoin.Miter,
207 | strokeLineMiter = 1.0f,
208 | pathFillType = PathFillType.NonZero
209 | ) {
210 | moveTo(142.089f, 92.8545f)
211 | lineTo(104.205f, 152.1f)
212 | lineTo(198.505f, 65.4132f)
213 | lineTo(171.399f, 62.4672f)
214 | lineTo(142.089f, 92.8545f)
215 | close()
216 | }
217 | }
218 | group {
219 | path(
220 | fill = SolidColor(Color(0xFFA771FF)),
221 | fillAlpha = 1.0f,
222 | stroke = null,
223 | strokeAlpha = 1.0f,
224 | strokeLineWidth = 1.0f,
225 | strokeLineCap = StrokeCap.Butt,
226 | strokeLineJoin = StrokeJoin.Miter,
227 | strokeLineMiter = 1.0f,
228 | pathFillType = PathFillType.NonZero
229 | ) {
230 | moveTo(143.607f, 103.479f)
231 | lineTo(105.723f, 162.724f)
232 | lineTo(200.022f, 76.0375f)
233 | lineTo(172.917f, 73.0915f)
234 | lineTo(143.607f, 103.479f)
235 | close()
236 | }
237 | }
238 | group {
239 | path(
240 | fill = SolidColor(Color(0xFFA771FF)),
241 | fillAlpha = 1.0f,
242 | stroke = null,
243 | strokeAlpha = 1.0f,
244 | strokeLineWidth = 1.0f,
245 | strokeLineCap = StrokeCap.Butt,
246 | strokeLineJoin = StrokeJoin.Miter,
247 | strokeLineMiter = 1.0f,
248 | pathFillType = PathFillType.NonZero
249 | ) {
250 | moveTo(211.322f, 70.8285f)
251 | lineTo(214.717f, 35.4265f)
252 | lineTo(191.893f, 96.5885f)
253 | lineTo(205.042f, 91.366f)
254 | lineTo(211.322f, 70.8285f)
255 | close()
256 | }
257 | }
258 | group {
259 | path(
260 | fill = SolidColor(Color(0xFFA771FF)),
261 | fillAlpha = 1.0f,
262 | stroke = null,
263 | strokeAlpha = 1.0f,
264 | strokeLineWidth = 1.0f,
265 | strokeLineCap = StrokeCap.Butt,
266 | strokeLineJoin = StrokeJoin.Miter,
267 | strokeLineMiter = 1.0f,
268 | pathFillType = PathFillType.NonZero
269 | ) {
270 | moveTo(211.322f, 70.8285f)
271 | lineTo(214.717f, 35.4265f)
272 | lineTo(191.893f, 96.5885f)
273 | lineTo(205.042f, 91.366f)
274 | lineTo(211.322f, 70.8285f)
275 | close()
276 | }
277 | }
278 | group {
279 | path(
280 | fill = SolidColor(Color(0xFFA771FF)),
281 | fillAlpha = 1.0f,
282 | stroke = null,
283 | strokeAlpha = 1.0f,
284 | strokeLineWidth = 1.0f,
285 | strokeLineCap = StrokeCap.Butt,
286 | strokeLineJoin = StrokeJoin.Miter,
287 | strokeLineMiter = 1.0f,
288 | pathFillType = PathFillType.NonZero
289 | ) {
290 | moveTo(202.974f, 71.2079f)
291 | lineTo(206.369f, 35.8059f)
292 | lineTo(183.545f, 96.9679f)
293 | lineTo(196.695f, 91.7454f)
294 | lineTo(202.974f, 71.2079f)
295 | close()
296 | }
297 | }
298 | group {
299 | path(
300 | fill = SolidColor(Color(0xFFA771FF)),
301 | fillAlpha = 1.0f,
302 | stroke = null,
303 | strokeAlpha = 1.0f,
304 | strokeLineWidth = 1.0f,
305 | strokeLineCap = StrokeCap.Butt,
306 | strokeLineJoin = StrokeJoin.Miter,
307 | strokeLineMiter = 1.0f,
308 | pathFillType = PathFillType.NonZero
309 | ) {
310 | moveTo(147.781f, 96.5081f)
311 | lineTo(59.8105f, 225.021f)
312 | lineTo(176.537f, 84.2657f)
313 | lineTo(147.781f, 96.5081f)
314 | close()
315 | }
316 | }
317 | group {
318 | path(
319 | fill = SolidColor(Color(0xFFA771FF)),
320 | fillAlpha = 1.0f,
321 | stroke = null,
322 | strokeAlpha = 1.0f,
323 | strokeLineWidth = 1.0f,
324 | strokeLineCap = StrokeCap.Butt,
325 | strokeLineJoin = StrokeJoin.Miter,
326 | strokeLineMiter = 1.0f,
327 | pathFillType = PathFillType.NonZero
328 | ) {
329 | moveTo(152.122f, 73.9709f)
330 | lineTo(98.1348f, 161.729f)
331 | lineTo(167.777f, 75.6725f)
332 | lineTo(152.122f, 73.9709f)
333 | close()
334 | }
335 | }
336 | group {
337 | path(
338 | fill = SolidColor(Color(0xFFA771FF)),
339 | fillAlpha = 1.0f,
340 | stroke = null,
341 | strokeAlpha = 1.0f,
342 | strokeLineWidth = 1.0f,
343 | strokeLineCap = StrokeCap.Butt,
344 | strokeLineJoin = StrokeJoin.Miter,
345 | strokeLineMiter = 1.0f,
346 | pathFillType = PathFillType.NonZero
347 | ) {
348 | moveTo(133.197f, 123.764f)
349 | lineTo(95.3125f, 183.01f)
350 | lineTo(189.612f, 96.3232f)
351 | lineTo(162.507f, 93.3771f)
352 | lineTo(133.197f, 123.764f)
353 | close()
354 | }
355 | }
356 | group {
357 | path(
358 | fill = SolidColor(Color(0xFFA771FF)),
359 | fillAlpha = 1.0f,
360 | stroke = null,
361 | strokeAlpha = 1.0f,
362 | strokeLineWidth = 1.0f,
363 | strokeLineCap = StrokeCap.Butt,
364 | strokeLineJoin = StrokeJoin.Miter,
365 | strokeLineMiter = 1.0f,
366 | pathFillType = PathFillType.NonZero
367 | ) {
368 | moveTo(147.644f, 108.312f)
369 | lineTo(59.6738f, 236.825f)
370 | lineTo(176.4f, 96.0694f)
371 | lineTo(147.644f, 108.312f)
372 | close()
373 | }
374 | }
375 | group {
376 | path(
377 | fill = SolidColor(Color(0xFFA771FF)),
378 | fillAlpha = 1.0f,
379 | stroke = null,
380 | strokeAlpha = 1.0f,
381 | strokeLineWidth = 1.0f,
382 | strokeLineCap = StrokeCap.Butt,
383 | strokeLineJoin = StrokeJoin.Miter,
384 | strokeLineMiter = 1.0f,
385 | pathFillType = PathFillType.NonZero
386 | ) {
387 | moveTo(160.745f, 94.3681f)
388 | lineTo(106.758f, 182.126f)
389 | lineTo(176.4f, 96.0697f)
390 | lineTo(160.745f, 94.3681f)
391 | close()
392 | }
393 | }
394 | group {
395 | path(
396 | fill = SolidColor(Color(0xFFA771FF)),
397 | fillAlpha = 1.0f,
398 | stroke = null,
399 | strokeAlpha = 1.0f,
400 | strokeLineWidth = 1.0f,
401 | strokeLineCap = StrokeCap.Butt,
402 | strokeLineJoin = StrokeJoin.Miter,
403 | strokeLineMiter = 1.0f,
404 | pathFillType = PathFillType.NonZero
405 | ) {
406 | moveTo(160.745f, 94.3681f)
407 | lineTo(106.758f, 182.126f)
408 | lineTo(176.4f, 96.0697f)
409 | lineTo(160.745f, 94.3681f)
410 | close()
411 | }
412 | }
413 | group {
414 | path(
415 | fill = SolidColor(Color(0xFFA771FF)),
416 | fillAlpha = 1.0f,
417 | stroke = null,
418 | strokeAlpha = 1.0f,
419 | strokeLineWidth = 1.0f,
420 | strokeLineCap = StrokeCap.Butt,
421 | strokeLineJoin = StrokeJoin.Miter,
422 | strokeLineMiter = 1.0f,
423 | pathFillType = PathFillType.NonZero
424 | ) {
425 | moveTo(160.745f, 94.3681f)
426 | lineTo(106.758f, 182.126f)
427 | lineTo(176.4f, 96.0697f)
428 | lineTo(160.745f, 94.3681f)
429 | close()
430 | }
431 | }
432 | group {
433 | path(
434 | fill = SolidColor(Color(0xFFA771FF)),
435 | fillAlpha = 1.0f,
436 | stroke = null,
437 | strokeAlpha = 1.0f,
438 | strokeLineWidth = 1.0f,
439 | strokeLineCap = StrokeCap.Butt,
440 | strokeLineJoin = StrokeJoin.Miter,
441 | strokeLineMiter = 1.0f,
442 | pathFillType = PathFillType.NonZero
443 | ) {
444 | moveTo(144.397f, 91.4365f)
445 | lineTo(90.4102f, 179.195f)
446 | lineTo(160.053f, 93.1381f)
447 | lineTo(144.397f, 91.4365f)
448 | close()
449 | }
450 | }
451 | group {
452 | path(
453 | fill = SolidColor(Color(0xFFA771FF)),
454 | fillAlpha = 1.0f,
455 | stroke = null,
456 | strokeAlpha = 1.0f,
457 | strokeLineWidth = 1.0f,
458 | strokeLineCap = StrokeCap.Butt,
459 | strokeLineJoin = StrokeJoin.Miter,
460 | strokeLineMiter = 1.0f,
461 | pathFillType = PathFillType.NonZero
462 | ) {
463 | moveTo(137.565f, 100.922f)
464 | lineTo(83.5781f, 188.68f)
465 | lineTo(153.221f, 102.624f)
466 | lineTo(137.565f, 100.922f)
467 | close()
468 | }
469 | }
470 | group {
471 | path(
472 | fill = SolidColor(Color(0xFFA771FF)),
473 | fillAlpha = 1.0f,
474 | stroke = null,
475 | strokeAlpha = 1.0f,
476 | strokeLineWidth = 1.0f,
477 | strokeLineCap = StrokeCap.Butt,
478 | strokeLineJoin = StrokeJoin.Miter,
479 | strokeLineMiter = 1.0f,
480 | pathFillType = PathFillType.NonZero
481 | ) {
482 | moveTo(136.428f, 114.582f)
483 | lineTo(82.4414f, 202.34f)
484 | lineTo(152.084f, 116.284f)
485 | lineTo(136.428f, 114.582f)
486 | close()
487 | }
488 | }
489 | group {
490 | path(
491 | fill = SolidColor(Color(0xFFA771FF)),
492 | fillAlpha = 1.0f,
493 | stroke = null,
494 | strokeAlpha = 1.0f,
495 | strokeLineWidth = 1.0f,
496 | strokeLineCap = StrokeCap.Butt,
497 | strokeLineJoin = StrokeJoin.Miter,
498 | strokeLineMiter = 1.0f,
499 | pathFillType = PathFillType.NonZero
500 | ) {
501 | moveTo(148.19f, 126.724f)
502 | lineTo(94.2031f, 214.482f)
503 | lineTo(163.846f, 128.426f)
504 | lineTo(148.19f, 126.724f)
505 | close()
506 | }
507 | }
508 | group {
509 | path(
510 | fill = SolidColor(Color(0xFFA771FF)),
511 | fillAlpha = 1.0f,
512 | stroke = null,
513 | strokeAlpha = 1.0f,
514 | strokeLineWidth = 1.0f,
515 | strokeLineCap = StrokeCap.Butt,
516 | strokeLineJoin = StrokeJoin.Miter,
517 | strokeLineMiter = 1.0f,
518 | pathFillType = PathFillType.NonZero
519 | ) {
520 | moveTo(170.759f, 95.3069f)
521 | lineTo(132.875f, 154.552f)
522 | lineTo(227.175f, 67.8656f)
523 | lineTo(200.069f, 64.9196f)
524 | lineTo(170.759f, 95.3069f)
525 | close()
526 | }
527 | }
528 | group {
529 | path(
530 | fill = SolidColor(Color(0xFFA771FF)),
531 | fillAlpha = 1.0f,
532 | stroke = null,
533 | strokeAlpha = 1.0f,
534 | strokeLineWidth = 1.0f,
535 | strokeLineCap = StrokeCap.Butt,
536 | strokeLineJoin = StrokeJoin.Miter,
537 | strokeLineMiter = 1.0f,
538 | pathFillType = PathFillType.NonZero
539 | ) {
540 | moveTo(185.206f, 79.854f)
541 | lineTo(97.2363f, 208.367f)
542 | lineTo(213.963f, 67.6116f)
543 | lineTo(185.206f, 79.854f)
544 | close()
545 | }
546 | }
547 | group {
548 | path(
549 | fill = SolidColor(Color(0xFFA771FF)),
550 | fillAlpha = 1.0f,
551 | stroke = null,
552 | strokeAlpha = 1.0f,
553 | strokeLineWidth = 1.0f,
554 | strokeLineCap = StrokeCap.Butt,
555 | strokeLineJoin = StrokeJoin.Miter,
556 | strokeLineMiter = 1.0f,
557 | pathFillType = PathFillType.NonZero
558 | ) {
559 | moveTo(166.78f, 78.5356f)
560 | lineTo(112.793f, 166.294f)
561 | lineTo(182.436f, 80.2372f)
562 | lineTo(166.78f, 78.5356f)
563 | close()
564 | }
565 | }
566 | group {
567 | path(
568 | fill = SolidColor(Color(0xFFA771FF)),
569 | fillAlpha = 1.0f,
570 | stroke = null,
571 | strokeAlpha = 1.0f,
572 | strokeLineWidth = 1.0f,
573 | strokeLineCap = StrokeCap.Butt,
574 | strokeLineJoin = StrokeJoin.Miter,
575 | strokeLineMiter = 1.0f,
576 | pathFillType = PathFillType.NonZero
577 | ) {
578 | moveTo(163.173f, 132.112f)
579 | lineTo(125.289f, 191.358f)
580 | lineTo(219.589f, 104.671f)
581 | lineTo(192.483f, 101.725f)
582 | lineTo(163.173f, 132.112f)
583 | close()
584 | }
585 | }
586 | group {
587 | path(
588 | fill = SolidColor(Color(0xFFA771FF)),
589 | fillAlpha = 1.0f,
590 | stroke = null,
591 | strokeAlpha = 1.0f,
592 | strokeLineWidth = 1.0f,
593 | strokeLineCap = StrokeCap.Butt,
594 | strokeLineJoin = StrokeJoin.Miter,
595 | strokeLineMiter = 1.0f,
596 | pathFillType = PathFillType.NonZero
597 | ) {
598 | moveTo(177.62f, 116.659f)
599 | lineTo(89.6504f, 245.173f)
600 | lineTo(206.377f, 104.417f)
601 | lineTo(177.62f, 116.659f)
602 | close()
603 | }
604 | }
605 | group {
606 | path(
607 | fill = SolidColor(Color(0xFFA771FF)),
608 | fillAlpha = 1.0f,
609 | stroke = null,
610 | strokeAlpha = 1.0f,
611 | strokeLineWidth = 1.0f,
612 | strokeLineCap = StrokeCap.Butt,
613 | strokeLineJoin = StrokeJoin.Miter,
614 | strokeLineMiter = 1.0f,
615 | pathFillType = PathFillType.NonZero
616 | ) {
617 | moveTo(190.721f, 102.716f)
618 | lineTo(136.734f, 190.474f)
619 | lineTo(206.377f, 104.417f)
620 | lineTo(190.721f, 102.716f)
621 | close()
622 | }
623 | }
624 | group {
625 | path(
626 | fill = SolidColor(Color(0xFFA771FF)),
627 | fillAlpha = 1.0f,
628 | stroke = null,
629 | strokeAlpha = 1.0f,
630 | strokeLineWidth = 1.0f,
631 | strokeLineCap = StrokeCap.Butt,
632 | strokeLineJoin = StrokeJoin.Miter,
633 | strokeLineMiter = 1.0f,
634 | pathFillType = PathFillType.NonZero
635 | ) {
636 | moveTo(181.386f, 129.076f)
637 | lineTo(143.502f, 188.322f)
638 | lineTo(237.802f, 101.635f)
639 | lineTo(210.696f, 98.6891f)
640 | lineTo(181.386f, 129.076f)
641 | close()
642 | }
643 | }
644 | group {
645 | path(
646 | fill = SolidColor(Color(0xFFA771FF)),
647 | fillAlpha = 1.0f,
648 | stroke = null,
649 | strokeAlpha = 1.0f,
650 | strokeLineWidth = 1.0f,
651 | strokeLineCap = StrokeCap.Butt,
652 | strokeLineJoin = StrokeJoin.Miter,
653 | strokeLineMiter = 1.0f,
654 | pathFillType = PathFillType.NonZero
655 | ) {
656 | moveTo(195.833f, 113.624f)
657 | lineTo(107.863f, 242.137f)
658 | lineTo(224.59f, 101.381f)
659 | lineTo(195.833f, 113.624f)
660 | close()
661 | }
662 | }
663 | group {
664 | path(
665 | fill = SolidColor(Color(0xFFA771FF)),
666 | fillAlpha = 1.0f,
667 | stroke = null,
668 | strokeAlpha = 1.0f,
669 | strokeLineWidth = 1.0f,
670 | strokeLineCap = StrokeCap.Butt,
671 | strokeLineJoin = StrokeJoin.Miter,
672 | strokeLineMiter = 1.0f,
673 | pathFillType = PathFillType.NonZero
674 | ) {
675 | moveTo(208.934f, 99.6799f)
676 | lineTo(154.947f, 187.438f)
677 | lineTo(224.59f, 101.381f)
678 | lineTo(208.934f, 99.6799f)
679 | close()
680 | }
681 | }
682 | group {
683 | path(
684 | fill = SolidColor(Color(0xFFA771FF)),
685 | fillAlpha = 1.0f,
686 | stroke = null,
687 | strokeAlpha = 1.0f,
688 | strokeLineWidth = 1.0f,
689 | strokeLineCap = StrokeCap.Butt,
690 | strokeLineJoin = StrokeJoin.Miter,
691 | strokeLineMiter = 1.0f,
692 | pathFillType = PathFillType.NonZero
693 | ) {
694 | moveTo(205.671f, 104.793f)
695 | lineTo(167.787f, 164.038f)
696 | lineTo(262.087f, 77.3517f)
697 | lineTo(234.981f, 74.4057f)
698 | lineTo(205.671f, 104.793f)
699 | close()
700 | }
701 | }
702 | group {
703 | path(
704 | fill = SolidColor(Color(0xFFA771FF)),
705 | fillAlpha = 1.0f,
706 | stroke = null,
707 | strokeAlpha = 1.0f,
708 | strokeLineWidth = 1.0f,
709 | strokeLineCap = StrokeCap.Butt,
710 | strokeLineJoin = StrokeJoin.Miter,
711 | strokeLineMiter = 1.0f,
712 | pathFillType = PathFillType.NonZero
713 | ) {
714 | moveTo(220.118f, 89.3401f)
715 | lineTo(132.148f, 217.853f)
716 | lineTo(248.875f, 77.0977f)
717 | lineTo(220.118f, 89.3401f)
718 | close()
719 | }
720 | }
721 | group {
722 | path(
723 | fill = SolidColor(Color(0xFFA771FF)),
724 | fillAlpha = 1.0f,
725 | stroke = null,
726 | strokeAlpha = 1.0f,
727 | strokeLineWidth = 1.0f,
728 | strokeLineCap = StrokeCap.Butt,
729 | strokeLineJoin = StrokeJoin.Miter,
730 | strokeLineMiter = 1.0f,
731 | pathFillType = PathFillType.NonZero
732 | ) {
733 | moveTo(233.219f, 75.3962f)
734 | lineTo(179.232f, 163.154f)
735 | lineTo(248.875f, 77.0978f)
736 | lineTo(233.219f, 75.3962f)
737 | close()
738 | }
739 | }
740 | group {
741 | path(
742 | fill = SolidColor(Color(0xFFA771FF)),
743 | fillAlpha = 1.0f,
744 | stroke = null,
745 | strokeAlpha = 1.0f,
746 | strokeLineWidth = 1.0f,
747 | strokeLineCap = StrokeCap.Butt,
748 | strokeLineJoin = StrokeJoin.Miter,
749 | strokeLineMiter = 1.0f,
750 | pathFillType = PathFillType.NonZero
751 | ) {
752 | moveTo(217.814f, 123.006f)
753 | lineTo(179.93f, 182.251f)
754 | lineTo(274.229f, 95.5644f)
755 | lineTo(247.124f, 92.6183f)
756 | lineTo(217.814f, 123.006f)
757 | close()
758 | }
759 | }
760 | group {
761 | path(
762 | fill = SolidColor(Color(0xFFA771FF)),
763 | fillAlpha = 1.0f,
764 | stroke = null,
765 | strokeAlpha = 1.0f,
766 | strokeLineWidth = 1.0f,
767 | strokeLineCap = StrokeCap.Butt,
768 | strokeLineJoin = StrokeJoin.Miter,
769 | strokeLineMiter = 1.0f,
770 | pathFillType = PathFillType.NonZero
771 | ) {
772 | moveTo(228.466f, 99.9343f)
773 | lineTo(140.496f, 228.448f)
774 | lineTo(257.222f, 87.6919f)
775 | lineTo(228.466f, 99.9343f)
776 | close()
777 | }
778 | }
779 | group {
780 | path(
781 | fill = SolidColor(Color(0xFFA771FF)),
782 | fillAlpha = 1.0f,
783 | stroke = null,
784 | strokeAlpha = 1.0f,
785 | strokeLineWidth = 1.0f,
786 | strokeLineCap = StrokeCap.Butt,
787 | strokeLineJoin = StrokeJoin.Miter,
788 | strokeLineMiter = 1.0f,
789 | pathFillType = PathFillType.NonZero
790 | ) {
791 | moveTo(245.362f, 93.6091f)
792 | lineTo(191.375f, 181.367f)
793 | lineTo(261.018f, 95.3107f)
794 | lineTo(245.362f, 93.6091f)
795 | close()
796 | }
797 | }
798 | group {
799 | path(
800 | fill = SolidColor(Color(0xFFA771FF)),
801 | fillAlpha = 1.0f,
802 | stroke = null,
803 | strokeAlpha = 1.0f,
804 | strokeLineWidth = 1.0f,
805 | strokeLineCap = StrokeCap.Butt,
806 | strokeLineJoin = StrokeJoin.Miter,
807 | strokeLineMiter = 1.0f,
808 | pathFillType = PathFillType.NonZero
809 | ) {
810 | moveTo(188.537f, 98.4949f)
811 | lineTo(150.652f, 157.74f)
812 | lineTo(244.952f, 71.0536f)
813 | lineTo(217.846f, 68.1076f)
814 | lineTo(188.537f, 98.4949f)
815 | close()
816 | }
817 | }
818 | group {
819 | path(
820 | fill = SolidColor(Color(0xFFA771FF)),
821 | fillAlpha = 1.0f,
822 | stroke = null,
823 | strokeAlpha = 1.0f,
824 | strokeLineWidth = 1.0f,
825 | strokeLineCap = StrokeCap.Butt,
826 | strokeLineJoin = StrokeJoin.Miter,
827 | strokeLineMiter = 1.0f,
828 | pathFillType = PathFillType.NonZero
829 | ) {
830 | moveTo(198.677f, 64.4959f)
831 | lineTo(110.707f, 193.009f)
832 | lineTo(227.433f, 52.2534f)
833 | lineTo(198.677f, 64.4959f)
834 | close()
835 | }
836 | }
837 | group {
838 | path(
839 | fill = SolidColor(Color(0xFFA771FF)),
840 | fillAlpha = 1.0f,
841 | stroke = null,
842 | strokeAlpha = 1.0f,
843 | strokeLineWidth = 1.0f,
844 | strokeLineCap = StrokeCap.Butt,
845 | strokeLineJoin = StrokeJoin.Miter,
846 | strokeLineMiter = 1.0f,
847 | pathFillType = PathFillType.NonZero
848 | ) {
849 | moveTo(223.225f, 56.9479f)
850 | lineTo(169.238f, 144.706f)
851 | lineTo(238.881f, 58.6495f)
852 | lineTo(223.225f, 56.9479f)
853 | close()
854 | }
855 | }
856 | group {
857 | path(
858 | fill = SolidColor(Color(0xFFA771FF)),
859 | fillAlpha = 1.0f,
860 | stroke = null,
861 | strokeAlpha = 1.0f,
862 | strokeLineWidth = 1.0f,
863 | strokeLineCap = StrokeCap.Butt,
864 | strokeLineJoin = StrokeJoin.Miter,
865 | strokeLineMiter = 1.0f,
866 | pathFillType = PathFillType.NonZero
867 | ) {
868 | moveTo(136.285f, 196.967f)
869 | lineTo(98.4004f, 256.212f)
870 | lineTo(192.7f, 169.526f)
871 | lineTo(165.595f, 166.58f)
872 | lineTo(136.285f, 196.967f)
873 | close()
874 | }
875 | }
876 | group {
877 | path(
878 | fill = SolidColor(Color(0xFFA771FF)),
879 | fillAlpha = 1.0f,
880 | stroke = null,
881 | strokeAlpha = 1.0f,
882 | strokeLineWidth = 1.0f,
883 | strokeLineCap = StrokeCap.Butt,
884 | strokeLineJoin = StrokeJoin.Miter,
885 | strokeLineMiter = 1.0f,
886 | pathFillType = PathFillType.NonZero
887 | ) {
888 | moveTo(150.732f, 181.514f)
889 | lineTo(62.7617f, 310.027f)
890 | lineTo(179.488f, 169.272f)
891 | lineTo(150.732f, 181.514f)
892 | close()
893 | }
894 | }
895 | group {
896 | path(
897 | fill = SolidColor(Color(0xFFA771FF)),
898 | fillAlpha = 1.0f,
899 | stroke = null,
900 | strokeAlpha = 1.0f,
901 | strokeLineWidth = 1.0f,
902 | strokeLineCap = StrokeCap.Butt,
903 | strokeLineJoin = StrokeJoin.Miter,
904 | strokeLineMiter = 1.0f,
905 | pathFillType = PathFillType.NonZero
906 | ) {
907 | moveTo(163.833f, 167.57f)
908 | lineTo(109.846f, 255.328f)
909 | lineTo(179.488f, 169.272f)
910 | lineTo(163.833f, 167.57f)
911 | close()
912 | }
913 | }
914 | group {
915 | path(
916 | fill = SolidColor(Color(0xFFA771FF)),
917 | fillAlpha = 1.0f,
918 | stroke = null,
919 | strokeAlpha = 1.0f,
920 | strokeLineWidth = 1.0f,
921 | strokeLineCap = StrokeCap.Butt,
922 | strokeLineJoin = StrokeJoin.Miter,
923 | strokeLineMiter = 1.0f,
924 | pathFillType = PathFillType.NonZero
925 | ) {
926 | moveTo(172.564f, 195.905f)
927 | lineTo(134.68f, 255.151f)
928 | lineTo(228.979f, 168.464f)
929 | lineTo(201.874f, 165.518f)
930 | lineTo(172.564f, 195.905f)
931 | close()
932 | }
933 | }
934 | group {
935 | path(
936 | fill = SolidColor(Color(0xFFA771FF)),
937 | fillAlpha = 1.0f,
938 | stroke = null,
939 | strokeAlpha = 1.0f,
940 | strokeLineWidth = 1.0f,
941 | strokeLineCap = StrokeCap.Butt,
942 | strokeLineJoin = StrokeJoin.Miter,
943 | strokeLineMiter = 1.0f,
944 | pathFillType = PathFillType.NonZero
945 | ) {
946 | moveTo(187.011f, 180.452f)
947 | lineTo(99.041f, 308.966f)
948 | lineTo(215.767f, 168.21f)
949 | lineTo(187.011f, 180.452f)
950 | close()
951 | }
952 | }
953 | group {
954 | path(
955 | fill = SolidColor(Color(0xFFA771FF)),
956 | fillAlpha = 1.0f,
957 | stroke = null,
958 | strokeAlpha = 1.0f,
959 | strokeLineWidth = 1.0f,
960 | strokeLineCap = StrokeCap.Butt,
961 | strokeLineJoin = StrokeJoin.Miter,
962 | strokeLineMiter = 1.0f,
963 | pathFillType = PathFillType.NonZero
964 | ) {
965 | moveTo(200.112f, 166.508f)
966 | lineTo(146.125f, 254.267f)
967 | lineTo(215.768f, 168.21f)
968 | lineTo(200.112f, 166.508f)
969 | close()
970 | }
971 | }
972 | group {
973 | path(
974 | fill = SolidColor(Color(0xFFA771FF)),
975 | fillAlpha = 1.0f,
976 | stroke = null,
977 | strokeAlpha = 1.0f,
978 | strokeLineWidth = 1.0f,
979 | strokeLineCap = StrokeCap.Butt,
980 | strokeLineJoin = StrokeJoin.Miter,
981 | strokeLineMiter = 1.0f,
982 | pathFillType = PathFillType.NonZero
983 | ) {
984 | moveTo(161.326f, 187.361f)
985 | lineTo(123.441f, 246.606f)
986 | lineTo(217.741f, 159.92f)
987 | lineTo(190.636f, 156.974f)
988 | lineTo(161.326f, 187.361f)
989 | close()
990 | }
991 | }
992 | group {
993 | path(
994 | fill = SolidColor(Color(0xFFA771FF)),
995 | fillAlpha = 1.0f,
996 | stroke = null,
997 | strokeAlpha = 1.0f,
998 | strokeLineWidth = 1.0f,
999 | strokeLineCap = StrokeCap.Butt,
1000 | strokeLineJoin = StrokeJoin.Miter,
1001 | strokeLineMiter = 1.0f,
1002 | pathFillType = PathFillType.NonZero
1003 | ) {
1004 | moveTo(175.773f, 171.908f)
1005 | lineTo(87.8027f, 300.421f)
1006 | lineTo(204.529f, 159.666f)
1007 | lineTo(175.773f, 171.908f)
1008 | close()
1009 | }
1010 | }
1011 | group {
1012 | path(
1013 | fill = SolidColor(Color(0xFFA771FF)),
1014 | fillAlpha = 1.0f,
1015 | stroke = null,
1016 | strokeAlpha = 1.0f,
1017 | strokeLineWidth = 1.0f,
1018 | strokeLineCap = StrokeCap.Butt,
1019 | strokeLineJoin = StrokeJoin.Miter,
1020 | strokeLineMiter = 1.0f,
1021 | pathFillType = PathFillType.NonZero
1022 | ) {
1023 | moveTo(188.874f, 157.964f)
1024 | lineTo(134.887f, 245.722f)
1025 | lineTo(204.529f, 159.666f)
1026 | lineTo(188.874f, 157.964f)
1027 | close()
1028 | }
1029 | }
1030 | group {
1031 | path(
1032 | fill = SolidColor(Color(0xFFA771FF)),
1033 | fillAlpha = 1.0f,
1034 | stroke = null,
1035 | strokeAlpha = 1.0f,
1036 | strokeLineWidth = 1.0f,
1037 | strokeLineCap = StrokeCap.Butt,
1038 | strokeLineJoin = StrokeJoin.Miter,
1039 | strokeLineMiter = 1.0f,
1040 | pathFillType = PathFillType.NonZero
1041 | ) {
1042 | moveTo(183.132f, 150.985f)
1043 | lineTo(145.248f, 210.231f)
1044 | lineTo(239.548f, 123.544f)
1045 | lineTo(212.442f, 120.598f)
1046 | lineTo(183.132f, 150.985f)
1047 | close()
1048 | }
1049 | }
1050 | group {
1051 | path(
1052 | fill = SolidColor(Color(0xFFA771FF)),
1053 | fillAlpha = 1.0f,
1054 | stroke = null,
1055 | strokeAlpha = 1.0f,
1056 | strokeLineWidth = 1.0f,
1057 | strokeLineCap = StrokeCap.Butt,
1058 | strokeLineJoin = StrokeJoin.Miter,
1059 | strokeLineMiter = 1.0f,
1060 | pathFillType = PathFillType.NonZero
1061 | ) {
1062 | moveTo(197.579f, 135.533f)
1063 | lineTo(109.609f, 264.046f)
1064 | lineTo(226.336f, 123.29f)
1065 | lineTo(197.579f, 135.533f)
1066 | close()
1067 | }
1068 | }
1069 | group {
1070 | path(
1071 | fill = SolidColor(Color(0xFFA771FF)),
1072 | fillAlpha = 1.0f,
1073 | stroke = null,
1074 | strokeAlpha = 1.0f,
1075 | strokeLineWidth = 1.0f,
1076 | strokeLineCap = StrokeCap.Butt,
1077 | strokeLineJoin = StrokeJoin.Miter,
1078 | strokeLineMiter = 1.0f,
1079 | pathFillType = PathFillType.NonZero
1080 | ) {
1081 | moveTo(210.678f, 121.589f)
1082 | lineTo(156.691f, 209.347f)
1083 | lineTo(226.334f, 123.29f)
1084 | lineTo(210.678f, 121.589f)
1085 | close()
1086 | }
1087 | }
1088 | group {
1089 | path(
1090 | fill = SolidColor(Color(0xFFA771FF)),
1091 | fillAlpha = 1.0f,
1092 | stroke = null,
1093 | strokeAlpha = 1.0f,
1094 | strokeLineWidth = 1.0f,
1095 | strokeLineCap = StrokeCap.Butt,
1096 | strokeLineJoin = StrokeJoin.Miter,
1097 | strokeLineMiter = 1.0f,
1098 | pathFillType = PathFillType.NonZero
1099 | ) {
1100 | moveTo(108.523f, 180.363f)
1101 | lineTo(70.6387f, 239.608f)
1102 | lineTo(164.938f, 152.922f)
1103 | lineTo(137.833f, 149.976f)
1104 | lineTo(108.523f, 180.363f)
1105 | close()
1106 | }
1107 | }
1108 | group {
1109 | path(
1110 | fill = SolidColor(Color(0xFFA771FF)),
1111 | fillAlpha = 1.0f,
1112 | stroke = null,
1113 | strokeAlpha = 1.0f,
1114 | strokeLineWidth = 1.0f,
1115 | strokeLineCap = StrokeCap.Butt,
1116 | strokeLineJoin = StrokeJoin.Miter,
1117 | strokeLineMiter = 1.0f,
1118 | pathFillType = PathFillType.NonZero
1119 | ) {
1120 | moveTo(122.97f, 164.91f)
1121 | lineTo(35f, 293.424f)
1122 | lineTo(151.726f, 152.668f)
1123 | lineTo(122.97f, 164.91f)
1124 | close()
1125 | }
1126 | }
1127 | group {
1128 | path(
1129 | fill = SolidColor(Color(0xFFA771FF)),
1130 | fillAlpha = 1.0f,
1131 | stroke = null,
1132 | strokeAlpha = 1.0f,
1133 | strokeLineWidth = 1.0f,
1134 | strokeLineCap = StrokeCap.Butt,
1135 | strokeLineJoin = StrokeJoin.Miter,
1136 | strokeLineMiter = 1.0f,
1137 | pathFillType = PathFillType.NonZero
1138 | ) {
1139 | moveTo(136.069f, 150.966f)
1140 | lineTo(82.082f, 238.725f)
1141 | lineTo(151.725f, 152.668f)
1142 | lineTo(136.069f, 150.966f)
1143 | close()
1144 | }
1145 | }
1146 | group {
1147 | path(
1148 | fill = SolidColor(Color(0xFFA771FF)),
1149 | fillAlpha = 1.0f,
1150 | stroke = null,
1151 | strokeAlpha = 1.0f,
1152 | strokeLineWidth = 1.0f,
1153 | strokeLineCap = StrokeCap.Butt,
1154 | strokeLineJoin = StrokeJoin.Miter,
1155 | strokeLineMiter = 1.0f,
1156 | pathFillType = PathFillType.NonZero
1157 | ) {
1158 | moveTo(233.853f, 125.014f)
1159 | lineTo(195.969f, 184.26f)
1160 | lineTo(290.268f, 97.5729f)
1161 | lineTo(263.163f, 94.6269f)
1162 | lineTo(233.853f, 125.014f)
1163 | close()
1164 | }
1165 | }
1166 | group {
1167 | path(
1168 | fill = SolidColor(Color(0xFFA771FF)),
1169 | fillAlpha = 1.0f,
1170 | stroke = null,
1171 | strokeAlpha = 1.0f,
1172 | strokeLineWidth = 1.0f,
1173 | strokeLineCap = StrokeCap.Butt,
1174 | strokeLineJoin = StrokeJoin.Miter,
1175 | strokeLineMiter = 1.0f,
1176 | pathFillType = PathFillType.NonZero
1177 | ) {
1178 | moveTo(248.3f, 109.561f)
1179 | lineTo(160.33f, 238.074f)
1180 | lineTo(277.056f, 97.3189f)
1181 | lineTo(248.3f, 109.561f)
1182 | close()
1183 | }
1184 | }
1185 | group {
1186 | path(
1187 | fill = SolidColor(Color(0xFFA771FF)),
1188 | fillAlpha = 1.0f,
1189 | stroke = null,
1190 | strokeAlpha = 1.0f,
1191 | strokeLineWidth = 1.0f,
1192 | strokeLineCap = StrokeCap.Butt,
1193 | strokeLineJoin = StrokeJoin.Miter,
1194 | strokeLineMiter = 1.0f,
1195 | pathFillType = PathFillType.NonZero
1196 | ) {
1197 | moveTo(261.401f, 95.6174f)
1198 | lineTo(207.414f, 183.375f)
1199 | lineTo(277.057f, 97.319f)
1200 | lineTo(261.401f, 95.6174f)
1201 | close()
1202 | }
1203 | }
1204 | }.build()
1205 | }
1206 | }
1207 |
1208 |
--------------------------------------------------------------------------------