├── .nvmrc
├── rust-toolchain
├── .husky
└── pre-commit
├── .rustfmt.toml
├── packages
├── react
│ ├── refresh
│ │ ├── .gitignore
│ │ ├── .npmignore
│ │ └── tsconfig.json
│ ├── runtime
│ │ ├── lazy
│ │ │ └── import.d.ts
│ │ ├── .gitignore
│ │ ├── .prettierrc
│ │ ├── CHANGELOG.md
│ │ ├── .npmignore
│ │ └── debug
│ │ │ ├── index.d.ts
│ │ │ └── index.js
│ ├── components
│ │ ├── .gitignore
│ │ └── .npmignore
│ ├── transform
│ │ ├── cjs
│ │ │ ├── package.json
│ │ │ └── main.d.cts
│ │ ├── .cargo
│ │ │ └── config.toml
│ │ ├── src
│ │ │ └── swc_plugin_shake
│ │ │ │ └── README.md
│ │ ├── tests
│ │ │ └── __swc_snapshots__
│ │ │ │ └── src
│ │ │ │ ├── swc_plugin_compat
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── should_rename_view.js
│ │ │ │ │ ├── should_left_no_remove_component_element_attr.js
│ │ │ │ │ ├── should_not_handle_jsx_member_expression.js
│ │ │ │ │ ├── should_transform_event_props_1.js
│ │ │ │ │ ├── should_transform_event_props_2.js
│ │ │ │ │ ├── should_change_runtime_pkg.js
│ │ │ │ │ ├── should_not_rename_view_redeclaration.js
│ │ │ │ │ ├── should_add_component_element_embedded_compiler_only.js
│ │ │ │ │ ├── should_not_rename_view_in_scope.js
│ │ │ │ │ ├── should_handle_recursive.js
│ │ │ │ │ └── should_simplify_ctor.js
│ │ │ │ ├── swc_plugin_snapshot
│ │ │ │ └── mod.rs
│ │ │ │ │ └── empty_module.js
│ │ │ │ ├── swc_plugin_define_dce
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── should_replace_to_lit.js
│ │ │ │ │ ├── should_be_able_to_define_object.js
│ │ │ │ │ ├── should_not_crash_when_eval_failed.js
│ │ │ │ │ ├── should_keep_only_true_branch.js
│ │ │ │ │ ├── should_replace_to_lit_recur.js
│ │ │ │ │ ├── should_keep_only_true_branch_if_else_if.js
│ │ │ │ │ ├── should_keep_only_true_branch_with_unary_operator.js
│ │ │ │ │ ├── should_not_replace_to_lit_when_resolved.js
│ │ │ │ │ └── should_not_eval_bad_case_modifying.js
│ │ │ │ ├── swc_plugin_directive_dce
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── should_eliminate_fn_decl.js
│ │ │ │ │ ├── should_eliminate_fn_body_in_component_props.js
│ │ │ │ │ ├── should_eliminate_native_modules_in_default_params.js
│ │ │ │ │ ├── should_do_nothing_when_arrow_function_return_directive.js
│ │ │ │ │ ├── should_eliminate_js_only_class_method.js
│ │ │ │ │ ├── should_eliminate_js_only_class_property.js
│ │ │ │ │ └── should_eliminate_js_only_but_keep_constructor.js
│ │ │ │ ├── swc_plugin_worklet
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── class_in_worklet_1.js
│ │ │ │ │ ├── should_extract_member_expr_4_js.js
│ │ │ │ │ ├── should_transform_fn_decl_js.js
│ │ │ │ │ ├── should_transform_ui_worklet_js.js
│ │ │ │ │ ├── should_extract_ident_from_this_js.js
│ │ │ │ │ ├── should_not_transform_constructor.js
│ │ │ │ │ ├── should_transform_js_general.js
│ │ │ │ │ ├── should_extract_idents_outside_of_ctx.js
│ │ │ │ │ └── should_not_extract_ident_from_this.js
│ │ │ │ ├── swc_plugin_inject
│ │ │ │ └── mod.rs
│ │ │ │ │ └── should_inject_callee.js
│ │ │ │ ├── swc_plugin_list
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── should_transform_list_item_not_deferred.js
│ │ │ │ │ └── should_not_transform_list_item_with_defer_false.js
│ │ │ │ ├── swc_plugin_shake
│ │ │ │ └── mod.rs
│ │ │ │ │ ├── should_not_remove_test_with_other_runtime.js
│ │ │ │ │ ├── should_remove_test.js
│ │ │ │ │ ├── should_remove_unused_indirect.js
│ │ │ │ │ ├── should_remove_use_effect_param.js
│ │ │ │ │ ├── should_not_remove_in_scope_id.js
│ │ │ │ │ └── should_keep_state_and_remove_other.js
│ │ │ │ └── swc_plugin_compat_post
│ │ │ │ └── mod.rs
│ │ │ │ └── should_compat_dark_mode.js
│ │ ├── .npmignore
│ │ ├── .gitignore
│ │ └── __test__
│ │ │ └── css
│ │ │ └── __snapshots__
│ │ │ └── transform-imports-defaults.js
│ ├── worklet-runtime
│ │ ├── .gitignore
│ │ ├── .npmignore
│ │ └── src
│ │ │ └── types
│ │ │ └── dev.d.ts
│ ├── testing-library
│ │ ├── .npmignore
│ │ ├── src
│ │ │ ├── __tests__
│ │ │ │ ├── css
│ │ │ │ │ ├── style1.css
│ │ │ │ │ ├── style3.module.css
│ │ │ │ │ └── style2.css
│ │ │ │ └── lazy-bundle
│ │ │ │ │ └── LazyComponent.jsx
│ │ │ ├── entry.ts
│ │ │ └── env
│ │ │ │ └── vitest.ts
│ │ └── types
│ │ │ └── pure.d.ts
│ └── api-extractor.json
├── rspeedy
│ ├── core
│ │ ├── test
│ │ │ ├── client
│ │ │ │ ├── bar.svg
│ │ │ │ ├── baz.gif
│ │ │ │ ├── foo.png
│ │ │ │ ├── simple.module.css
│ │ │ │ ├── simple.module.less
│ │ │ │ └── simple.module.scss
│ │ │ ├── cli
│ │ │ │ └── fixtures
│ │ │ │ │ ├── environment
│ │ │ │ │ └── lynx.config.js
│ │ │ │ │ ├── project-with-env
│ │ │ │ │ ├── lynx.config.js
│ │ │ │ │ ├── .env
│ │ │ │ │ └── .env.test
│ │ │ │ │ ├── start
│ │ │ │ │ ├── .gitignore
│ │ │ │ │ ├── package.json
│ │ │ │ │ └── node_modules
│ │ │ │ │ │ └── @lynx-js
│ │ │ │ │ │ └── rspeedy
│ │ │ │ │ │ └── lib
│ │ │ │ │ │ └── cli
│ │ │ │ │ │ └── main.js
│ │ │ │ │ ├── invalid-config
│ │ │ │ │ ├── resolve-error.ts
│ │ │ │ │ └── resolve-error-2.ts
│ │ │ │ │ ├── onCloseBuild
│ │ │ │ │ └── src
│ │ │ │ │ │ └── index.js
│ │ │ │ │ ├── register
│ │ │ │ │ ├── foo.ts
│ │ │ │ │ └── with-query.ts
│ │ │ │ │ ├── register.js
│ │ │ │ │ ├── start-no-dependencies
│ │ │ │ │ └── package.json
│ │ │ │ │ ├── build-cache
│ │ │ │ │ ├── lynx.config.js
│ │ │ │ │ └── build-dependencies.js
│ │ │ │ │ ├── start-invalid-package-json
│ │ │ │ │ └── package.json
│ │ │ │ │ ├── watch-files
│ │ │ │ │ └── object.js
│ │ │ │ │ └── start-invalid-entry-point
│ │ │ │ │ └── package.json
│ │ │ ├── config
│ │ │ │ └── fixtures
│ │ │ │ │ ├── error
│ │ │ │ │ ├── invalid.js
│ │ │ │ │ └── throw.js
│ │ │ │ │ ├── cjs
│ │ │ │ │ ├── .gitignore
│ │ │ │ │ ├── default
│ │ │ │ │ │ ├── package.json
│ │ │ │ │ │ ├── config.mjs
│ │ │ │ │ │ └── config.js
│ │ │ │ │ ├── package.json
│ │ │ │ │ ├── lynx.config.mts
│ │ │ │ │ ├── lynx.config.js
│ │ │ │ │ ├── export-default.ts
│ │ │ │ │ ├── node_modules
│ │ │ │ │ │ └── esm-pkg
│ │ │ │ │ │ │ ├── package.json
│ │ │ │ │ │ │ └── index.js
│ │ │ │ │ └── esm-import-esm.js
│ │ │ │ │ ├── order
│ │ │ │ │ ├── lynx.config.js
│ │ │ │ │ └── lynx.config.ts
│ │ │ │ │ ├── default
│ │ │ │ │ └── lynx.config.ts
│ │ │ │ │ └── custom
│ │ │ │ │ ├── custom.config.js
│ │ │ │ │ ├── custom.cts
│ │ │ │ │ ├── custom.mts
│ │ │ │ │ ├── custom.config.cjs
│ │ │ │ │ ├── custom-cts.config.ts
│ │ │ │ │ ├── enum.ts
│ │ │ │ │ └── const-enum.ts
│ │ │ └── plugins
│ │ │ │ └── fixtures
│ │ │ │ └── hello-world
│ │ │ │ └── index.js
│ │ └── api-extractor.json
│ ├── create-rspeedy
│ │ ├── .gitignore
│ │ ├── template-react-vitest-rltl-ts
│ │ │ └── src
│ │ │ │ └── rspeedy-env.d.ts
│ │ └── template-common
│ │ │ ├── src
│ │ │ └── assets
│ │ │ │ ├── arrow.png
│ │ │ │ ├── lynx-logo.png
│ │ │ │ └── react-logo.png
│ │ │ └── gitignore
│ ├── plugin-qrcode
│ │ ├── test
│ │ │ └── fixtures
│ │ │ │ ├── error
│ │ │ │ └── index.js
│ │ │ │ └── hello-world
│ │ │ │ └── index.js
│ │ └── api-extractor.json
│ ├── plugin-react
│ │ └── test
│ │ │ ├── fixtures
│ │ │ ├── special-var-name
│ │ │ │ ├── Card
│ │ │ │ │ └── Card.js
│ │ │ │ ├── ReactLynx
│ │ │ │ │ └── index.js
│ │ │ │ ├── Component.js
│ │ │ │ └── Behavior.jsx
│ │ │ ├── defineDCE
│ │ │ │ └── basic.js
│ │ │ ├── postcss
│ │ │ │ └── postcss.config.js
│ │ │ ├── background-only
│ │ │ │ └── backgroundCall.tsx
│ │ │ └── standalone-lazy-bundle
│ │ │ │ └── index.tsx
│ │ │ └── tsconfig.json
│ ├── websocket
│ │ ├── README.md
│ │ └── api-extractor.json
│ └── plugin-react-alias
│ │ ├── api-extractor.json
│ │ └── tsconfig.json
├── web-platform
│ ├── .gitignore
│ ├── web-explorer
│ │ ├── README.md
│ │ └── icons
│ │ │ ├── icon-72x72.png
│ │ │ ├── icon-96x96.png
│ │ │ ├── icon-128x128.png
│ │ │ ├── icon-144x144.png
│ │ │ ├── icon-152x152.png
│ │ │ ├── icon-192x192.png
│ │ │ ├── icon-384x384.png
│ │ │ └── icon-512x512.png
│ ├── web-tests
│ │ ├── resources
│ │ │ ├── text.txt
│ │ │ ├── lynx-logo.jpeg
│ │ │ ├── chromium-logo.png
│ │ │ ├── firefox-logo.png
│ │ │ ├── inline-image.png
│ │ │ ├── NotoSansSC-Regular.woff2
│ │ │ └── ddee519472dd7e73eeb153e78d484db3.mp3
│ │ ├── Notice.txt
│ │ ├── tests
│ │ │ ├── react
│ │ │ │ ├── basic-flex-1
│ │ │ │ │ └── index.css
│ │ │ │ ├── basic-css-asset-in-css
│ │ │ │ │ └── index.css
│ │ │ │ ├── basic-element-x-input-placeholder-pseudo-element
│ │ │ │ │ └── index.css
│ │ │ │ ├── basic-css-compound-selector
│ │ │ │ │ └── index.css
│ │ │ │ ├── basic-element-image-placeholder
│ │ │ │ │ └── lynx.png
│ │ │ │ ├── basic-element-text-color
│ │ │ │ │ └── index.css
│ │ │ │ ├── basic-element-x-refresh-view-demo
│ │ │ │ │ └── img.png
│ │ │ │ ├── basic-css-var
│ │ │ │ │ └── index.css
│ │ │ │ └── basic-element-x-swiper-swiper-dynamic
│ │ │ │ │ └── getColor.js
│ │ │ ├── web-elements
│ │ │ │ └── x-audio-tt
│ │ │ │ │ ├── source-detail.mp3
│ │ │ │ │ └── source-horse.mp3
│ │ │ ├── react.spec.ts-snapshots
│ │ │ │ ├── svg
│ │ │ │ │ ├── utf8
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── with-css
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ └── hex-color
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ ├── text
│ │ │ │ │ ├── maxline
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── baseline
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── maxlength
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── nest-image
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── nest-text
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── nest-view
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── word-break
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── display-none
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ └── raw-text-new-line
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ ├── x-input
│ │ │ │ │ ├── blur
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── type
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ └── placeholder
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ ├── image
│ │ │ │ │ ├── auto-size
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── placeholder
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ └── border-radius
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ ├── x-swiper
│ │ │ │ │ ├── scroll-to
│ │ │ │ │ │ ├── 1-firefox-linux.png
│ │ │ │ │ │ ├── 1-webkit-linux.png
│ │ │ │ │ │ ├── 2-firefox-linux.png
│ │ │ │ │ │ ├── 2-webkit-linux.png
│ │ │ │ │ │ ├── 3-firefox-linux.png
│ │ │ │ │ │ ├── 3-webkit-linux.png
│ │ │ │ │ │ ├── 1-chromium-linux.png
│ │ │ │ │ │ ├── 2-chromium-linux.png
│ │ │ │ │ │ └── 3-chromium-linux.png
│ │ │ │ │ ├── autoplay-10
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── autoplay-15
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── autoplay-20
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── autoplay-5
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── current-0
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── current-1
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── current-2
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── current-3
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── current-4
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ ├── interval-1
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── interval-2
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── interval-3
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── mode-carry
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ ├── mode-normal
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ │ ├── duration
│ │ │ │ │ │ ├── current-1-firefox-linux.png
│ │ │ │ │ │ ├── current-1-webkit-linux.png
│ │ │ │ │ │ ├── current-2-firefox-linux.png
│ │ │ │ │ │ ├── current-2-webkit-linux.png
│ │ │ │ │ │ ├── current-3-firefox-linux.png
│ │ │ │ │ │ ├── current-3-webkit-linux.png
│ │ │ │ │ │ ├── current-4-firefox-linux.png
│ │ │ │ │ │ └── current-4-webkit-linux.png
│ │ │ │ │ ├── mode-carousel
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ │ └── page-margin
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ ├── api-animate
│ │ │ │ │ ├── animate
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ │ └── initial
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ │ └── index-chromium-linux.png
│ │ │ │ ├── basic-flex-1
│ │ │ │ │ └── index
│ │ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ │ ├── index-firefox-linux.png
│ │ │ │ │ │ └── index-webkit-linux.png
│ │ │ │ └── x-overlay-ng
│ │ │ │ │ └── demo
│ │ │ │ │ ├── inital-chromium-linux.png
│ │ │ │ │ ├── inital-firefox-linux.png
│ │ │ │ │ └── inital-webkit-linux.png
│ │ │ └── web-elements.spec.ts-snapshots
│ │ │ │ ├── x-image
│ │ │ │ └── basic
│ │ │ │ │ ├── index-webkit-linux.png
│ │ │ │ │ ├── index-chromium-linux.png
│ │ │ │ │ └── index-firefox-linux.png
│ │ │ │ └── x-list
│ │ │ │ ├── sticky
│ │ │ │ ├── index-webkit-linux.png
│ │ │ │ ├── index-chromium-linux.png
│ │ │ │ └── index-firefox-linux.png
│ │ │ │ ├── axis-gap
│ │ │ │ └── index-webkit-linux.png
│ │ │ │ └── basic
│ │ │ │ ├── initial-firefox-linux.png
│ │ │ │ └── initial-webkit-linux.png
│ │ └── shell-project
│ │ │ ├── fp-only.ts
│ │ │ └── web-elements.ts
│ ├── web-worker-rpc
│ │ ├── README.md
│ │ └── Notice.txt
│ ├── web-worker-runtime
│ │ ├── README.md
│ │ └── Notice.txt
│ ├── web-core-server
│ │ └── .gitignore
│ ├── web-elements
│ │ ├── src
│ │ │ ├── XSvg
│ │ │ │ └── index.ts
│ │ │ ├── XInput
│ │ │ │ └── index.ts
│ │ │ ├── XAudioTT
│ │ │ │ ├── index.ts
│ │ │ │ └── x-audio-tt.css
│ │ │ ├── XCanvas
│ │ │ │ └── index.ts
│ │ │ ├── ScrollView
│ │ │ │ └── index.ts
│ │ │ ├── XOverlayNg
│ │ │ │ └── index.ts
│ │ │ ├── XTextarea
│ │ │ │ └── index.ts
│ │ │ ├── LynxWrapper
│ │ │ │ └── index.ts
│ │ │ ├── XList
│ │ │ │ └── index.ts
│ │ │ ├── XView
│ │ │ │ └── index.ts
│ │ │ ├── XImage
│ │ │ │ └── index.ts
│ │ │ ├── XSwiper
│ │ │ │ └── index.ts
│ │ │ ├── XViewpagerNg
│ │ │ │ └── index.ts
│ │ │ ├── common
│ │ │ │ └── renameEvent.ts
│ │ │ └── XRefreshView
│ │ │ │ └── index.ts
│ │ └── Notice.txt
│ ├── web-style-transformer
│ │ ├── standard.js
│ │ ├── src
│ │ │ └── transformer
│ │ │ │ └── mod.rs
│ │ ├── Notice.txt
│ │ ├── README.md
│ │ ├── legacy.js
│ │ └── index.d.ts
│ ├── web-core
│ │ └── Notice.txt
│ ├── web-constants
│ │ ├── Notice.txt
│ │ └── src
│ │ │ └── types
│ │ │ └── FlushElementTreeOptions.ts
│ ├── offscreen-document
│ │ ├── Notice.txt
│ │ └── README.md
│ ├── web-elements-compat
│ │ └── Notice.txt
│ ├── web-elements-reactive
│ │ ├── Notice.txt
│ │ └── README.md
│ ├── web-elements-template
│ │ └── Notice.txt
│ ├── web-mainthread-apis
│ │ ├── Notice.txt
│ │ └── README.md
│ ├── web-rsbuild-plugin
│ │ ├── tests
│ │ │ ├── tsconfig.json
│ │ │ └── __snapshots__
│ │ │ │ └── config.test.ts.snap
│ │ ├── api-extractor.json
│ │ └── rslib.config.ts
│ ├── inline-style-parser
│ │ └── Cargo.toml
│ └── .nycrc.json
├── webpack
│ ├── react-webpack-plugin
│ │ ├── .gitignore
│ │ ├── test
│ │ │ ├── cases
│ │ │ │ ├── basic
│ │ │ │ │ ├── public-path
│ │ │ │ │ │ ├── asset.json
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── export-default-abstract
│ │ │ │ │ │ └── abstract.ts
│ │ │ │ │ ├── swc-syntax-config
│ │ │ │ │ │ └── c-style-cast.ts
│ │ │ │ │ ├── hello-world
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── lazy-imports
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── bundle-splitting
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── css
│ │ │ │ │ ├── modules
│ │ │ │ │ │ └── index.module.css
│ │ │ │ │ ├── modules-remove-scope
│ │ │ │ │ │ └── index.module.css
│ │ │ │ │ └── modules-without-jsx
│ │ │ │ │ │ └── index.module.css
│ │ │ │ ├── code-splitting
│ │ │ │ │ ├── context
│ │ │ │ │ │ └── locales
│ │ │ │ │ │ │ ├── bar.json
│ │ │ │ │ │ │ ├── baz.json
│ │ │ │ │ │ │ └── foo.json
│ │ │ │ │ ├── basic
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── eval-result
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── amd-runtime
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── bar.js
│ │ │ │ │ ├── load-lazy-bundle
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── recursive
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── async-chunk-name
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── bar.js
│ │ │ │ │ ├── chunk-filename
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── with-static
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── background-only
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── amd-runtime-with-source-map
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── bar.js
│ │ │ │ │ ├── async-chunk-groups
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── amd-runtime-production
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ └── amd-runtime-lazy-bundle-production
│ │ │ │ │ │ └── baz.js
│ │ │ │ ├── main-thread
│ │ │ │ │ ├── code-splitting
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── bar.js
│ │ │ │ │ └── entry
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── typescript
│ │ │ │ │ └── type-import
│ │ │ │ │ │ ├── bar.ts
│ │ │ │ │ │ └── e.ts
│ │ │ │ ├── define
│ │ │ │ │ ├── extract-str
│ │ │ │ │ │ ├── index.jsx
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── disable-create-selector-query
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── disable-create-selector-query-false
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── dev
│ │ │ │ │ │ ├── index.jsx
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── dev-true
│ │ │ │ │ │ ├── index.jsx
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── default
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── profile
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── enum
│ │ │ │ │ ├── basic
│ │ │ │ │ │ ├── e.ts
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── tree-shake
│ │ │ │ │ │ ├── e.ts
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── source-map
│ │ │ │ │ ├── jsx
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── tsx
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── compat
│ │ │ │ │ ├── component-is
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── run-in-js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── define-dce
│ │ │ │ │ └── basic
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ └── directive-dce
│ │ │ │ │ └── basic
│ │ │ │ │ └── test.config.cjs
│ │ │ └── diagnostic
│ │ │ │ ├── module-build-failed
│ │ │ │ └── errors
│ │ │ │ │ ├── index.jsx
│ │ │ │ │ ├── invalid.js
│ │ │ │ │ └── rspack.config.js
│ │ │ │ ├── jsx
│ │ │ │ ├── namespace-name
│ │ │ │ │ ├── index.jsx
│ │ │ │ │ └── rspack.config.js
│ │ │ │ ├── component
│ │ │ │ │ ├── index.jsx
│ │ │ │ │ └── rspack.config.js
│ │ │ │ └── _unknown-css-property
│ │ │ │ │ ├── rspack.config.js
│ │ │ │ │ └── index.jsx
│ │ │ │ ├── main-thread
│ │ │ │ └── error
│ │ │ │ │ ├── index.jsx
│ │ │ │ │ └── rspack.config.js
│ │ │ │ └── compat
│ │ │ │ ├── lynx-key
│ │ │ │ ├── rspack.config.js
│ │ │ │ └── index.jsx
│ │ │ │ ├── utf-8
│ │ │ │ ├── rspack.config.js
│ │ │ │ └── index.jsx
│ │ │ │ ├── get-node-ref
│ │ │ │ └── rspack.config.js
│ │ │ │ ├── react-runtime
│ │ │ │ ├── rspack.config.js
│ │ │ │ └── expected
│ │ │ │ │ └── webpack.txt
│ │ │ │ ├── stop-propagation
│ │ │ │ └── rspack.config.js
│ │ │ │ └── this-selector-query
│ │ │ │ └── rspack.config.js
│ │ └── api-extractor.json
│ ├── template-webpack-plugin
│ │ ├── test
│ │ │ ├── cases
│ │ │ │ ├── hooks
│ │ │ │ │ ├── before-emit-lepus
│ │ │ │ │ │ ├── index.js
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── after-emit
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── before-emit
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── before-encode
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── before-emit-filename
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ └── before-emit-filename-hash
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ ├── web
│ │ │ │ │ ├── all-in-one
│ │ │ │ │ │ ├── a.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── page-config
│ │ │ │ │ │ ├── a.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── default-export
│ │ │ │ │ │ ├── a.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ └── element-template
│ │ │ │ │ │ ├── a.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── code-splitting
│ │ │ │ │ ├── context
│ │ │ │ │ │ ├── a.json
│ │ │ │ │ │ └── b.json
│ │ │ │ │ ├── async-chunk
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── webpack-chunk-name
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ └── duplicated-async-chunk
│ │ │ │ │ │ └── shared
│ │ │ │ │ │ ├── baz.js
│ │ │ │ │ │ └── bar.js
│ │ │ │ ├── bundle-splitting
│ │ │ │ │ └── async-chunk
│ │ │ │ │ │ ├── dynamic.js
│ │ │ │ │ │ ├── dynamic2.js
│ │ │ │ │ │ ├── dynamic3.js
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ ├── assets
│ │ │ │ │ ├── production
│ │ │ │ │ │ ├── async
│ │ │ │ │ │ │ └── baz.js
│ │ │ │ │ │ ├── shared
│ │ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ │ └── foo.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ │ ├── mode-none
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── debug-info
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── filename-flat
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── filename-hash
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── lazy-bundle
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── source-map
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── debug-info-filename
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ ├── filename-hash-8
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ └── debug-info-public-path-auto
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ ├── inline-scripts
│ │ │ │ │ ├── external
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── inline
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── inline-fn
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── inline-object
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ ├── inline-regex
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ └── foo.js
│ │ │ │ │ └── inline-partial
│ │ │ │ │ │ ├── bar.js
│ │ │ │ │ │ ├── foo.js
│ │ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── runtime-module
│ │ │ │ │ ├── async-chunk
│ │ │ │ │ │ ├── dynamic.js
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ │ └── async-chunks
│ │ │ │ │ │ ├── dynamic.js
│ │ │ │ │ │ ├── dynamic2.js
│ │ │ │ │ │ └── rspack.config.js
│ │ │ │ └── main-thread
│ │ │ │ │ └── mpa
│ │ │ │ │ └── rspack.config.js
│ │ │ └── fixtures
│ │ │ │ └── basic.tsx
│ │ └── api-extractor.json
│ ├── css-extract-webpack-plugin
│ │ ├── test
│ │ │ ├── cases
│ │ │ │ ├── base-uri
│ │ │ │ │ ├── index.js
│ │ │ │ │ ├── expected
│ │ │ │ │ │ ├── index.mjs
│ │ │ │ │ │ ├── index.css
│ │ │ │ │ │ └── asset
│ │ │ │ │ │ │ └── roboto-v18-latin-300.ttf
│ │ │ │ │ ├── rspack-expected
│ │ │ │ │ │ ├── index.mjs
│ │ │ │ │ │ └── index.css
│ │ │ │ │ ├── main.css
│ │ │ │ │ └── fonts
│ │ │ │ │ │ └── roboto-v18-latin-300.ttf
│ │ │ │ ├── asset-modules
│ │ │ │ │ ├── index.js
│ │ │ │ │ ├── style.css
│ │ │ │ │ ├── expected
│ │ │ │ │ │ └── main.css
│ │ │ │ │ └── rspack-expected
│ │ │ │ │ │ └── main.css
│ │ │ │ ├── base-uri-in-entry
│ │ │ │ │ ├── index.js
│ │ │ │ │ ├── expected
│ │ │ │ │ │ └── index.mjs
│ │ │ │ │ ├── rspack-expected
│ │ │ │ │ │ └── index.mjs
│ │ │ │ │ ├── main.css
│ │ │ │ │ └── fonts
│ │ │ │ │ │ └── roboto-v18-latin-300.ttf
│ │ │ │ ├── hmr-locals
│ │ │ │ │ ├── index.css
│ │ │ │ │ ├── expected
│ │ │ │ │ │ └── main.css
│ │ │ │ │ └── rspack-expected
│ │ │ │ │ │ └── main.css
│ │ │ │ ├── hmr
│ │ │ │ │ ├── a.css
│ │ │ │ │ ├── index.css
│ │ │ │ │ ├── b.css
│ │ │ │ │ └── c.css
│ │ │ │ ├── at-import
│ │ │ │ │ ├── aa.css
│ │ │ │ │ ├── ab.css
│ │ │ │ │ ├── ac.css
│ │ │ │ │ ├── ad.css
│ │ │ │ │ ├── ae.css
│ │ │ │ │ ├── ba.css
│ │ │ │ │ ├── bb.css
│ │ │ │ │ ├── index.js
│ │ │ │ │ ├── b.css
│ │ │ │ │ └── a.css
│ │ │ │ ├── css-id-at-import
│ │ │ │ │ ├── db.css
│ │ │ │ │ ├── ca.css
│ │ │ │ │ ├── cb.css
│ │ │ │ │ ├── common.css
│ │ │ │ │ ├── aa.css
│ │ │ │ │ ├── ab.css
│ │ │ │ │ ├── ac.css
│ │ │ │ │ ├── ad.css
│ │ │ │ │ ├── ae.css
│ │ │ │ │ ├── ba.css
│ │ │ │ │ ├── base.css
│ │ │ │ │ ├── bb.css
│ │ │ │ │ ├── common-false.css
│ │ │ │ │ ├── da.css
│ │ │ │ │ ├── c.css
│ │ │ │ │ ├── d.css
│ │ │ │ │ └── b.css
│ │ │ │ ├── css-id-asset-modules
│ │ │ │ │ ├── index.js
│ │ │ │ │ ├── style.css
│ │ │ │ │ ├── expected
│ │ │ │ │ │ └── main.css
│ │ │ │ │ └── rspack-expected
│ │ │ │ │ │ └── main.css
│ │ │ │ └── at-import-in-the-entry
│ │ │ │ │ ├── a.css
│ │ │ │ │ ├── b.css
│ │ │ │ │ ├── expected
│ │ │ │ │ └── main.css
│ │ │ │ │ └── rspack-expected
│ │ │ │ │ └── main.css
│ │ │ ├── diagnostic
│ │ │ │ └── error
│ │ │ │ │ └── sass
│ │ │ │ │ ├── index.scss
│ │ │ │ │ └── index.js
│ │ │ ├── .gitignore
│ │ │ ├── fixtures
│ │ │ │ ├── esm
│ │ │ │ │ ├── module-concatenation
│ │ │ │ │ │ ├── a.css
│ │ │ │ │ │ ├── b.css
│ │ │ │ │ │ └── c.css
│ │ │ │ │ ├── css-id-module-concatenation
│ │ │ │ │ │ ├── a.css
│ │ │ │ │ │ ├── b.css
│ │ │ │ │ │ └── c.css
│ │ │ │ │ ├── module-concatenation-modules
│ │ │ │ │ │ ├── a.css
│ │ │ │ │ │ ├── b.css
│ │ │ │ │ │ └── c.css
│ │ │ │ │ └── css-id-module-concatenation-modules
│ │ │ │ │ │ ├── a.css
│ │ │ │ │ │ ├── b.css
│ │ │ │ │ │ └── c.css
│ │ │ │ ├── side-effects
│ │ │ │ │ ├── css-id-side-effects-common
│ │ │ │ │ │ ├── common1.css
│ │ │ │ │ │ ├── common2.css
│ │ │ │ │ │ └── style.css
│ │ │ │ │ └── css-id-side-effects
│ │ │ │ │ │ └── style.css
│ │ │ │ └── modules
│ │ │ │ │ ├── named-export
│ │ │ │ │ └── style.css
│ │ │ │ │ ├── css-id-named-export
│ │ │ │ │ └── style.css
│ │ │ │ │ ├── export-only-locals
│ │ │ │ │ └── style.css
│ │ │ │ │ ├── named-export-as-is
│ │ │ │ │ └── style.css
│ │ │ │ │ └── css-id-export-only-locals
│ │ │ │ │ └── style.css
│ │ │ └── hotCases
│ │ │ │ ├── hot-update-json
│ │ │ │ ├── chunk-splitting
│ │ │ │ │ └── test.config.cjs
│ │ │ │ └── nested
│ │ │ │ │ └── test.config.cjs
│ │ │ │ ├── css
│ │ │ │ ├── basic
│ │ │ │ │ └── __snapshot__
│ │ │ │ │ │ └── webpack
│ │ │ │ │ │ └── 0.snap.txt
│ │ │ │ └── scoped
│ │ │ │ │ └── __snapshot__
│ │ │ │ │ └── webpack
│ │ │ │ │ └── 0.snap.txt
│ │ │ │ └── modules
│ │ │ │ └── basic
│ │ │ │ └── __snapshot__
│ │ │ │ └── webpack
│ │ │ │ └── 0.snap.txt
│ │ ├── runtime
│ │ │ ├── hotModuleReplacement.lepus.d.cts
│ │ │ └── hotModuleReplacement.d.cts
│ │ ├── src
│ │ │ └── .gitignore
│ │ ├── README.md
│ │ └── api-extractor.json
│ ├── chunk-loading-webpack-plugin
│ │ ├── Notice.txt
│ │ ├── test
│ │ │ └── cases
│ │ │ │ ├── chunk-loading
│ │ │ │ ├── development
│ │ │ │ │ └── dynamic.js
│ │ │ │ ├── production
│ │ │ │ │ └── dynamic.js
│ │ │ │ └── runtime-globals
│ │ │ │ │ └── dynamic.js
│ │ │ │ └── css
│ │ │ │ └── development
│ │ │ │ └── dynamic.css
│ │ ├── README.md
│ │ └── api-extractor.json
│ ├── test-tools
│ │ └── README.md
│ ├── runtime-wrapper-webpack-plugin
│ │ ├── test
│ │ │ └── cases
│ │ │ │ ├── variables
│ │ │ │ ├── iife-false
│ │ │ │ │ └── fetch.js
│ │ │ │ ├── iife-true
│ │ │ │ │ └── fetch.js
│ │ │ │ ├── component
│ │ │ │ │ ├── rspack.config.js
│ │ │ │ │ └── index.js
│ │ │ │ ├── entry
│ │ │ │ │ ├── rspack.config.js
│ │ │ │ │ └── index.js
│ │ │ │ ├── default-entry
│ │ │ │ │ ├── rspack.config.js
│ │ │ │ │ └── index.js
│ │ │ │ ├── empty-entry
│ │ │ │ │ ├── rspack.config.js
│ │ │ │ │ └── index.js
│ │ │ │ └── inject-vars
│ │ │ │ │ └── rspack.config.js
│ │ │ │ └── runtime-globals
│ │ │ │ ├── lynx-chunk-entries
│ │ │ │ └── rspack.config.js
│ │ │ │ └── lynx-chunk-entries-production
│ │ │ │ └── rspack.config.js
│ │ ├── README.md
│ │ ├── api-extractor.json
│ │ └── tsconfig.json
│ ├── react-refresh-webpack-plugin
│ │ ├── README.md
│ │ ├── api-extractor.json
│ │ └── test
│ │ │ └── hotCases
│ │ │ └── jsx
│ │ │ ├── basic
│ │ │ └── __snapshot__
│ │ │ │ ├── rspack
│ │ │ │ └── 0.snap.txt
│ │ │ │ └── webpack
│ │ │ │ ├── 0.snap.txt
│ │ │ │ └── 1.snap.txt
│ │ │ ├── value
│ │ │ └── __snapshot__
│ │ │ │ ├── rspack
│ │ │ │ └── 0.snap.txt
│ │ │ │ └── webpack
│ │ │ │ ├── 0.snap.txt
│ │ │ │ └── 1.snap.txt
│ │ │ └── recovery
│ │ │ └── __snapshot__
│ │ │ └── rspack
│ │ │ └── 0.snap.txt
│ ├── webpack-runtime-globals
│ │ ├── api-extractor.json
│ │ └── tsconfig.json
│ └── webpack-dev-transport
│ │ └── api-extractor.json
├── tools
│ ├── canary-release
│ │ └── Notice.txt
│ └── css-serializer
│ │ ├── Notice.txt
│ │ ├── test
│ │ └── __preparation__
│ │ │ ├── aspect-ratio.css
│ │ │ ├── clip-path.css
│ │ │ ├── function.css
│ │ │ ├── slash-selector.css
│ │ │ ├── string-value.css
│ │ │ ├── css-variable-with-shorthand-properties.css
│ │ │ ├── import.css
│ │ │ ├── break-rule.css
│ │ │ ├── url-contain-identifier.css
│ │ │ └── no-space-within-name-value.css
│ │ ├── src
│ │ └── types
│ │ │ └── index.ts
│ │ └── vitest.config.ts
├── testing-library
│ └── examples
│ │ └── basic
│ │ ├── src
│ │ ├── rspeedy-env.d.ts
│ │ └── index.tsx
│ │ └── .gitignore
├── third-party
│ └── tailwind-preset
│ │ ├── src
│ │ └── __tests__
│ │ │ └── styles.css
│ │ └── tsconfig.json
└── background-only
│ ├── empty.js
│ └── index.d.ts
├── website
├── docs
│ ├── en
│ │ ├── about.md
│ │ └── guide
│ │ │ ├── glossary.md
│ │ │ ├── compatibility.md
│ │ │ ├── hmr.md
│ │ │ └── chunk-splitting.md
│ ├── zh
│ │ ├── about.md
│ │ └── guide
│ │ │ ├── glossary.md
│ │ │ ├── compatibility.md
│ │ │ ├── hmr.md
│ │ │ └── chunk-splitting.md
│ └── public
│ │ ├── rspeedy.png
│ │ ├── rspeedy-navbar-logo.png
│ │ └── rspeedy-navbar-logo-dark.png
├── api-documenter.json
├── .gitignore
└── theme
│ └── rsbuild-env.d.ts
├── .changeset
├── icy-dancers-help.md
├── floppy-shrimps-own.md
└── modern-bags-wait.md
├── .github
├── cla.json
├── codeql-config.yml
└── ISSUE_TEMPLATE
│ └── config.yml
├── clippy.toml
├── examples
├── react
│ ├── src
│ │ ├── rspeedy-env.d.ts
│ │ └── assets
│ │ │ ├── arrow.png
│ │ │ ├── lynx-logo.png
│ │ │ └── react-logo.png
│ └── vitest.config.ts
└── tailwindcss
│ ├── src
│ ├── rspeedy-env.d.ts
│ ├── utils.ts
│ └── index.tsx
│ └── vitest.config.ts
├── CODEOWNERS
├── NOTICE
├── .vscode
└── extensions.json
└── .gitattributes
/.nvmrc:
--------------------------------------------------------------------------------
1 | v24
2 |
--------------------------------------------------------------------------------
/rust-toolchain:
--------------------------------------------------------------------------------
1 | 1.86.0
2 |
--------------------------------------------------------------------------------
/.husky/pre-commit:
--------------------------------------------------------------------------------
1 | lint-staged
2 |
--------------------------------------------------------------------------------
/.rustfmt.toml:
--------------------------------------------------------------------------------
1 | tab_spaces = 2
2 |
--------------------------------------------------------------------------------
/packages/react/refresh/.gitignore:
--------------------------------------------------------------------------------
1 | /dist
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/bar.svg:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/baz.gif:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/foo.png:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/packages/web-platform/.gitignore:
--------------------------------------------------------------------------------
1 | binary
2 | pkg
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/README.md:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/website/docs/en/about.md:
--------------------------------------------------------------------------------
1 | # About Lynx Stack
2 |
--------------------------------------------------------------------------------
/website/docs/en/guide/glossary.md:
--------------------------------------------------------------------------------
1 | # Glossary
2 |
--------------------------------------------------------------------------------
/website/docs/zh/about.md:
--------------------------------------------------------------------------------
1 | # 关于 lynx-stack
2 |
--------------------------------------------------------------------------------
/website/docs/zh/guide/glossary.md:
--------------------------------------------------------------------------------
1 | # Glossary
2 |
--------------------------------------------------------------------------------
/.changeset/icy-dancers-help.md:
--------------------------------------------------------------------------------
1 | ---
2 |
3 | ---
4 |
--------------------------------------------------------------------------------
/.github/cla.json:
--------------------------------------------------------------------------------
1 | { "signedContributors": [] }
2 |
--------------------------------------------------------------------------------
/clippy.toml:
--------------------------------------------------------------------------------
1 | too-many-arguments-threshold = 10
2 |
--------------------------------------------------------------------------------
/packages/react/runtime/lazy/import.d.ts:
--------------------------------------------------------------------------------
1 | export {};
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/simple.module.css:
--------------------------------------------------------------------------------
1 |
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/simple.module.less:
--------------------------------------------------------------------------------
1 |
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/client/simple.module.scss:
--------------------------------------------------------------------------------
1 |
2 |
--------------------------------------------------------------------------------
/website/docs/en/guide/compatibility.md:
--------------------------------------------------------------------------------
1 | # Compatibility
2 |
--------------------------------------------------------------------------------
/website/docs/en/guide/hmr.md:
--------------------------------------------------------------------------------
1 | # Hot Module Replacement
2 |
--------------------------------------------------------------------------------
/website/docs/zh/guide/compatibility.md:
--------------------------------------------------------------------------------
1 | # Compatibility
2 |
--------------------------------------------------------------------------------
/website/docs/zh/guide/hmr.md:
--------------------------------------------------------------------------------
1 | # Hot Module Replacement
2 |
--------------------------------------------------------------------------------
/packages/react/refresh/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !dist/*
3 | !src/*
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/.gitignore:
--------------------------------------------------------------------------------
1 | /rspeedy-project
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/text.txt:
--------------------------------------------------------------------------------
1 | this is text
--------------------------------------------------------------------------------
/website/docs/en/guide/chunk-splitting.md:
--------------------------------------------------------------------------------
1 | # Chunk Splitting
2 |
--------------------------------------------------------------------------------
/website/docs/zh/guide/chunk-splitting.md:
--------------------------------------------------------------------------------
1 | # Chunk Splitting
2 |
--------------------------------------------------------------------------------
/packages/react/runtime/.gitignore:
--------------------------------------------------------------------------------
1 | coverage/
2 | lib/
3 | !debug
4 |
--------------------------------------------------------------------------------
/packages/react/components/.gitignore:
--------------------------------------------------------------------------------
1 | coverage/
2 | dist/
3 | lib/
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/environment/lynx.config.js:
--------------------------------------------------------------------------------
1 |
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/project-with-env/lynx.config.js:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/error/invalid.js:
--------------------------------------------------------------------------------
1 | import {}
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/error/throw.js:
--------------------------------------------------------------------------------
1 | throw 1
2 |
--------------------------------------------------------------------------------
/packages/react/transform/cjs/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "type": "commonjs"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/worklet-runtime/.gitignore:
--------------------------------------------------------------------------------
1 | coverage/
2 | dist/
3 | lib/
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/project-with-env/.env:
--------------------------------------------------------------------------------
1 | PUBLIC_FOO=BAR
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start/.gitignore:
--------------------------------------------------------------------------------
1 | !node_modules
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/.gitignore:
--------------------------------------------------------------------------------
1 | !node_modules
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/default/package.json:
--------------------------------------------------------------------------------
1 | {}
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-worker-rpc/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/web-worker-rpc
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-worker-runtime/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/worker-rpc
2 |
--------------------------------------------------------------------------------
/packages/react/transform/.cargo/config.toml:
--------------------------------------------------------------------------------
1 | [net]
2 | git-fetch-with-cli = true
3 |
--------------------------------------------------------------------------------
/packages/react/worklet-runtime/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !dist/*
3 | !lib/**
4 | !lib/*
5 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/project-with-env/.env.test:
--------------------------------------------------------------------------------
1 | PUBLIC_TEST=TEST
--------------------------------------------------------------------------------
/packages/web-platform/web-core-server/.gitignore:
--------------------------------------------------------------------------------
1 | build
2 | Makefile
3 | CMakeFiles
--------------------------------------------------------------------------------
/packages/react/components/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !dist/*
3 | !lib/**
4 | !lib/*
5 | !src/*
6 |
--------------------------------------------------------------------------------
/packages/react/testing-library/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !dist/*
3 | !dist/env/*
4 | !types/*
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/.gitignore:
--------------------------------------------------------------------------------
1 | src/loader.js
2 | src/loader.js.map
3 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/public-path/asset.json:
--------------------------------------------------------------------------------
1 | {}
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-emit-lepus/index.js:
--------------------------------------------------------------------------------
1 |
--------------------------------------------------------------------------------
/examples/react/src/rspeedy-env.d.ts:
--------------------------------------------------------------------------------
1 | ///
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-qrcode/test/fixtures/error/index.js:
--------------------------------------------------------------------------------
1 | console.log('Hello, world!')
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XSvg/index.ts:
--------------------------------------------------------------------------------
1 | export { XSvg } from './XSvg.js';
2 |
--------------------------------------------------------------------------------
/examples/tailwindcss/src/rspeedy-env.d.ts:
--------------------------------------------------------------------------------
1 | ///
2 |
--------------------------------------------------------------------------------
/packages/react/testing-library/src/__tests__/css/style1.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/invalid-config/resolve-error.ts:
--------------------------------------------------------------------------------
1 | import 'non-exist-pkg'
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/onCloseBuild/src/index.js:
--------------------------------------------------------------------------------
1 | console.info('onCloseBuild')
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "type": "commonjs"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/plugins/fixtures/hello-world/index.js:
--------------------------------------------------------------------------------
1 | console.info('Hello, world')
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-qrcode/test/fixtures/hello-world/index.js:
--------------------------------------------------------------------------------
1 | console.info('Hello, world')
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/special-var-name/Card/Card.js:
--------------------------------------------------------------------------------
1 | export default 42
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": "../tsconfig.json",
3 | }
4 |
--------------------------------------------------------------------------------
/packages/tools/canary-release/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/tools/css-serializer/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XInput/index.ts:
--------------------------------------------------------------------------------
1 | export { XInput } from './XInput.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/standard.js:
--------------------------------------------------------------------------------
1 | export * from './dist/standard.js';
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/index.js:
--------------------------------------------------------------------------------
1 | import './main.css';
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/diagnostic/error/sass/index.scss:
--------------------------------------------------------------------------------
1 | ..foo {}
2 |
--------------------------------------------------------------------------------
/packages/react/testing-library/src/__tests__/css/style3.module.css:
--------------------------------------------------------------------------------
1 | .baz {
2 | color: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/testing-library/types/pure.d.ts:
--------------------------------------------------------------------------------
1 | // @ts-nocheck
2 | export * from './index.d.ts';
3 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/order/lynx.config.js:
--------------------------------------------------------------------------------
1 | throw new Error('unreachable!')
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-core/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XAudioTT/index.ts:
--------------------------------------------------------------------------------
1 | export { XAudioTT } from './XAudioTT.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XCanvas/index.ts:
--------------------------------------------------------------------------------
1 | export { XCanvas } from './XCanvas.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/runtime/hotModuleReplacement.lepus.d.cts:
--------------------------------------------------------------------------------
1 | export {};
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/asset-modules/index.js:
--------------------------------------------------------------------------------
1 | import './style.css';
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/all-in-one/a.js:
--------------------------------------------------------------------------------
1 | console.info('**aaa**');
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/page-config/a.js:
--------------------------------------------------------------------------------
1 | console.info('**aaa**');
2 |
--------------------------------------------------------------------------------
/website/api-documenter.json:
--------------------------------------------------------------------------------
1 | {
2 | "newlineKind": "lf",
3 | "outputTarget": "markdown"
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/testing-library/src/__tests__/css/style2.css:
--------------------------------------------------------------------------------
1 | .bar {
2 | background-color: yellow;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/transform/src/swc_plugin_shake/README.md:
--------------------------------------------------------------------------------
1 | # swc plugin lepus shake
2 |
3 | ```
4 | ```
5 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/invalid-config/resolve-error-2.ts:
--------------------------------------------------------------------------------
1 | import './non-exist-module.js'
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-constants/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/ScrollView/index.ts:
--------------------------------------------------------------------------------
1 | export { ScrollView } from './ScrollView.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XAudioTT/x-audio-tt.css:
--------------------------------------------------------------------------------
1 | x-audio-tt {
2 | display: none;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XOverlayNg/index.ts:
--------------------------------------------------------------------------------
1 | export { XOverlayNg } from './XOverlayNg.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XTextarea/index.ts:
--------------------------------------------------------------------------------
1 | export { XTextarea } from './XTextarea.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/src/transformer/mod.rs:
--------------------------------------------------------------------------------
1 | mod rules;
2 | pub mod transform;
3 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-flex-1/index.css:
--------------------------------------------------------------------------------
1 | view {
2 | display: flex;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-worker-rpc/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/index.js:
--------------------------------------------------------------------------------
1 | import './main.css';
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr-locals/index.css:
--------------------------------------------------------------------------------
1 | .x {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr/a.css:
--------------------------------------------------------------------------------
1 | body {
2 | background: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/diagnostic/error/sass/index.js:
--------------------------------------------------------------------------------
1 | import './index.scss'
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/default-export/a.js:
--------------------------------------------------------------------------------
1 | console.info('**aaa**');
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/element-template/a.js:
--------------------------------------------------------------------------------
1 | console.info('**aaa**');
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/fixtures/basic.tsx:
--------------------------------------------------------------------------------
1 | console.info('Hello, Lynx x Webpack');
2 |
--------------------------------------------------------------------------------
/packages/react/testing-library/src/entry.ts:
--------------------------------------------------------------------------------
1 | // @ts-ignore
2 | export type * from '../../../types/entry.d.ts';
3 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/register/foo.ts:
--------------------------------------------------------------------------------
1 | export function foo(): number {
2 | return 42
3 | }
4 |
--------------------------------------------------------------------------------
/packages/web-platform/offscreen-document/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements-compat/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements-reactive/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements-template/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/LynxWrapper/index.ts:
--------------------------------------------------------------------------------
1 | export { LynxWrapper } from './LynxWrapper.js';
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-mainthread-apis/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-mainthread-apis/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/web-mainthread-apis
2 |
3 | main-thread apis
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-rsbuild-plugin/tests/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": "../tsconfig.json",
3 | }
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/web-platform/web-worker-runtime/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/.gitignore:
--------------------------------------------------------------------------------
1 | # Output of test cases
2 | /js
3 | /rspack-js
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/aa.css:
--------------------------------------------------------------------------------
1 | .aa {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/ab.css:
--------------------------------------------------------------------------------
1 | .ab {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/ac.css:
--------------------------------------------------------------------------------
1 | .ac {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/ad.css:
--------------------------------------------------------------------------------
1 | .ad {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/ae.css:
--------------------------------------------------------------------------------
1 | .ae {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/ba.css:
--------------------------------------------------------------------------------
1 | .ba {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/bb.css:
--------------------------------------------------------------------------------
1 | .bb {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/db.css:
--------------------------------------------------------------------------------
1 | .db {
2 | width: 42px;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/css/modules/index.module.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/context/a.json:
--------------------------------------------------------------------------------
1 | {
2 | "name": "a"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/context/b.json:
--------------------------------------------------------------------------------
1 | {
2 | "name": "b"
3 | }
4 |
--------------------------------------------------------------------------------
/CODEOWNERS:
--------------------------------------------------------------------------------
1 | packages/web-platform/** @pupiltong
2 | packages/webpack/** @colinaaa
3 | packages/rspeedy/** @colinaaa
4 |
--------------------------------------------------------------------------------
/packages/react/refresh/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": "../../../tsconfig.json",
3 | "include": ["src"],
4 | }
5 |
--------------------------------------------------------------------------------
/packages/testing-library/examples/basic/src/rspeedy-env.d.ts:
--------------------------------------------------------------------------------
1 | ///
2 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/aspect-ratio.css:
--------------------------------------------------------------------------------
1 | .test {
2 | aspect-ratio: 275/180;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/Notice.txt:
--------------------------------------------------------------------------------
1 | Copyright 2023-2024 The Lynx Authors. All rights reserved.
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/index.js:
--------------------------------------------------------------------------------
1 | import './a.css';
2 | import './b.css';
3 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ca.css:
--------------------------------------------------------------------------------
1 | .ca {
2 | display: flex;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/cb.css:
--------------------------------------------------------------------------------
1 | .cb {
2 | display: flex;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/common.css:
--------------------------------------------------------------------------------
1 | .bg {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr/index.css:
--------------------------------------------------------------------------------
1 | @import "./c.css";
2 | @import "./b.css";
3 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/context/locales/bar.json:
--------------------------------------------------------------------------------
1 | {
2 | "bar": "42"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/context/locales/baz.json:
--------------------------------------------------------------------------------
1 | {
2 | "baz": "42"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/context/locales/foo.json:
--------------------------------------------------------------------------------
1 | {
2 | "foo": "42"
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/module-build-failed/errors/index.jsx:
--------------------------------------------------------------------------------
1 | import "./invalid.js";
2 |
--------------------------------------------------------------------------------
/packages/react/transform/cjs/main.d.cts:
--------------------------------------------------------------------------------
1 | import type * as Transform from '../index.d.ts';
2 |
3 | export = Transform;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_rename_view.js:
--------------------------------------------------------------------------------
1 | const a = ;
2 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/test/cases/chunk-loading/development/dynamic.js:
--------------------------------------------------------------------------------
1 | export const value = 1;
2 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/test/cases/chunk-loading/production/dynamic.js:
--------------------------------------------------------------------------------
1 | export const value = 1;
2 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/test/cases/css/development/dynamic.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-asset-modules/index.js:
--------------------------------------------------------------------------------
1 | import './style.css?cssId=1000';
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/aa.css:
--------------------------------------------------------------------------------
1 | .aa {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ab.css:
--------------------------------------------------------------------------------
1 | .ab {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ac.css:
--------------------------------------------------------------------------------
1 | .ac {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ad.css:
--------------------------------------------------------------------------------
1 | .ad {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ae.css:
--------------------------------------------------------------------------------
1 | .ae {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/ba.css:
--------------------------------------------------------------------------------
1 | .ba {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/base.css:
--------------------------------------------------------------------------------
1 | .container {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/bb.css:
--------------------------------------------------------------------------------
1 | .bb {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/common-false.css:
--------------------------------------------------------------------------------
1 | .bg {
2 | color: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/NOTICE:
--------------------------------------------------------------------------------
1 | Lynx Project
2 | Copyright (c) 2018-2024 ByteDance Inc.
3 | Copyright (c) 2024 TikTok Inc.
4 | All rights reserved.
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_snapshot/mod.rs/empty_module.js:
--------------------------------------------------------------------------------
1 | console.log('hello, world');
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/default/lynx.config.ts:
--------------------------------------------------------------------------------
1 | export default {
2 | source: { entry: 'default' },
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/order/lynx.config.ts:
--------------------------------------------------------------------------------
1 | export default {
2 | source: { entry: 'order' },
3 | }
4 |
--------------------------------------------------------------------------------
/packages/testing-library/examples/basic/.gitignore:
--------------------------------------------------------------------------------
1 | /dist
2 | /node_modules
3 |
4 | *.log
5 | log
6 | output
7 | .DS_Store
8 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/test/cases/chunk-loading/runtime-globals/dynamic.js:
--------------------------------------------------------------------------------
1 | export const value = 1;
2 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/expected/index.mjs:
--------------------------------------------------------------------------------
1 | var __webpack_exports__ = {};
2 |
3 |
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation/a.css:
--------------------------------------------------------------------------------
1 | .a {
2 | background: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation/b.css:
--------------------------------------------------------------------------------
1 | .b {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation/c.css:
--------------------------------------------------------------------------------
1 | .c {
2 | background: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/basic/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/css/modules-remove-scope/index.module.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/css/modules-without-jsx/index.module.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/bundle-splitting/async-chunk/dynamic.js:
--------------------------------------------------------------------------------
1 | console.info('***dynamic***');
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/bundle-splitting/async-chunk/dynamic2.js:
--------------------------------------------------------------------------------
1 | console.info('***dynamic2***');
2 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/bundle-splitting/async-chunk/dynamic3.js:
--------------------------------------------------------------------------------
1 | console.info('***dynamic3***');
2 |
--------------------------------------------------------------------------------
/website/docs/public/rspeedy.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/website/docs/public/rspeedy.png
--------------------------------------------------------------------------------
/.vscode/extensions.json:
--------------------------------------------------------------------------------
1 | {
2 | "recommendations": [
3 | "dprint.dprint",
4 | "editorconfig.editorconfig",
5 | ],
6 | }
7 |
--------------------------------------------------------------------------------
/examples/react/src/assets/arrow.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/examples/react/src/assets/arrow.png
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/register.js:
--------------------------------------------------------------------------------
1 | import { register } from '../../../register/index.js'
2 |
3 | register()
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/custom.config.js:
--------------------------------------------------------------------------------
1 | export default {
2 | source: { entry: 'custom-esm' },
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/defineDCE/basic.js:
--------------------------------------------------------------------------------
1 | if (__SOME_MACRO__) {
2 | void import('./non-exist.js')
3 | }
4 |
--------------------------------------------------------------------------------
/packages/third-party/tailwind-preset/src/__tests__/styles.css:
--------------------------------------------------------------------------------
1 | @tailwind base;
2 | @tailwind components;
3 | @tailwind utilities;
4 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/src/types/index.ts:
--------------------------------------------------------------------------------
1 | export type * from './Plugin.js';
2 | export type * from './LynxStyleNode.js';
3 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import-in-the-entry/a.css:
--------------------------------------------------------------------------------
1 | body {
2 | font-family: "Manrope";
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/rspack-expected/index.mjs:
--------------------------------------------------------------------------------
1 | var __webpack_exports__ = {};
2 |
3 |
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation/a.css:
--------------------------------------------------------------------------------
1 | .a {
2 | background: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/eval-result/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/production/async/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/external/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/template-react-vitest-rltl-ts/src/rspeedy-env.d.ts:
--------------------------------------------------------------------------------
1 | ///
2 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/clip-path.css:
--------------------------------------------------------------------------------
1 | .foo {
2 | clip-path: inset(0px super-ellipse 3.5 3.5 20px);
3 | }
4 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/function.css:
--------------------------------------------------------------------------------
1 | .backtop {
2 | transform: translate3d(42px, -62px, -135px);
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/expected/index.mjs:
--------------------------------------------------------------------------------
1 | var __webpack_exports__ = {};
2 |
3 |
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation/b.css:
--------------------------------------------------------------------------------
1 | .b {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation/c.css:
--------------------------------------------------------------------------------
1 | .c {
2 | background: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation-modules/a.css:
--------------------------------------------------------------------------------
1 | .a {
2 | background: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation-modules/b.css:
--------------------------------------------------------------------------------
1 | .b {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/module-concatenation-modules/c.css:
--------------------------------------------------------------------------------
1 | .c {
2 | background: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 'baz';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/load-lazy-bundle/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/recursive/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return '**baz**';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/main-thread/code-splitting/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 'baz';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/production/shared/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/production/shared/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/async-chunk/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-fn/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 52;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-fn/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-object/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 52;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-object/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-regex/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 52;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-regex/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/examples/react/src/assets/lynx-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/examples/react/src/assets/lynx-logo.png
--------------------------------------------------------------------------------
/examples/react/src/assets/react-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/examples/react/src/assets/react-logo.png
--------------------------------------------------------------------------------
/packages/react/testing-library/src/env/vitest.ts:
--------------------------------------------------------------------------------
1 | import env from '@lynx-js/testing-environment/env/vitest';
2 |
3 | export default env;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_left_no_remove_component_element_attr.js:
--------------------------------------------------------------------------------
1 | ;
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start-no-dependencies/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "dependencies": {},
3 | "devDependencies": {}
4 | }
5 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/lynx.config.mts:
--------------------------------------------------------------------------------
1 | export default {
2 | source: {
3 | entry: 'cjs-mts',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/custom.cts:
--------------------------------------------------------------------------------
1 | module.exports = {
2 | source: {
3 | entry: 'custom-cts',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/custom.mts:
--------------------------------------------------------------------------------
1 | export default {
2 | source: {
3 | entry: 'custom-mts',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/special-var-name/ReactLynx/index.js:
--------------------------------------------------------------------------------
1 | export default function ReactLynx() {
2 | return 42
3 | }
4 |
--------------------------------------------------------------------------------
/packages/web-platform/inline-style-parser/Cargo.toml:
--------------------------------------------------------------------------------
1 | [package]
2 | name = "inline-style-parser"
3 | version = "0.0.0"
4 | edition = "2021"
5 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XList/index.ts:
--------------------------------------------------------------------------------
1 | export { ListItem } from './ListItem.js';
2 | export { XList } from './XList.js';
3 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XView/index.ts:
--------------------------------------------------------------------------------
1 | export { XView } from './XView.js';
2 | export { XBlurView } from './XBlurView.js';
3 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/web-style-transformer
2 |
3 | style transformer for flex、linear layout.
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/legacy.js:
--------------------------------------------------------------------------------
1 | export * from './dist/legacy.js';
2 | export { memory } from './dist/legacy_bg.wasm';
3 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/rspack-expected/index.mjs:
--------------------------------------------------------------------------------
1 | var __webpack_exports__ = {};
2 |
3 |
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr-locals/expected/main.css:
--------------------------------------------------------------------------------
1 | .VoofDB21D_QzDbRdwMiY {
2 | color: red;
3 | }
4 |
5 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr-locals/rspack-expected/main.css:
--------------------------------------------------------------------------------
1 | .uKUN7__BVSobrm9K {
2 | color: red;
3 | }
4 |
5 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation-modules/a.css:
--------------------------------------------------------------------------------
1 | .a {
2 | background: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation-modules/b.css:
--------------------------------------------------------------------------------
1 | .b {
2 | background: green;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/esm/css-id-module-concatenation-modules/c.css:
--------------------------------------------------------------------------------
1 | .c {
2 | background: blue;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/async-chunk-name/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 'baz';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/chunk-filename/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return '**baz**';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/with-static/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return '**baz**';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/namespace-name/index.jsx:
--------------------------------------------------------------------------------
1 | function App() {
2 | return
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/webpack-chunk-name/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/webpack-chunk-name/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-partial/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return 52;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-partial/foo.js:
--------------------------------------------------------------------------------
1 | export function foo() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/test-tools/README.md:
--------------------------------------------------------------------------------
1 | @lynx-js/test-tools
2 |
3 | The test runner for webpack & rspack plugins.
4 |
--------------------------------------------------------------------------------
/packages/react/transform/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !index.d.ts
3 | !main.js
4 | !main.cjs
5 | !cjs/*
6 | !dist/wasm.js
7 | !dist/wasm.cjs
8 | dist/*.node
9 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_not_handle_jsx_member_expression.js:
--------------------------------------------------------------------------------
1 | const a = ;
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_replace_to_lit.js:
--------------------------------------------------------------------------------
1 | let a = (true, false);
2 | let b = 3;
3 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/default/config.mjs:
--------------------------------------------------------------------------------
1 | export default {
2 | source: {
3 | entry: 'package-mjs',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/lynx.config.js:
--------------------------------------------------------------------------------
1 | module.exports = {
2 | source: {
3 | entry: 'cjs-default',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/postcss/postcss.config.js:
--------------------------------------------------------------------------------
1 | export default {
2 | plugins: {
3 | tailwindcss: {},
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/websocket/README.md:
--------------------------------------------------------------------------------
1 | The implementation of [WebSocket](https://developer.mozilla.org/en-US/docs/Web/API/WebSocket) for Lynx.
2 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements-reactive/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/web-elements-reactive
2 |
3 | Some built-in functions related to web-elements.
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XImage/index.ts:
--------------------------------------------------------------------------------
1 | export { FilterImage } from './FilterImage.js';
2 | export { XImage } from './XImage.js';
3 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/da.css:
--------------------------------------------------------------------------------
1 | @import "./db.css";
2 |
3 | .da {
4 | height: 100px;
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/side-effects/css-id-side-effects-common/common1.css:
--------------------------------------------------------------------------------
1 | .common1 {
2 | color: red;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/background-only/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return '**baz**';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/component/index.jsx:
--------------------------------------------------------------------------------
1 | function App() {
2 | return
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/main-thread/error/index.jsx:
--------------------------------------------------------------------------------
1 | if (__LEPUS__) {
2 | import('./non-exist-file.js')
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/runtime-module/async-chunk/dynamic.js:
--------------------------------------------------------------------------------
1 | export function dynamic() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/runtime-module/async-chunks/dynamic.js:
--------------------------------------------------------------------------------
1 | export function dynamic() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/runtime-module/async-chunks/dynamic2.js:
--------------------------------------------------------------------------------
1 | export function dynamic2() {
2 | return 42;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/runtime/.prettierrc:
--------------------------------------------------------------------------------
1 | {
2 | "printWidth": 130,
3 | "tabWidth": 2,
4 | "bracketSpacing": true,
5 | "arrowParens": "avoid"
6 | }
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_transform_event_props_1.js:
--------------------------------------------------------------------------------
1 | const a = ;
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_transform_event_props_2.js:
--------------------------------------------------------------------------------
1 | const a = ;
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/build-cache/lynx.config.js:
--------------------------------------------------------------------------------
1 | export default {
2 | performance: {
3 | buildCache: true,
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/default/config.js:
--------------------------------------------------------------------------------
1 | // We explicitly create an error
2 | module.exports = {
3 | default: {},
4 | }
5 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/export-default.ts:
--------------------------------------------------------------------------------
1 | export default {
2 | source: {
3 | entry: 'cjs-export-default',
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XSwiper/index.ts:
--------------------------------------------------------------------------------
1 | export { SwiperItem } from './SwiperItem.js';
2 | export { XSwiper } from './XSwiper.js';
3 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/side-effects/css-id-side-effects-common/common2.css:
--------------------------------------------------------------------------------
1 | .common2 {
2 | color: aqua;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-with-source-map/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 'baz';
3 | }
4 |
--------------------------------------------------------------------------------
/website/docs/public/rspeedy-navbar-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/website/docs/public/rspeedy-navbar-logo.png
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_be_able_to_define_object.js:
--------------------------------------------------------------------------------
1 | {
2 | console.log("a");
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_fn_decl.js:
--------------------------------------------------------------------------------
1 | export default function useExposure() {}
2 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/module-build-failed/errors/invalid.js:
--------------------------------------------------------------------------------
1 | /* eslint-disable */
2 | This is an invalid JavaScript file
3 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/iife-false/fetch.js:
--------------------------------------------------------------------------------
1 | export const fetch = function fetch() {
2 | return 42;
3 | };
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/iife-true/fetch.js:
--------------------------------------------------------------------------------
1 | export const fetch = function fetch() {
2 | return 42;
3 | };
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/duplicated-async-chunk/shared/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | return 'baz';
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_not_crash_when_eval_failed.js:
--------------------------------------------------------------------------------
1 | if (A) {
2 | console.log("a");
3 | }
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_fn_body_in_component_props.js:
--------------------------------------------------------------------------------
1 | {}}/>;
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/class_in_worklet_1.js:
--------------------------------------------------------------------------------
1 | let onTapLepus = {
2 | _wkltId: "a123:test:1"
3 | };
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/special-var-name/Component.js:
--------------------------------------------------------------------------------
1 | const Component = () => {
2 | return 42
3 | }
4 |
5 | export default Component
6 |
--------------------------------------------------------------------------------
/packages/web-platform/offscreen-document/README.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/offscreen-document
2 |
3 | Offscreen Document allows developers to use partial DOM in WebWorker
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/asset-modules/style.css:
--------------------------------------------------------------------------------
1 | body {
2 | background: red;
3 | background-image: url(./react.svg);
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/lynx-key/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/utf-8/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/component/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/mode-none/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/after-emit/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/main-thread/mpa/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/website/docs/public/rspeedy-navbar-logo-dark.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/website/docs/public/rspeedy-navbar-logo-dark.png
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_keep_only_true_branch.js:
--------------------------------------------------------------------------------
1 | {
2 | console.log("LEPUS");
3 | }let a = 1;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_replace_to_lit_recur.js:
--------------------------------------------------------------------------------
1 | let a = (true, false);
2 | let b = false + true;
3 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_native_modules_in_default_params.js:
--------------------------------------------------------------------------------
1 | const keepMe = ()=>{};
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_inject/mod.rs/should_inject_callee.js:
--------------------------------------------------------------------------------
1 | (__globalProps.xxx ?? __globalProps.yyy ?? 'zzz').toString();
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_list/mod.rs/should_transform_list_item_not_deferred.js:
--------------------------------------------------------------------------------
1 | ;
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start-invalid-package-json/package.json:
--------------------------------------------------------------------------------
1 | {
2 | // This is a invalid package.json
3 | "name": "invalid-package-json"
4 | }
5 |
--------------------------------------------------------------------------------
/packages/testing-library/examples/basic/src/index.tsx:
--------------------------------------------------------------------------------
1 | import { App } from './App.jsx';
2 | import { root } from '@lynx-js/react';
3 |
4 | root.render();
5 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/slash-selector.css:
--------------------------------------------------------------------------------
1 | .text-\[red\] {
2 | color: red;
3 | }
4 |
5 | .color-\[\#fff\] {
6 | color: #fff;
7 | }
8 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/string-value.css:
--------------------------------------------------------------------------------
1 | .test-1 {
2 | content: "test\"s 1";
3 | }
4 |
5 | .test-2 {
6 | content: 'test\'s 2';
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/b.css:
--------------------------------------------------------------------------------
1 | @import "./ba.css";
2 | @import "./bb.css";
3 |
4 | body {
5 | background: yellow;
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-asset-modules/style.css:
--------------------------------------------------------------------------------
1 | body {
2 | background: red;
3 | background-image: url(./react.svg);
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/c.css:
--------------------------------------------------------------------------------
1 | @import "./ca.css";
2 | @import "./cb.css";
3 |
4 | .c {
5 | display: grid;
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/export-default-abstract/abstract.ts:
--------------------------------------------------------------------------------
1 | export default abstract class Foo {
2 | abstract foo(): void;
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/typescript/type-import/bar.ts:
--------------------------------------------------------------------------------
1 | export type Bar = string;
2 |
3 | console.info('This should exist in the output');
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/get-node-ref/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/react-runtime/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/namespace-name/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/main-thread/error/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/debug-info/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/filename-flat/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/filename-hash/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/lazy-bundle/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/source-map/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-emit/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-encode/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_list/mod.rs/should_not_transform_list_item_with_defer_false.js:
--------------------------------------------------------------------------------
1 | ;
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "name": "local-rspeedy-test",
3 | "dependencies": {
4 | "@lynx-js/rspeedy": "*"
5 | }
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-72x72.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-72x72.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-96x96.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-96x96.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/shell-project/fp-only.ts:
--------------------------------------------------------------------------------
1 | import '@lynx-js/web-elements/index.css';
2 | import '@lynx-js/web-core/index.css';
3 | import './index.css';
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/README.md:
--------------------------------------------------------------------------------
1 | @lynx-js/react-refresh-webpack-plugin
2 |
3 | A webpack plugin to hot refresh for Lynx
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/swc-syntax-config/c-style-cast.ts:
--------------------------------------------------------------------------------
1 | const a = <() => void> function() {
2 | /* noop */
3 | };
4 | export { a };
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/stop-propagation/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/this-selector-query/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/_unknown-css-property/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/module-build-failed/errors/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js'
2 |
3 | export default config
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/component/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/entry/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/debug-info-filename/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/filename-hash-8/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/bundle-splitting/async-chunk/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-emit-filename/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-emit-lepus/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/runtime-module/async-chunk/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_change_runtime_pkg.js:
--------------------------------------------------------------------------------
1 | import { Component } from "@lynx-js/react/legacy-react-runtime";
2 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_keep_only_true_branch_if_else_if.js:
--------------------------------------------------------------------------------
1 | {
2 | console.log("LEPUS");
3 | }let a = 2;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_extract_member_expr_4_js.js:
--------------------------------------------------------------------------------
1 | let enableScroll = {
2 | _wkltId: "a123:test:1"
3 | };
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start/node_modules/@lynx-js/rspeedy/lib/cli/main.js:
--------------------------------------------------------------------------------
1 | export function main() {
2 | console.debug('local main()')
3 | return 42
4 | }
5 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/node_modules/esm-pkg/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "type": "module",
3 | "exports": {
4 | "import": "./index.js"
5 | }
6 | }
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/background-only/backgroundCall.tsx:
--------------------------------------------------------------------------------
1 | import 'background-only'
2 |
3 | export const backgroundCall = () => {
4 | return 1
5 | }
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XViewpagerNg/index.ts:
--------------------------------------------------------------------------------
1 | export { XViewpagerNg } from './XViewpagerNg.js';
2 | export { XViewpagerItemNg } from './XViewpagerItemNg.js';
3 |
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-128x128.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-128x128.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-144x144.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-144x144.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-152x152.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-152x152.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-192x192.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-192x192.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-384x384.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-384x384.png
--------------------------------------------------------------------------------
/packages/web-platform/web-explorer/icons/icon-512x512.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-explorer/icons/icon-512x512.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/lynx-logo.jpeg:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/lynx-logo.jpeg
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import-in-the-entry/b.css:
--------------------------------------------------------------------------------
1 | @import url(https://fonts.googleapis.com/css2?family=Manrope:wght@500;800&display=swap);
2 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/async-chunk-groups/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | return await Promise.resolve('**foo**');
3 | }
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/extract-str/index.jsx:
--------------------------------------------------------------------------------
1 | it('__EXTRACT_STR__ should be false', () => {
2 | expect(__EXTRACT_STR__).toBe(false);
3 | });
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/enum/basic/e.ts:
--------------------------------------------------------------------------------
1 | export const enum ConstEnum {
2 | Foo = 'Foo',
3 | }
4 |
5 | export enum Enum {
6 | Bar = 'Bar',
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/component/index.js:
--------------------------------------------------------------------------------
1 | ///
2 |
3 | expect(Component).toBe(undefined);
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/default-entry/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/empty-entry/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/inject-vars/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/hooks/before-emit-filename-hash/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/runtime-module/async-chunks/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_keep_only_true_branch_with_unary_operator.js:
--------------------------------------------------------------------------------
1 | {
2 | console.log("JS");
3 | }let a = 2;
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_do_nothing_when_arrow_function_return_directive.js:
--------------------------------------------------------------------------------
1 | const keepMe = ()=>'use js only';
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/node_modules/esm-pkg/index.js:
--------------------------------------------------------------------------------
1 | export const pluginFoo = () => {
2 | return {
3 | name: 'foo',
4 | setup() {},
5 | }
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/chromium-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/chromium-logo.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/firefox-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/firefox-logo.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/inline-image.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/inline-image.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/d.css:
--------------------------------------------------------------------------------
1 | @import "./common.css?common";
2 | @import "./da.css";
3 |
4 | .d {
5 | line-height: 24px;
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/disable-create-selector-query/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/debug-info-public-path-auto/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/examples/react/vitest.config.ts:
--------------------------------------------------------------------------------
1 | import { defineProject } from 'vitest/config';
2 |
3 | export default defineProject({
4 | test: {
5 | name: 'examples/react',
6 | },
7 | });
8 |
--------------------------------------------------------------------------------
/packages/react/runtime/CHANGELOG.md:
--------------------------------------------------------------------------------
1 | # @lynx-js/react-runtime
2 |
3 | ## 0.100.1
4 |
5 | ### Patch Changes
6 |
7 | - fd26881: export `snapshotManager` in `@lynx-js/react/internal`
8 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_not_rename_view_redeclaration.js:
--------------------------------------------------------------------------------
1 | {
2 | const View2 = View;
3 | const a = ;
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_not_remove_test_with_other_runtime.js:
--------------------------------------------------------------------------------
1 | export class A extends Component {
2 | test() {}
3 | }
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/watch-files/object.js:
--------------------------------------------------------------------------------
1 | export default {
2 | dev: {
3 | watchFiles: { paths: ['bar.js', 'baz.js'], type: 'reload-server' },
4 | },
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/custom.config.cjs:
--------------------------------------------------------------------------------
1 | // eslint-disable-next-line import/no-commonjs
2 | module.exports = {
3 | source: { entry: 'custom-cjs' },
4 | }
5 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/css-variable-with-shorthand-properties.css:
--------------------------------------------------------------------------------
1 | .text {
2 | border-bottom: 0.5px var(--css-var, solid) var(--border-color, #FFE4D0);
3 | }
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/disable-create-selector-query-false/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/runtime-globals/lynx-chunk-entries/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/entry/index.js:
--------------------------------------------------------------------------------
1 | ///
2 |
3 | expect(globDynamicComponentEntry).toBe('__FOO__');
4 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/start-invalid-entry-point/package.json:
--------------------------------------------------------------------------------
1 | {
2 | "name": "local-rspeedy-test",
3 | "dependencies": {
4 | "@lynx-js/rspeedy": "*"
5 | }
6 | }
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/custom-cts.config.ts:
--------------------------------------------------------------------------------
1 | // eslint-disable-next-line import/no-commonjs
2 | module.exports = {
3 | source: { entry: 'custom-cts' },
4 | }
5 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-css-asset-in-css/index.css:
--------------------------------------------------------------------------------
1 | .bg {
2 | background-image: url("../../../resources/lynx-logo.jpeg");
3 | background-size: contain;
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/README.md:
--------------------------------------------------------------------------------
1 | @lynx-js/chunk-loading-webpack-plugin
2 |
3 | A webpack plugin to generate chunk loading runtime for Lynx.
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/dev/index.jsx:
--------------------------------------------------------------------------------
1 | it('__DEV__ should be false', () => {
2 | expect(__DEV__).toBe(false);
3 | expect(__PROFILE__).toBe(false);
4 | });
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/utf-8/index.jsx:
--------------------------------------------------------------------------------
1 | import { Text } from '@lynx-js/react-components'
2 |
3 | function App() {
4 | return 你好，世界
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/jsx/_unknown-css-property/index.jsx:
--------------------------------------------------------------------------------
1 | function App() {
2 | return
3 | }
4 |
--------------------------------------------------------------------------------
/examples/tailwindcss/vitest.config.ts:
--------------------------------------------------------------------------------
1 | import { defineProject } from 'vitest/config';
2 |
3 | export default defineProject({
4 | test: {
5 | name: 'examples/tailwindcss',
6 | },
7 | });
8 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_js_only_class_method.js:
--------------------------------------------------------------------------------
1 | class Test {
2 | method() {}
3 | #privateMethod() {}
4 | }
5 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/NotoSansSC-Regular.woff2:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/NotoSansSC-Regular.woff2
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/src/.gitignore:
--------------------------------------------------------------------------------
1 | # TODO: remove these
2 | /loader.js
3 | /loader.js.map
4 | /rspack-loader.js
5 | /rspack-loader.js.map
6 | /util.js
7 | /util.js.map
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/asset-modules/expected/main.css:
--------------------------------------------------------------------------------
1 | body {
2 | background: red;
3 | background-image: url(https://example.com/static/react.svg);
4 | }
5 |
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/dev-true/index.jsx:
--------------------------------------------------------------------------------
1 | it('__DEV__ should be true', () => {
2 | expect(__DEV__).toBe(true);
3 | expect(__PROFILE__).toBe(true);
4 | });
5 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/README.md:
--------------------------------------------------------------------------------
1 | @lynx-js/runtime-wrapper-webpack-plugin
2 |
3 | Use runtime wrapper which allow JavaScript to be load by Lynx.
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/default-entry/index.js:
--------------------------------------------------------------------------------
1 | ///
2 |
3 | expect(globDynamicComponentEntry).toBe('__Card__');
4 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/variables/empty-entry/index.js:
--------------------------------------------------------------------------------
1 | ///
2 |
3 | expect(globDynamicComponentEntry).toBe('__Card__');
4 |
--------------------------------------------------------------------------------
/.gitattributes:
--------------------------------------------------------------------------------
1 | **/test/**/*.js linguist-detectable=false
2 | *.snap.txt text diff=markdown linguist-language=Markdown -linguist-documentation=false -linguist-detectable=false
3 | * text=auto eol=lf
4 |
--------------------------------------------------------------------------------
/.github/codeql-config.yml:
--------------------------------------------------------------------------------
1 | paths-ignore:
2 | - "**/diagnostic"
3 | - "**/hotCases"
4 | - "**/node_modules"
5 | - "packages/rspeedy/core/test/**"
6 | - "packages/webpack/test-tools/update.js"
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_add_component_element_embedded_compiler_only.js:
--------------------------------------------------------------------------------
1 | ;
2 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/template-common/src/assets/arrow.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/rspeedy/create-rspeedy/template-common/src/assets/arrow.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-element-x-input-placeholder-pseudo-element/index.css:
--------------------------------------------------------------------------------
1 | .target::placeholder {
2 | color: red;
3 | font-weight: bold;
4 | font-size: 20px;
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-at-import/b.css:
--------------------------------------------------------------------------------
1 | @import "./base.css";
2 | @import "./ba.css";
3 | @import "./bb.css";
4 |
5 | body {
6 | background: yellow;
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/recursive/bar.js:
--------------------------------------------------------------------------------
1 | export async function bar() {
2 | const { baz } = await import('./baz.js');
3 | return '**bar**' + baz();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/with-static/bar.js:
--------------------------------------------------------------------------------
1 | export async function bar() {
2 | const { baz } = await import('./baz.js');
3 | return '**bar**' + baz();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/test/cases/runtime-globals/lynx-chunk-entries-production/rspack.config.js:
--------------------------------------------------------------------------------
1 | import config from './webpack.config.js';
2 |
3 | export default config;
4 |
--------------------------------------------------------------------------------
/website/.gitignore:
--------------------------------------------------------------------------------
1 | # auto-generated docs
2 | docs/en/api
3 | docs/zh/api
4 | docs/en/changelog
5 | docs/zh/changelog
6 |
7 | # api-extractor
8 | temp
9 |
10 | # rspress
11 | doc_build
12 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_js_only_class_property.js:
--------------------------------------------------------------------------------
1 | class Test {
2 | method = ()=>{};
3 | #privateMethod = ()=>{};
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_remove_test.js:
--------------------------------------------------------------------------------
1 | export class A extends Component {
2 | render() {
3 | return ;
4 | }
5 | }
6 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_transform_fn_decl_js.js:
--------------------------------------------------------------------------------
1 | export default {
2 | _c: {
3 | x
4 | },
5 | _wkltId: "a123:test:1"
6 | };
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/build-cache/build-dependencies.js:
--------------------------------------------------------------------------------
1 | export default {
2 | performance: {
3 | buildCache: {
4 | buildDependencies: ['./foo.js'],
5 | },
6 | },
7 | }
8 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/template-common/src/assets/lynx-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/rspeedy/create-rspeedy/template-common/src/assets/lynx-logo.png
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/special-var-name/Behavior.jsx:
--------------------------------------------------------------------------------
1 | export default function Behavior() {
2 | return (
3 |
4 | Behavior
5 |
6 | )
7 | }
8 |
--------------------------------------------------------------------------------
/packages/web-platform/.nycrc.json:
--------------------------------------------------------------------------------
1 | {
2 | "all": true,
3 | "check-coverage": true,
4 | "extension": [".js", ".cjs", ".mjs", ".ts", ".tsx", ".jsx"],
5 | "temp-dir": "./web-tests/.nyc_output"
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/common/renameEvent.ts:
--------------------------------------------------------------------------------
1 | export const renameEvent: Record = {
2 | 'submit': 'confirm',
3 | 'blur': 'lynxblur',
4 | 'focus': 'lynxfocus',
5 | };
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/shell-project/web-elements.ts:
--------------------------------------------------------------------------------
1 | import '@lynx-js/web-elements-compat/LinearContainer';
2 | import '@lynx-js/web-elements/all';
3 | import '@lynx-js/web-elements/index.css';
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/asset-modules/rspack-expected/main.css:
--------------------------------------------------------------------------------
1 | body {
2 | background: red;
3 | background-image: url(https://example.com/static/react.svg);
4 | }
5 |
6 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr/b.css:
--------------------------------------------------------------------------------
1 | .b {
2 | background: red;
3 | }
4 |
5 | @import url("https://some/external/css");
6 |
7 | .b {
8 | color: yellow;
9 | }
10 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-production/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | expect(globDynamicComponentEntry).toBeUndefined();
3 | return 'baz';
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | return 'foo ' + await bar();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/background-only/bar.js:
--------------------------------------------------------------------------------
1 | export async function bar() {
2 | const { baz } = await import('./baz.js');
3 | return '**bar**' + baz();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/chunk-filename/bar.js:
--------------------------------------------------------------------------------
1 | export async function bar() {
2 | const { baz } = await import('./baz.js');
3 | return '**bar**' + baz();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/main-thread/code-splitting/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | return 'foo ' + await bar();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/testing-library/src/__tests__/lazy-bundle/LazyComponent.jsx:
--------------------------------------------------------------------------------
1 | export default function LazyComponent() {
2 | const content = `Hello from LazyComponent`;
3 | return {content};
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/transform/.gitignore:
--------------------------------------------------------------------------------
1 | /dist
2 | /*.node
3 |
4 | # auto-generated by napi-rs
5 | # Note that we are not ignoring index.d.ts since we want to build TypeScript without building Rust
6 | /index.cjs
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_remove_unused_indirect.js:
--------------------------------------------------------------------------------
1 | export class A extends Component {
2 | render() {
3 | return <>;
4 | }
5 | }
6 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_transform_ui_worklet_js.js:
--------------------------------------------------------------------------------
1 | let onTapLepus = {
2 | _c: {
3 | a
4 | },
5 | _wkltId: "a123:test:1"
6 | };
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/template-common/src/assets/react-logo.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/rspeedy/create-rspeedy/template-common/src/assets/react-logo.png
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/import.css:
--------------------------------------------------------------------------------
1 | @import;
2 | @import './test.css';
3 | @import '../test2.css';
4 | @import "printstyle.css";
5 | @import "@ies/ug-lynx-components/lib/styles.css";
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-style-transformer/index.d.ts:
--------------------------------------------------------------------------------
1 | export type WASMModule = typeof import('./standard.js');
2 | export declare let wasm: WASMModule;
3 | export declare function initWasm(): Promise;
4 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return import('./baz.js').then(({ baz }) => {
3 | return `bar ${baz()}`;
4 | });
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/async-chunk-name/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | return 'foo ' + await bar();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/main-thread/code-splitting/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return import('./baz.js').then(({ baz }) => {
3 | return `bar ${baz()}`;
4 | });
5 | }
6 |
--------------------------------------------------------------------------------
/.github/ISSUE_TEMPLATE/config.yml:
--------------------------------------------------------------------------------
1 | ---
2 | contact_links:
3 | - about: "Please raise issues about the site on its own repo."
4 | name: Website
5 | url: "https://github.com/lynx-family/lynx-website/issues"
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/websocket/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-css-compound-selector/index.css:
--------------------------------------------------------------------------------
1 | .wrapper view {
2 | border: 2px solid blue;
3 | }
4 |
5 | .a.b {
6 | background-color: red;
7 | border: 1px solid blue;
8 | }
9 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-lazy-bundle-production/baz.js:
--------------------------------------------------------------------------------
1 | export function baz() {
2 | expect(globDynamicComponentEntry).toBeUndefined();
3 | return 'baz';
4 | }
5 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/async-chunk-name/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return import('./baz.js').then(({ baz }) => {
3 | return `bar ${baz()}`;
4 | });
5 | }
6 |
--------------------------------------------------------------------------------
/.changeset/floppy-shrimps-own.md:
--------------------------------------------------------------------------------
1 | ---
2 | "@lynx-js/web-mainthread-apis": patch
3 | "@lynx-js/web-constants": patch
4 | "@lynx-js/web-worker-runtime": patch
5 | ---
6 |
7 | fix: globalThis is never accessible in MTS
8 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_remove_use_effect_param.js:
--------------------------------------------------------------------------------
1 | import { useEffect } from "@lynx-js/react-runtime";
2 | export function A() {
3 | useEffect();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_extract_ident_from_this_js.js:
--------------------------------------------------------------------------------
1 | let onTapLepus = {
2 | _wkltId: "a123:test:1",
3 | ...{
4 | a: this.a
5 | }
6 | };
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/cli/fixtures/register/with-query.ts:
--------------------------------------------------------------------------------
1 | import { foo } from './foo.ts?from=ts'
2 | import { foo as fooFromJS } from './foo.js?from=js'
3 |
4 | console.info(foo())
5 | console.info(fooFromJS())
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/enum.ts:
--------------------------------------------------------------------------------
1 | enum Foo {
2 | bar = 0,
3 | baz = 1,
4 | }
5 |
6 | export default {
7 | source: { define: { bar: Foo.bar, baz: Foo.baz }, entry: 'custom-enum' },
8 | }
9 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-qrcode/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/resources/ddee519472dd7e73eeb153e78d484db3.mp3:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/resources/ddee519472dd7e73eeb153e78d484db3.mp3
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements/x-audio-tt/source-detail.mp3:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements/x-audio-tt/source-detail.mp3
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements/x-audio-tt/source-horse.mp3:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements/x-audio-tt/source-horse.mp3
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-with-source-map/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | return 'foo ' + await bar();
4 | }
5 |
--------------------------------------------------------------------------------
/packages/react/runtime/.npmignore:
--------------------------------------------------------------------------------
1 | *
2 | !compat/*
3 | !compat/**
4 | !debug/*
5 | !debug/**
6 | !jsx-dev-runtime/*
7 | !jsx-runtime/*
8 | !lazy/*
9 | !lazy/**
10 | !lepus/**
11 | !lepus/*
12 | !lib/**
13 | !lib/*
14 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_not_replace_to_lit_when_resolved.js:
--------------------------------------------------------------------------------
1 | {
2 | let __LEPUS__ = 1;
3 | let __JS__ = 2;
4 | let a = (__LEPUS__, __JS__);
5 | }
6 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/cjs/esm-import-esm.js:
--------------------------------------------------------------------------------
1 | import { pluginFoo } from 'esm-pkg'
2 |
3 | export default {
4 | source: {
5 | entry: 'esm-import-esm',
6 | },
7 | plugins: [pluginFoo()],
8 | }
9 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react-alias/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/README.md:
--------------------------------------------------------------------------------
1 | @lynx-js/css-extract-webpack-plugin
2 |
3 | This plugin extracts CSS into separate files. It creates a CSS file per JS file which contains CSS.
4 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/hmr/c.css:
--------------------------------------------------------------------------------
1 | .c {
2 | background: red;
3 | }
4 | @import "./a.css";
5 | @import url("https://some/other/external/css");
6 |
7 | .c {
8 | color: yellow;
9 | }
10 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-with-source-map/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return import('./baz.js').then(({ baz }) => {
3 | return `bar ${baz()}`;
4 | });
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/all-in-one/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-runner").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'b/b.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/page-config/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-runner").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'b/b.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_not_rename_view_in_scope.js:
--------------------------------------------------------------------------------
1 | {
2 | const View = "view";
3 | const a = ;
4 | }{
5 | const a = ;
6 | }const a = ;
7 |
--------------------------------------------------------------------------------
/packages/rspeedy/create-rspeedy/template-common/gitignore:
--------------------------------------------------------------------------------
1 | # Local
2 | .DS_Store
3 | *.local
4 | *.log*
5 |
6 | # Dist
7 | node_modules
8 | dist/
9 |
10 | # IDE
11 | .vscode/*
12 | !.vscode/extensions.json
13 | .idea
14 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react/test/fixtures/standalone-lazy-bundle/index.tsx:
--------------------------------------------------------------------------------
1 | export default function LazyBundleComp() {
2 | return (
3 |
4 | Hello from lazy bundle!
5 |
6 | )
7 | }
8 |
--------------------------------------------------------------------------------
/packages/web-platform/web-elements/src/XRefreshView/index.ts:
--------------------------------------------------------------------------------
1 | export { XRefreshFooter } from './XRefreshFooter.js';
2 | export { XRefreshHeader } from './XRefreshHeader.js';
3 | export { XRefreshView } from './XRefreshView.js';
4 |
--------------------------------------------------------------------------------
/packages/web-platform/web-rsbuild-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-element-image-placeholder/lynx.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react/basic-element-image-placeholder/lynx.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-element-text-color/index.css:
--------------------------------------------------------------------------------
1 | .a {
2 | font-size: 16px;
3 | color: red;
4 | }
5 |
6 | .b {
7 | font-size: 80px;
8 | color: linear-gradient(green, yellow);
9 | }
10 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-element-x-refresh-view-demo/img.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react/basic-element-x-refresh-view-demo/img.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/runtime/hotModuleReplacement.d.cts:
--------------------------------------------------------------------------------
1 | declare function update(
2 | moduleId: string | number,
3 | options: unknown,
4 | cssId?: number,
5 | ): () => void;
6 |
7 | export = update;
8 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/default-export/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-runner").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'b/b.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/web/element-template/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-runner").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'b/b.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/webpack-runtime-globals/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/website/theme/rsbuild-env.d.ts:
--------------------------------------------------------------------------------
1 | // Copyright 2024 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 |
--------------------------------------------------------------------------------
/packages/background-only/empty.js:
--------------------------------------------------------------------------------
1 | // Copyright 2024 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/break-rule.css:
--------------------------------------------------------------------------------
1 | .test {
2 | display: flex;
3 | height;
4 | left: 10px;
5 | padding
6 | }
7 |
8 | .test-1 {
9 | display: flex;
10 | height:
11 | }
12 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-css-var/index.css:
--------------------------------------------------------------------------------
1 | #target {
2 | width: 100px;
3 | height: 100px;
4 | --nested-bg-color: pink;
5 | --bg-color: var(--nested-bg-color);
6 | background: var(--bg-color);
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/chunk-loading-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/modules/named-export/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/assets/production/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-runner").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'template.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_define_dce/mod.rs/should_not_eval_bad_case_modifying.js:
--------------------------------------------------------------------------------
1 | const a = [];
2 | a.push(1);
3 | if (a.length) {
4 | console.log("a");
5 | } else {
6 | console.log("b");
7 | }
8 |
--------------------------------------------------------------------------------
/packages/rspeedy/plugin-react-alias/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": ["./tsconfig.build.json"],
3 | "compilerOptions": {
4 | "rootDir": ".",
5 | "noEmit": true,
6 | },
7 | "include": ["src", "test", "vitest.config.ts"],
8 | }
9 |
--------------------------------------------------------------------------------
/packages/web-platform/web-rsbuild-plugin/rslib.config.ts:
--------------------------------------------------------------------------------
1 | import { defineConfig } from '@rslib/core';
2 |
3 | export default defineConfig({
4 | lib: [
5 | { format: 'esm', syntax: 'es2022', dts: { bundle: true } },
6 | ],
7 | });
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/modules/css-id-named-export/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/modules/export-only-locals/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/modules/named-export-as-is/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/vitest.config.ts:
--------------------------------------------------------------------------------
1 | import { defineConfig } from 'vitest/config';
2 |
3 | export default defineConfig({
4 | test: {
5 | include: ['**/test/*.spec.ts'],
6 | name: 'tools/css-serializer',
7 | },
8 | });
9 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import/a.css:
--------------------------------------------------------------------------------
1 | @import "./ae.css";
2 | @import "./aa.css";
3 | @import "./ab.css";
4 | @import "./ac.css";
5 | @import "./ad.css";
6 |
7 | body {
8 | background: red;
9 | }
10 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/main.css:
--------------------------------------------------------------------------------
1 | @font-face {
2 | font-family: Roboto-plp;
3 | font-style: normal;
4 | font-weight: 400;
5 | src: url("./fonts/roboto-v18-latin-300.ttf") format("truetype");
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-asset-modules/expected/main.css:
--------------------------------------------------------------------------------
1 | @cssId "1000" "style.css" {
2 | body {
3 | background: red;
4 | background-image: url(https://example.com/static/react.svg);
5 | }
6 |
7 | }
8 |
9 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/modules/css-id-export-only-locals/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/side-effects/css-id-side-effects/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/enum/tree-shake/e.ts:
--------------------------------------------------------------------------------
1 | export const enum ConstEnum {
2 | Foo = 'Foo',
3 | }
4 |
5 | export enum Enum {
6 | Bar = 'Bar',
7 | }
8 |
9 | export function fn() {
10 | return 42;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/react-runtime/expected/webpack.txt:
--------------------------------------------------------------------------------
1 | WARNING in ./compat/react-runtime/index.jsx
2 | Module Warning (from ../../lib/loaders/background.js):
3 | DEPRECATED: lynx-key is changed to key
4 |
--------------------------------------------------------------------------------
/packages/webpack/webpack-runtime-globals/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": ["./tsconfig.build.json"],
3 | "compilerOptions": {
4 | "rootDir": ".",
5 | "noEmit": true,
6 | },
7 | "include": ["src", "test", "vitest.config.ts"],
8 | }
9 |
--------------------------------------------------------------------------------
/examples/tailwindcss/src/utils.ts:
--------------------------------------------------------------------------------
1 | import { clsx } from 'clsx';
2 | import type { ClassValue } from 'clsx';
3 | import { twMerge } from 'tailwind-merge';
4 |
5 | export function cn(...inputs: ClassValue[]) {
6 | return twMerge(clsx(inputs));
7 | }
8 |
--------------------------------------------------------------------------------
/packages/background-only/index.d.ts:
--------------------------------------------------------------------------------
1 | // Copyright 2024 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 | export {};
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_not_remove_in_scope_id.js:
--------------------------------------------------------------------------------
1 | import { useEffect } from '@lynx-js/react-runtime';
2 | {
3 | const useEffect = ()=>{};
4 | useEffect(()=>{});
5 | }useEffect();
6 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_not_transform_constructor.js:
--------------------------------------------------------------------------------
1 | let a = 1;
2 | class App extends Component {
3 | constructor(){
4 | "main thread";
5 | return a;
6 | }
7 | }
8 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/utf8/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import-in-the-entry/expected/main.css:
--------------------------------------------------------------------------------
1 | @import url(https://fonts.googleapis.com/css2?family=Manrope:wght@500;800&display=swap);
2 | body {
3 | font-family: "Manrope";
4 | }
5 |
6 |
7 |
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/fonts/roboto-v18-latin-300.ttf:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/fonts/roboto-v18-latin-300.ttf
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/hotCases/hot-update-json/chunk-splitting/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'index.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/hotCases/hot-update-json/nested/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'rspack-bundle.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/eval-result/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/inline-scripts/inline-partial/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'rspack.bundle.js',
5 | ],
6 | };
7 |
--------------------------------------------------------------------------------
/.changeset/modern-bags-wait.md:
--------------------------------------------------------------------------------
1 | ---
2 | "@lynx-js/react": patch
3 | ---
4 |
5 | Fix wrong render result when using expression as `key`.
6 |
7 | See [lynx-family/lynx-stack#1371](https://github.com/lynx-family/lynx-stack/issues/1371) for more details.
8 |
--------------------------------------------------------------------------------
/examples/tailwindcss/src/index.tsx:
--------------------------------------------------------------------------------
1 | import { root } from '@lynx-js/react';
2 |
3 | import { App } from './App.js';
4 |
5 | root.render(
6 | ,
7 | );
8 |
9 | if (import.meta.webpackHot) {
10 | import.meta.webpackHot.accept();
11 | }
12 |
--------------------------------------------------------------------------------
/packages/react/runtime/debug/index.d.ts:
--------------------------------------------------------------------------------
1 | // Copyright 2025 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 | export {};
5 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/url-contain-identifier.css:
--------------------------------------------------------------------------------
1 | .backtop-btn {
2 | background-image: url(~/resource/back_top_btn.png);
3 | height: url(./resource/back_top_btn.png);
4 | width: url(/resource/back_top_btn.png);
5 | }
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-constants/src/types/FlushElementTreeOptions.ts:
--------------------------------------------------------------------------------
1 | import type { PerformancePipelineOptions } from './Performance.js';
2 |
3 | export interface FlushElementTreeOptions {
4 | pipelineOptions?: PerformancePipelineOptions;
5 | }
6 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/at-import-in-the-entry/rspack-expected/main.css:
--------------------------------------------------------------------------------
1 | @import url(https://fonts.googleapis.com/css2?family=Manrope:wght@500;800&display=swap);
2 | body {
3 | font-family: "Manrope";
4 | }
5 |
6 |
7 |
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/main.css:
--------------------------------------------------------------------------------
1 | @font-face {
2 | font-family: Roboto-plp;
3 | font-style: normal;
4 | font-weight: 400;
5 | src: url("./fonts/roboto-v18-latin-300.ttf") format("truetype");
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/css-id-asset-modules/rspack-expected/main.css:
--------------------------------------------------------------------------------
1 | @cssId "1000" "style.css" {
2 | body {
3 | background: red;
4 | background-image: url(https://example.com/static/react.svg);
5 | }
6 |
7 | }
8 |
9 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/fixtures/side-effects/css-id-side-effects-common/style.css:
--------------------------------------------------------------------------------
1 | .a-class {
2 | background: red;
3 | }
4 |
5 | .b__class {
6 | color: green;
7 | }
8 |
9 | .cClass {
10 | color: blue;
11 | }
12 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/with-static/foo.js:
--------------------------------------------------------------------------------
1 | import { baz } from './baz.js';
2 |
3 | export async function foo() {
4 | const { bar } = await import('./bar.js');
5 | return '**foo**' + await bar() + baz();
6 | }
7 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/diagnostic/compat/lynx-key/index.jsx:
--------------------------------------------------------------------------------
1 | import { Component } from '@lynx-js/react-runtime'
2 |
3 | export class App extends Component {
4 | render() {
5 | return
6 | }
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/runtime-wrapper-webpack-plugin/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": ["./tsconfig.build.json"],
3 | "compilerOptions": {
4 | "rootDir": ".",
5 | "noEmit": true,
6 | },
7 | "include": ["src", "test", "vitest.config.ts"],
8 | }
9 |
--------------------------------------------------------------------------------
/packages/webpack/template-webpack-plugin/test/cases/code-splitting/duplicated-async-chunk/shared/bar.js:
--------------------------------------------------------------------------------
1 | export function bar() {
2 | return import(
3 | /* webpackChunkName: "baz" */
4 | './baz.js'
5 | ).then(({ baz }) => 'bar ' + baz());
6 | }
7 |
--------------------------------------------------------------------------------
/packages/react/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../api-extractor.json",
6 | "mainEntryPointFilePath": "./types/react.docs.d.ts",
7 | }
8 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_handle_recursive.js:
--------------------------------------------------------------------------------
1 | const a =
2 |
3 |
4 | ;
5 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_directive_dce/mod.rs/should_eliminate_js_only_but_keep_constructor.js:
--------------------------------------------------------------------------------
1 | class Test {
2 | constructor(props = function() {}){
3 | 'use js only';
4 | super(props);
5 | }
6 | }
7 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_shake/mod.rs/should_keep_state_and_remove_other.js:
--------------------------------------------------------------------------------
1 | export class A extends Component {
2 | state = {
3 | a: 1
4 | };
5 | render() {
6 | return <>;
7 | }
8 | }
9 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/hex-color/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/svg/with-css/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/baseline/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxline/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/blur/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/type/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react/basic-element-x-swiper-swiper-dynamic/getColor.js:
--------------------------------------------------------------------------------
1 | export function getColor(num) {
2 | if (num % 2 === 0) {
3 | return 'rgba(50, 50, 255, 1)';
4 | } else {
5 | return 'rgba(255, 50, 50, 1)';
6 | }
7 | }
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/recursive/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | const { baz } = await import('./baz.js');
4 | return '**foo**' + await bar() + baz();
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/typescript/type-import/e.ts:
--------------------------------------------------------------------------------
1 | // This will **NOT** be removed
2 | import {} from './bar.js';
3 |
4 | import type { Foo } from './foo.js';
5 | import type {} from './foo.js';
6 |
7 | export const a: Foo = {};
8 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_transform_js_general.js:
--------------------------------------------------------------------------------
1 | let worklet = {
2 | _c: {
3 | y1
4 | },
5 | _wkltId: "a77b:test:1",
6 | ...{
7 | y1: this.y1
8 | }
9 | };
10 |
--------------------------------------------------------------------------------
/packages/tools/css-serializer/test/__preparation__/no-space-within-name-value.css:
--------------------------------------------------------------------------------
1 | .test {
2 | border-left-style:dashed double;
3 | border-top-style:dotted solid ridge groove;
4 | border-color:red blue blue red;
5 | border-top-width:0.5px;
6 | }
7 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/auto-size/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/maxlength/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-image/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-text/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/nest-view/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/word-break/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/1-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/2-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/scroll-to/3-chromium-linux.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/expected/index.css:
--------------------------------------------------------------------------------
1 | @font-face {
2 | font-family: Roboto-plp;
3 | font-style: normal;
4 | font-weight: 400;
5 | src: url(/assets/asset/roboto-v18-latin-300.ttf) format("truetype");
6 | }
7 |
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/background-only/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | const { baz } = await import('./baz.js');
4 | return '**foo**' + await bar() + baz();
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/chunk-filename/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | const { bar } = await import('./bar.js');
3 | const { baz } = await import('./baz.js');
4 | return '**foo**' + await bar() + baz();
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/default/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/dev/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/profile/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/enum/basic/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/source-map/jsx/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/source-map/tsx/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/react/runtime/debug/index.js:
--------------------------------------------------------------------------------
1 | // Copyright 2025 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 |
5 | import './index.cjs';
6 |
--------------------------------------------------------------------------------
/packages/react/transform/__test__/css/__snapshots__/transform-imports-defaults.js:
--------------------------------------------------------------------------------
1 | import './foo.css';
2 | import bar from './bar.css';
3 | import * as styles from './baz.scss';
4 | import { styles0, styles1 } from './foo.modules.css';
5 | bar, styles, styles0, styles1;
6 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat/mod.rs/should_simplify_ctor.js:
--------------------------------------------------------------------------------
1 | class A extends Component {
2 | render() {
3 | return ;
4 | }
5 | state = {
6 | d: 1,
7 | a: 1
8 | };
9 | }
10 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_compat_post/mod.rs/should_compat_dark_mode.js:
--------------------------------------------------------------------------------
1 | import { __SetClassesDarkMode as __SetClasses } from "@lynx-js/react/src/compat/darkMode";
2 | lynx.__globalProps.theme.toString();
3 | __SetClasses(a, b);
4 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_extract_idents_outside_of_ctx.js:
--------------------------------------------------------------------------------
1 | let onTapLepus = {
2 | _c: {
3 | a,
4 | m,
5 | b,
6 | c
7 | },
8 | _wkltId: "a123:test:1"
9 | };
10 |
--------------------------------------------------------------------------------
/packages/react/transform/tests/__swc_snapshots__/src/swc_plugin_worklet/mod.rs/should_not_extract_ident_from_this.js:
--------------------------------------------------------------------------------
1 | let onTapLepus = {
2 | _c: {
3 | x
4 | },
5 | _wkltId: "a123:test:1",
6 | ...{
7 | y: this.y
8 | }
9 | };
10 |
--------------------------------------------------------------------------------
/packages/rspeedy/core/test/config/fixtures/custom/const-enum.ts:
--------------------------------------------------------------------------------
1 | const enum Foo {
2 | bar = 0,
3 | baz = 1,
4 | }
5 |
6 | export default {
7 | source: {
8 | define: { bar: Foo.bar, baz: Foo.baz },
9 | entry: 'custom-const-enum',
10 | },
11 | }
12 |
--------------------------------------------------------------------------------
/packages/web-platform/web-rsbuild-plugin/tests/__snapshots__/config.test.ts.snap:
--------------------------------------------------------------------------------
1 | // Vitest Snapshot v1, https://vitest.dev/guide/snapshot.html
2 |
3 | exports[`Config > basic config 1`] = `
4 | [
5 | /node_modules\\[\\\\\\\\/\\]@lynx-js\\[\\\\\\\\/\\]/,
6 | ]
7 | `;
8 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/basic-flex-1/index/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/placeholder/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/display-none/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-overlay-ng/demo/inital-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-0/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-1/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-2/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-3/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/current-4/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-1/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-1/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-2/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-2/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-3/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-3/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/fonts/roboto-v18-latin-300.ttf:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri-in-entry/fonts/roboto-v18-latin-300.ttf
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/expected/asset/roboto-v18-latin-300.ttf:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/expected/asset/roboto-v18-latin-300.ttf
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/cases/base-uri/rspack-expected/index.css:
--------------------------------------------------------------------------------
1 | @font-face {
2 | font-family: Roboto-plp;
3 | font-style: normal;
4 | font-weight: 400;
5 | src: url(/assets/asset/roboto-v18-latin-300.ttf) format("truetype");
6 | }
7 |
8 |
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/hotCases/css/basic/__snapshot__/webpack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case basic - webpack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/basic/__snapshot__/rspack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case basic - rspack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: rspack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/value/__snapshot__/rspack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case value - rspack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: rspack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/hello-world/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/lazy-imports/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/public-path/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/code-splitting/amd-runtime-production/foo.js:
--------------------------------------------------------------------------------
1 | export async function foo() {
2 | expect(globDynamicComponentEntry).toBeUndefined();
3 | const { bar } = await import('./bar.js');
4 | return 'foo ' + await bar();
5 | }
6 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/compat/component-is/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/compat/run-in-js/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define-dce/basic/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/dev-true/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/define/extract-str/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/directive-dce/basic/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/enum/tree-shake/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/main-thread/entry/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------
/packages/webpack/webpack-dev-transport/api-extractor.json:
--------------------------------------------------------------------------------
1 | /**
2 | * Config file for API Extractor. For more info, please visit: https://api-extractor.com
3 | */
4 | {
5 | "extends": "../../../api-extractor.json",
6 | "mainEntryPointFilePath": "index.d.ts",
7 | }
8 |
--------------------------------------------------------------------------------
/packages/react/worklet-runtime/src/types/dev.d.ts:
--------------------------------------------------------------------------------
1 | // Copyright 2024 The Lynx Authors. All rights reserved.
2 | // Licensed under the Apache License Version 2.0 that can be found in the
3 | // LICENSE file in the root directory of this source tree.
4 | declare let __DEV__;
5 |
--------------------------------------------------------------------------------
/packages/third-party/tailwind-preset/tsconfig.json:
--------------------------------------------------------------------------------
1 | {
2 | "extends": ["./tsconfig.build.json"],
3 | "compilerOptions": {
4 | "rootDir": ".",
5 | "noEmit": true,
6 | },
7 | "include": ["src", "test", "vitest.config.ts"],
8 | "references": [],
9 | }
10 |
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/animate/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/api-animate/initial/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/image/border-radius/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/raw-text-new-line/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/text/raw-text-new-line/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-input/placeholder/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-10/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-15/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-20/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/autoplay-5/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-1-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-1-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-1-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-1-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-2-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-2-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-2-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-2-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-3-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-3-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-3-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-3-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-4-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-4-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-4-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/duration/current-4-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-1/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-1/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-2/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-2/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-3/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/interval-3/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carousel/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carousel/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-carry/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/mode-normal/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/page-margin/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/page-margin/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/page-margin/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/react.spec.ts-snapshots/x-swiper/page-margin/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-image/basic/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/axis-gap/index-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/axis-gap/index-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/basic/initial-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/basic/initial-firefox-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/basic/initial-webkit-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/basic/initial-webkit-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-chromium-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-chromium-linux.png
--------------------------------------------------------------------------------
/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-firefox-linux.png:
--------------------------------------------------------------------------------
https://raw.githubusercontent.com/rahul-vashishtha/lynx-stack/HEAD/packages/web-platform/web-tests/tests/web-elements.spec.ts-snapshots/x-list/sticky/index-firefox-linux.png
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/hotCases/css/scoped/__snapshot__/webpack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case scoped - webpack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/css-extract-webpack-plugin/test/hotCases/modules/basic/__snapshot__/webpack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case basic - webpack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/basic/__snapshot__/webpack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case basic - webpack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/basic/__snapshot__/webpack/1.snap.txt:
--------------------------------------------------------------------------------
1 | # Case basic - webpack: Step 1
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/recovery/__snapshot__/rspack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case recovery - rspack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: rspack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/value/__snapshot__/webpack/0.snap.txt:
--------------------------------------------------------------------------------
1 | # Case value - webpack: Step 0
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-refresh-webpack-plugin/test/hotCases/jsx/value/__snapshot__/webpack/1.snap.txt:
--------------------------------------------------------------------------------
1 | # Case value - webpack: Step 1
2 |
3 | ## Changed Files
4 |
5 |
6 | ## Asset Files
7 | - Bundle: webpack-bundle.js
8 |
9 | ## Manifest
10 |
11 |
12 | ## Update
--------------------------------------------------------------------------------
/packages/webpack/react-webpack-plugin/test/cases/basic/bundle-splitting/test.config.cjs:
--------------------------------------------------------------------------------
1 | /** @type {import("@lynx-js/test-tools").TConfigCaseConfig} */
2 | module.exports = {
3 | bundlePath: [
4 | 'main__main-thread.js',
5 | 'main__background.js',
6 | ],
7 | };
8 |
--------------------------------------------------------------------------------